Datasets:
JoaoJunior
/
python_java_dataset_APR

Dataset card Data Studio Files Community
rem
stringlengths
1
226k
add
stringlengths
0
227k
context
stringlengths
6
326k
meta
stringlengths
143
403
input_ids
sequencelengths
256
256
attention_mask
sequencelengths
256
256
labels
sequencelengths
128
128
if condition:
if condition:
def selectPilots(self,condDict, older=None, newer=None, timeStamp='CreationDate', orderAttribute=None, limit=None): """ Select pilot references according to the provided criteria. "newer" and "older" specify the time interval in minutes """
4281b6ebd17e9e6456de007d4a03f9fe1ab6a236 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/12864/4281b6ebd17e9e6456de007d4a03f9fe1ab6a236/PilotAgentsDB.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2027, 52, 330, 6968, 12, 2890, 16, 10013, 5014, 16, 12156, 33, 7036, 16, 16069, 33, 7036, 16, 18198, 2218, 9906, 1626, 2187, 1353, 1499, 33, 7036, 16, 1800, 33, 7036, 4672, 3536, 6766, 293, 22797, 5351, 4888, 358, 326, 2112, 3582, 18, 315, 2704, 264, 6, 471, 315, 1498, 6, 4800, 326, 813, 3673, 316, 6824, 3536, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2027, 52, 330, 6968, 12, 2890, 16, 10013, 5014, 16, 12156, 33, 7036, 16, 16069, 33, 7036, 16, 18198, 2218, 9906, 1626, 2187, 1353, 1499, 33, 7036, 16, 1800, 33, 7036, 4672, 3536, 6766, 293, 22797, 5351, 4888, 358, 326, 2112, 3582, 18, 315, 2704, 264, 6, 471, 315, 1498, 6, 4800, 326, 813, 3673, 316, 6824, 3536, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
def name(self, new=''):
def name(self, new=None):
def name(self, new=''): """ Returns the name of the (di)graph. INPUT: new -- if not None, then this becomes the new name of the (di)graph. set_to_none -- if True, removes any name EXAMPLE: sage: d = {0: [1,4,5], 1: [2,6], 2: [3,7], 3: [4,8], 4: [9], 5: [7, 8], 6: [8,9], 7: [9]} sage: G = Graph(d); G Graph on 10 vertices sage: G.name("Petersen Graph"); G 'Petersen Graph' Petersen Graph: Graph on 10 vertices sage: G.name(""); G Graph on 10 vertices
3f700878d8373eecd5c46e21e9080f2b46363947 /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/9890/3f700878d8373eecd5c46e21e9080f2b46363947/graph.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 508, 12, 2890, 16, 394, 33, 7036, 4672, 3536, 2860, 326, 508, 434, 326, 261, 3211, 13, 4660, 18, 225, 12943, 30, 394, 1493, 309, 486, 599, 16, 1508, 333, 12724, 326, 394, 508, 434, 326, 261, 3211, 13, 4660, 18, 444, 67, 869, 67, 6102, 1493, 309, 1053, 16, 7157, 1281, 508, 225, 5675, 21373, 30, 272, 410, 30, 302, 273, 288, 20, 30, 306, 21, 16, 24, 16, 25, 6487, 404, 30, 306, 22, 16, 26, 6487, 576, 30, 306, 23, 16, 27, 6487, 890, 30, 306, 24, 16, 28, 6487, 1059, 30, 306, 29, 6487, 1381, 30, 306, 27, 16, 1725, 6487, 1666, 30, 306, 28, 16, 29, 6487, 2371, 30, 306, 29, 18322, 272, 410, 30, 611, 273, 5601, 12, 72, 1769, 611, 5601, 603, 1728, 6928, 272, 410, 30, 611, 18, 529, 2932, 52, 1032, 275, 5601, 8863, 611, 296, 52, 1032, 275, 5601, 11, 453, 1032, 275, 5601, 30, 5601, 603, 1728, 6928, 272, 410, 30, 611, 18, 529, 2932, 8863, 611, 5601, 603, 1728, 6928, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 508, 12, 2890, 16, 394, 33, 7036, 4672, 3536, 2860, 326, 508, 434, 326, 261, 3211, 13, 4660, 18, 225, 12943, 30, 394, 1493, 309, 486, 599, 16, 1508, 333, 12724, 326, 394, 508, 434, 326, 261, 3211, 13, 4660, 18, 444, 67, 869, 67, 6102, 1493, 309, 1053, 16, 7157, 1281, 508, 225, 5675, 21373, 30, 272, 410, 30, 302, 273, 288, 20, 30, 306, 21, 16, 24, 16, 25, 6487, 404, 30, 306, 22, 16, 26, 6487, 576, 30, 306, 23, 16, 27, 6487, 890, 30, 306, 24, 16, 28, 6487, 1059, 30, 306, 29, 6487, 1381, 30, 306, 27, 16, 1725, 6487, 1666, 30, 306, 28, 16, 29, 6487, 2371, 30, 306, 29, 18322, 272, 2 ]
if not page.has_key('saved'):
if checkAccess and not can_be_read(name):
def can_be_read(name): return request.user.may.read(name)
54c491e676ba258f38c8d4b9a23f42b50e62d4e5 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/888/54c491e676ba258f38c8d4b9a23f42b50e62d4e5/editing.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 848, 67, 2196, 67, 896, 12, 529, 4672, 327, 590, 18, 1355, 18, 24877, 18, 896, 12, 529, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 848, 67, 2196, 67, 896, 12, 529, 4672, 327, 590, 18, 1355, 18, 24877, 18, 896, 12, 529, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
log("Warning: Value of property \"length\" must be greater than 0 (setting to 1)")
log(_("Warning: Value of property \"length\" must be greater than 0 (setting to 1)"))
def __setattr__(self, name, value):
f7391a9446de756cb42910377e3e520b76672941 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/5768/f7391a9446de756cb42910377e3e520b76672941/ControlWrapper.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 542, 1747, 972, 12, 2890, 16, 508, 16, 460, 4672, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 542, 1747, 972, 12, 2890, 16, 508, 16, 460, 4672, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
'''
"""
def HyperStarGraph(self,n,k): r''' Returns the hyper-star graph HS(n,k). The vertices of the hyper-star graph are the set of binary strings of length n which contain k 1s. Two vertices, u and v, are adjacent only if u can be obtained from v by swapping the first bit with a different symbol in another position. INPUT:: - ``n`` - ``k`` EXAMPLES:: sage: g = graphs.HyperStarGraph(6,3) sage: g.plot() # long time REFERENCES: - Lee, Hyeong-Ok, Jong-Seok Kim, Eunseuk Oh, and Hyeong-Seok Lim. "Hyper-Star Graph: A New Interconnection Network Improving the Network Cost of the Hypercube." In Proceedings of the First EurAsian Conference on Information and Communication Technology, 858-865. Springer-Verlag, 2002. AUTHORS: - Michael Yurko (2009-09-01)
e57a7b736852231f13d906c838b0d978d747387f /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/9890/e57a7b736852231f13d906c838b0d978d747387f/graph_generators.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 18274, 18379, 4137, 12, 2890, 16, 82, 16, 79, 4672, 436, 26418, 2860, 326, 9512, 17, 10983, 2667, 670, 55, 12, 82, 16, 79, 2934, 225, 1021, 6928, 434, 326, 9512, 17, 10983, 2667, 854, 326, 444, 434, 3112, 2064, 434, 769, 290, 1492, 912, 417, 404, 87, 18, 16896, 6928, 16, 582, 471, 331, 16, 854, 16335, 1338, 309, 582, 848, 506, 12700, 628, 331, 635, 7720, 1382, 326, 1122, 2831, 598, 279, 3775, 3273, 316, 4042, 1754, 18, 225, 12943, 2866, 225, 300, 225, 12176, 82, 10335, 225, 300, 225, 12176, 79, 10335, 225, 5675, 8900, 11386, 2866, 225, 272, 410, 30, 314, 273, 19422, 18, 15996, 18379, 4137, 12, 26, 16, 23, 13, 272, 410, 30, 314, 18, 4032, 1435, 468, 1525, 813, 225, 22898, 55, 30, 225, 300, 511, 1340, 16, 14881, 73, 932, 17, 8809, 16, 804, 932, 17, 1761, 601, 1475, 381, 16, 512, 318, 307, 19445, 531, 76, 16, 471, 14881, 73, 932, 17, 1761, 601, 511, 381, 18, 315, 15996, 17, 18379, 5601, 30, 432, 1166, 5294, 4071, 5128, 2221, 685, 6282, 326, 5128, 28108, 434, 326, 18274, 21186, 1199, 657, 1186, 5288, 899, 434, 326, 5783, 512, 295, 1463, 2779, 735, 1134, 603, 15353, 471, 31598, 30960, 4676, 16, 1725, 8204, 17, 5292, 25, 18, 348, 683, 6658, 17, 3945, 22532, 16, 4044, 22, 18, 225, 12790, 14006, 30, 225, 300, 490, 1354, 69, 292, 1624, 20628, 83, 261, 6976, 29, 17, 5908, 17, 1611, 13, 2, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 18274, 18379, 4137, 12, 2890, 16, 82, 16, 79, 4672, 436, 26418, 2860, 326, 9512, 17, 10983, 2667, 670, 55, 12, 82, 16, 79, 2934, 225, 1021, 6928, 434, 326, 9512, 17, 10983, 2667, 854, 326, 444, 434, 3112, 2064, 434, 769, 290, 1492, 912, 417, 404, 87, 18, 16896, 6928, 16, 582, 471, 331, 16, 854, 16335, 1338, 309, 582, 848, 506, 12700, 628, 331, 635, 7720, 1382, 326, 1122, 2831, 598, 279, 3775, 3273, 316, 4042, 1754, 18, 225, 12943, 2866, 225, 300, 225, 12176, 82, 10335, 225, 300, 225, 12176, 79, 10335, 225, 5675, 8900, 11386, 2866, 225, 272, 410, 30, 314, 273, 19422, 18, 15996, 18379, 4137, 12, 26, 16, 23, 13, 272, 410, 2 ]
(lineIsFull, line, cursor, currentLength, usedIndent, maxLength, justStrings) = self.fitLine(remainder, maxwidth)
(lineIsFull, line, cursor, currentLength, \ usedIndent, maxLength, justStrings) = self.fitLine(remainder, maxwidth)
def format(self, maxwidth, maxheight, program, leading=0): "return program with line operations added if at least one line fits" # note: a generated formatted segment should not be formatted again startstate = self.__dict__.copy() #remainder = self.cleanProgram(program) remainder = program[:] #program1 = remainder[:] # debug only lineprogram = [] from reportlab.lib.enums import TA_LEFT, TA_CENTER, TA_RIGHT, TA_JUSTIFY #if maxheight<TOOSMALLSPACE: # raise ValueError, "attempt to format inside too small a height! "+repr(maxheight) heightremaining = maxheight-leading room = 1 cursorcount = 0 # debug while remainder and room: #heightremaining>=self.leading and remainder: #print "getting line with statestack", len(self.textStateStack) #heightremaining = heightremaining - self.leading indent = self.indent rightIndent = self.rightIndent linewidth = maxwidth - indent - rightIndent beforelinestate = self.__dict__.copy() if linewidth<TOOSMALLSPACE: raise ValueError, "indents %s %s too wide for space %s" % (self.indent, self.rightIndent, maxwidth) try: (lineIsFull, line, cursor, currentLength, usedIndent, maxLength, justStrings) = self.fitLine(remainder, maxwidth) except:
a9fe2a25d7fcc8f510447cdecc4f6473c43d80f7 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/7053/a9fe2a25d7fcc8f510447cdecc4f6473c43d80f7/para.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 740, 12, 2890, 16, 943, 2819, 16, 943, 4210, 16, 5402, 16, 7676, 33, 20, 4672, 315, 2463, 5402, 598, 980, 5295, 3096, 309, 622, 4520, 1245, 980, 13351, 6, 468, 4721, 30, 279, 4374, 4955, 3267, 1410, 486, 506, 4955, 3382, 787, 2019, 273, 365, 16186, 1576, 25648, 3530, 1435, 468, 2764, 25407, 273, 365, 18, 6200, 9459, 12, 12890, 13, 10022, 273, 5402, 10531, 65, 468, 12890, 21, 273, 10022, 10531, 65, 468, 1198, 1338, 980, 12890, 273, 5378, 628, 2605, 7411, 18, 2941, 18, 7924, 87, 1930, 399, 37, 67, 10066, 16, 399, 37, 67, 19835, 16, 399, 37, 67, 11847, 16, 399, 37, 67, 46, 5996, 12096, 468, 430, 943, 4210, 32, 4296, 4618, 49, 1013, 3045, 4066, 1441, 30, 468, 565, 1002, 2068, 16, 315, 11764, 358, 740, 4832, 4885, 5264, 279, 2072, 5, 13773, 12715, 12, 1896, 4210, 13, 2072, 17956, 273, 943, 4210, 17, 27200, 7725, 273, 404, 3347, 1883, 273, 374, 468, 1198, 1323, 10022, 471, 7725, 30, 468, 4210, 17956, 34, 33, 2890, 18, 27200, 471, 10022, 30, 468, 1188, 315, 588, 1787, 980, 598, 610, 395, 484, 3113, 562, 12, 2890, 18, 955, 1119, 2624, 13, 468, 4210, 17956, 273, 2072, 17956, 300, 365, 18, 27200, 3504, 273, 365, 18, 9355, 2145, 7790, 273, 365, 18, 4083, 7790, 18795, 273, 943, 2819, 300, 3504, 300, 2145, 7790, 1865, 7511, 395, 340, 273, 365, 16186, 1576, 25648, 3530, 1435, 309, 18795, 32, 4296, 4618, 49, 1013, 3045, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 740, 12, 2890, 16, 943, 2819, 16, 943, 4210, 16, 5402, 16, 7676, 33, 20, 4672, 315, 2463, 5402, 598, 980, 5295, 3096, 309, 622, 4520, 1245, 980, 13351, 6, 468, 4721, 30, 279, 4374, 4955, 3267, 1410, 486, 506, 4955, 3382, 787, 2019, 273, 365, 16186, 1576, 25648, 3530, 1435, 468, 2764, 25407, 273, 365, 18, 6200, 9459, 12, 12890, 13, 10022, 273, 5402, 10531, 65, 468, 12890, 21, 273, 10022, 10531, 65, 468, 1198, 1338, 980, 12890, 273, 5378, 628, 2605, 7411, 18, 2941, 18, 7924, 87, 1930, 399, 37, 67, 10066, 16, 399, 37, 67, 19835, 16, 399, 37, 67, 11847, 16, 399, 37, 67, 46, 5996, 12096, 468, 430, 943, 4210, 32, 4296, 4618, 2 ]
except AttributeError:
except (AttributeError, io.UnsupportedOperation):
def __init__(self, buffer, encoding=None, newline=None): if newline not in (None, "\n", "\r\n"): raise ValueError("illegal newline value: %r" % (newline,)) if encoding is None: try: encoding = os.device_encoding(buffer.fileno()) except AttributeError: pass if encoding is None: try: import locale except ImportError: # Importing locale may fail if Python is being built encoding = "ascii" else: encoding = locale.getpreferredencoding()
c1420ab170a3fadc1fee550248464b7524722a9e /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/3187/c1420ab170a3fadc1fee550248464b7524722a9e/io.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 1613, 16, 2688, 33, 7036, 16, 9472, 33, 7036, 4672, 309, 9472, 486, 316, 261, 7036, 16, 1548, 82, 3113, 1548, 86, 64, 82, 6, 4672, 1002, 2068, 2932, 31751, 9472, 460, 30, 738, 86, 6, 738, 261, 22861, 16, 3719, 309, 2688, 353, 599, 30, 775, 30, 2688, 273, 1140, 18, 5964, 67, 5999, 12, 4106, 18, 7540, 5764, 10756, 1335, 261, 1499, 668, 16, 2527, 18, 8544, 2988, 4672, 1342, 309, 2688, 353, 599, 30, 775, 30, 1930, 2573, 1335, 11308, 30, 468, 6164, 310, 2573, 2026, 2321, 309, 6600, 353, 3832, 6650, 2688, 273, 315, 9184, 6, 469, 30, 2688, 273, 2573, 18, 588, 23616, 5999, 1435, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 1613, 16, 2688, 33, 7036, 16, 9472, 33, 7036, 4672, 309, 9472, 486, 316, 261, 7036, 16, 1548, 82, 3113, 1548, 86, 64, 82, 6, 4672, 1002, 2068, 2932, 31751, 9472, 460, 30, 738, 86, 6, 738, 261, 22861, 16, 3719, 309, 2688, 353, 599, 30, 775, 30, 2688, 273, 1140, 18, 5964, 67, 5999, 12, 4106, 18, 7540, 5764, 10756, 1335, 261, 1499, 668, 16, 2527, 18, 8544, 2988, 4672, 1342, 309, 2688, 353, 599, 30, 775, 30, 1930, 2573, 1335, 11308, 30, 468, 6164, 310, 2573, 2026, 2321, 309, 6600, 353, 3832, 6650, 2688, 273, 315, 9184, 6, 469, 30, 2688, 273, 2573, 18, 588, 23616, 5999, 1435, 2, -100, -100 ]
formatname = self.var_format_name.get() if formatname == USER_SPECIFIC: height, width=self.var_width.get(),self.var_height.get() self.var_width.set(width) self.var_height.set(height)
width =min(self.var_width.get(),self.var_height.get()) height=max(self.var_width.get(),self.var_height.get()) self.update_size(width, height)
def set_portrait(self): self.page_orientation=0 formatname = self.var_format_name.get() if formatname == USER_SPECIFIC: height, width=self.var_width.get(),self.var_height.get() self.var_width.set(width) self.var_height.set(height) self.set_size()
9968b3b60a6a59c3677dab6bf7afea7e0e6494b1 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/3123/9968b3b60a6a59c3677dab6bf7afea7e0e6494b1/page_panel.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 444, 67, 3831, 22513, 12, 2890, 4672, 365, 18, 2433, 67, 19235, 33, 20, 1835, 273, 1154, 12, 2890, 18, 1401, 67, 2819, 18, 588, 9334, 2890, 18, 1401, 67, 4210, 18, 588, 10756, 2072, 33, 1896, 12, 2890, 18, 1401, 67, 2819, 18, 588, 9334, 2890, 18, 1401, 67, 4210, 18, 588, 10756, 365, 18, 2725, 67, 1467, 12, 2819, 16, 2072, 13, 365, 18, 542, 67, 1467, 1435, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 444, 67, 3831, 22513, 12, 2890, 4672, 365, 18, 2433, 67, 19235, 33, 20, 1835, 273, 1154, 12, 2890, 18, 1401, 67, 2819, 18, 588, 9334, 2890, 18, 1401, 67, 4210, 18, 588, 10756, 2072, 33, 1896, 12, 2890, 18, 1401, 67, 2819, 18, 588, 9334, 2890, 18, 1401, 67, 4210, 18, 588, 10756, 365, 18, 2725, 67, 1467, 12, 2819, 16, 2072, 13, 365, 18, 542, 67, 1467, 1435, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
UMASK = 077 WORKDIR = "/"
def Daemonize(logfile): """Daemonize the current process. This detaches the current process from the controlling terminal and runs it in the background as a daemon. @type logfile: str @param logfile: the logfile to which we should redirect stdout/stderr @rtype: int @return: the value zero """ # pylint: disable-msg=W0212 # yes, we really want os._exit UMASK = 077 WORKDIR = "/" # this might fail pid = os.fork() if (pid == 0): # The first child. os.setsid() # this might fail pid = os.fork() # Fork a second child. if (pid == 0): # The second child. os.chdir(WORKDIR) os.umask(UMASK) else: # exit() or _exit()? See below. os._exit(0) # Exit parent (the first child) of the second child. else: os._exit(0) # Exit parent of the first child. for fd in range(3): _CloseFDNoErr(fd) i = os.open("/dev/null", os.O_RDONLY) # stdin assert i == 0, "Can't close/reopen stdin" i = os.open(logfile, os.O_WRONLY|os.O_CREAT|os.O_APPEND, 0600) # stdout assert i == 1, "Can't close/reopen stdout" # Duplicate standard output to standard error. os.dup2(1, 2) return 0
0260032ce37a960f7c619a1bbc891434ff84c927 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/7542/0260032ce37a960f7c619a1bbc891434ff84c927/utils.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 13054, 554, 12, 28806, 4672, 3536, 12858, 554, 326, 783, 1207, 18, 225, 1220, 10199, 281, 326, 783, 1207, 628, 326, 3325, 2456, 8651, 471, 7597, 518, 316, 326, 5412, 487, 279, 8131, 18, 225, 632, 723, 15204, 30, 609, 632, 891, 15204, 30, 326, 15204, 358, 1492, 732, 1410, 3136, 3909, 19, 11241, 632, 86, 723, 30, 509, 632, 2463, 30, 326, 460, 3634, 225, 3536, 468, 7601, 30, 4056, 17, 3576, 33, 59, 3103, 2138, 468, 12465, 16, 732, 8654, 2545, 1140, 6315, 8593, 225, 468, 333, 4825, 2321, 4231, 273, 1140, 18, 23335, 1435, 309, 261, 6610, 422, 374, 4672, 225, 468, 1021, 1122, 1151, 18, 1140, 18, 4424, 350, 1435, 468, 333, 4825, 2321, 4231, 273, 1140, 18, 23335, 1435, 468, 27599, 279, 2205, 1151, 18, 309, 261, 6610, 422, 374, 4672, 225, 468, 1021, 2205, 1151, 18, 1140, 18, 343, 1214, 12, 10566, 4537, 13, 1140, 18, 379, 835, 12, 2799, 6971, 13, 469, 30, 468, 2427, 1435, 578, 389, 8593, 1435, 35, 225, 2164, 5712, 18, 1140, 6315, 8593, 12, 20, 13, 468, 9500, 982, 261, 5787, 1122, 1151, 13, 434, 326, 2205, 1151, 18, 469, 30, 1140, 6315, 8593, 12, 20, 13, 468, 9500, 982, 434, 326, 1122, 1151, 18, 225, 364, 5194, 316, 1048, 12, 23, 4672, 389, 4605, 16894, 2279, 2524, 12, 8313, 13, 277, 273, 1140, 18, 3190, 2932, 19, 5206, 19, 2011, 3113, 1140, 18, 51, 67, 20403, 10857, 13, 468, 8801, 1815, 277, 422, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 13054, 554, 12, 28806, 4672, 3536, 12858, 554, 326, 783, 1207, 18, 225, 1220, 10199, 281, 326, 783, 1207, 628, 326, 3325, 2456, 8651, 471, 7597, 518, 316, 326, 5412, 487, 279, 8131, 18, 225, 632, 723, 15204, 30, 609, 632, 891, 15204, 30, 326, 15204, 358, 1492, 732, 1410, 3136, 3909, 19, 11241, 632, 86, 723, 30, 509, 632, 2463, 30, 326, 460, 3634, 225, 3536, 468, 7601, 30, 4056, 17, 3576, 33, 59, 3103, 2138, 468, 12465, 16, 732, 8654, 2545, 1140, 6315, 8593, 225, 468, 333, 4825, 2321, 4231, 273, 1140, 18, 23335, 1435, 309, 261, 6610, 422, 374, 4672, 225, 468, 1021, 1122, 1151, 18, 1140, 18, 4424, 350, 1435, 468, 333, 4825, 2321, 2 ]
line = fp.readline()
line = fp.readline().rstrip()
def extractbin(fp): line = fp.readline() while line and not line.startswith('literal '): line = fp.readline() if not line: return size = int(line[8:].rstrip()) dec = [] line = fp.readline() while line: line = line[1:-1] dec.append(base85.b85decode(line)) line = fp.readline() text = zlib.decompress(''.join(dec)) if len(text) != size: raise util.Abort(_('binary patch is %d bytes, not %d') % (len(text), size)) return text
503bc67416634bd09e5cca6f05550c7420052aec /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/11312/503bc67416634bd09e5cca6f05550c7420052aec/patch.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2608, 4757, 12, 7944, 4672, 980, 273, 4253, 18, 896, 1369, 7675, 86, 6406, 1435, 1323, 980, 471, 486, 980, 18, 17514, 1918, 2668, 13107, 296, 4672, 980, 273, 4253, 18, 896, 1369, 7675, 86, 6406, 1435, 309, 486, 980, 30, 327, 963, 273, 509, 12, 1369, 63, 28, 30, 8009, 86, 6406, 10756, 2109, 273, 5378, 980, 273, 4253, 18, 896, 1369, 7675, 86, 6406, 1435, 1323, 980, 30, 980, 273, 980, 63, 21, 30, 17, 21, 65, 2109, 18, 6923, 12, 1969, 7140, 18, 70, 7140, 3922, 12, 1369, 3719, 980, 273, 4253, 18, 896, 1369, 7675, 86, 6406, 1435, 977, 273, 24220, 18, 323, 14706, 2668, 10332, 5701, 12, 4924, 3719, 309, 562, 12, 955, 13, 480, 963, 30, 1002, 1709, 18, 13572, 24899, 2668, 8578, 4729, 353, 738, 72, 1731, 16, 486, 738, 72, 6134, 738, 261, 1897, 12, 955, 3631, 963, 3719, 327, 977, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2608, 4757, 12, 7944, 4672, 980, 273, 4253, 18, 896, 1369, 7675, 86, 6406, 1435, 1323, 980, 471, 486, 980, 18, 17514, 1918, 2668, 13107, 296, 4672, 980, 273, 4253, 18, 896, 1369, 7675, 86, 6406, 1435, 309, 486, 980, 30, 327, 963, 273, 509, 12, 1369, 63, 28, 30, 8009, 86, 6406, 10756, 2109, 273, 5378, 980, 273, 4253, 18, 896, 1369, 7675, 86, 6406, 1435, 1323, 980, 30, 980, 273, 980, 63, 21, 30, 17, 21, 65, 2109, 18, 6923, 12, 1969, 7140, 18, 70, 7140, 3922, 12, 1369, 3719, 980, 273, 4253, 18, 896, 1369, 7675, 86, 6406, 1435, 977, 273, 24220, 18, 323, 14706, 2668, 10332, 5701, 12, 4924, 3719, 309, 562, 12, 955, 2 ]
Return the ambient group related to self. EXAMPLES: An example involving the dihedral group on four elements,
Return the ambient group related to ``self``. EXAMPLES: An example involving the dihedral group on four elements,
def ambient_group(self): """ Return the ambient group related to self. EXAMPLES: An example involving the dihedral group on four elements, `D_8`:: sage: G = DihedralGroup(4) sage: H = CyclicPermutationGroup(4) sage: gens = H.gens() sage: S = PermutationGroup_subgroup(G, list(gens)) sage: S.ambient_group() Dihedral group of order 8 as a permutation group sage: S.ambient_group() == G True """ return self.__ambient_group
6ac30ecf5071d4fb909072e90d2311932d8c2165 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/9890/6ac30ecf5071d4fb909072e90d2311932d8c2165/permgroup.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 13232, 1979, 67, 1655, 12, 2890, 4672, 3536, 2000, 326, 13232, 1979, 1041, 3746, 358, 12176, 2890, 68, 8338, 225, 5675, 8900, 11386, 30, 225, 1922, 3454, 29876, 6282, 326, 4314, 28351, 1041, 603, 12792, 2186, 16, 1375, 40, 67, 28, 68, 2866, 225, 272, 410, 30, 611, 273, 463, 7392, 329, 23811, 1114, 12, 24, 13, 272, 410, 30, 670, 273, 22337, 18964, 9123, 9245, 1114, 12, 24, 13, 272, 410, 30, 314, 773, 273, 670, 18, 23730, 1435, 272, 410, 30, 348, 273, 13813, 9245, 1114, 67, 1717, 1655, 12, 43, 16, 666, 12, 23730, 3719, 272, 410, 30, 348, 18, 2536, 1979, 67, 1655, 1435, 463, 7392, 329, 23811, 1041, 434, 1353, 1725, 487, 279, 17440, 1041, 272, 410, 30, 348, 18, 2536, 1979, 67, 1655, 1435, 422, 611, 1053, 3536, 327, 365, 16186, 2536, 1979, 67, 1655, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 13232, 1979, 67, 1655, 12, 2890, 4672, 3536, 2000, 326, 13232, 1979, 1041, 3746, 358, 12176, 2890, 68, 8338, 225, 5675, 8900, 11386, 30, 225, 1922, 3454, 29876, 6282, 326, 4314, 28351, 1041, 603, 12792, 2186, 16, 1375, 40, 67, 28, 68, 2866, 225, 272, 410, 30, 611, 273, 463, 7392, 329, 23811, 1114, 12, 24, 13, 272, 410, 30, 670, 273, 22337, 18964, 9123, 9245, 1114, 12, 24, 13, 272, 410, 30, 314, 773, 273, 670, 18, 23730, 1435, 272, 410, 30, 348, 273, 13813, 9245, 1114, 67, 1717, 1655, 12, 43, 16, 666, 12, 23730, 3719, 272, 410, 30, 348, 18, 2536, 1979, 67, 1655, 1435, 463, 7392, 329, 23811, 1041, 434, 1353, 1725, 487, 279, 2 ]
checkversion(repo.manifest, "manifest") checksize(repo.manifest, "manifest")
if repo.changelog.count() > 0 and repo.manifest.count() == 0: havemf = 0 err(0, _("empty or missing 00manifest.i")) else: checkversion(repo.manifest, "manifest") checksize(repo.manifest, "manifest")
def checkversion(obj, name): if obj.version != revlog.REVLOGV0: if not revlogv1: warn(_("warning: `%s' uses revlog format 1") % name) elif revlogv1: warn(_("warning: `%s' uses revlog format 0") % name)
81ab121d11413401b817b66dfac2aab4c2762a61 /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/11312/81ab121d11413401b817b66dfac2aab4c2762a61/verify.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 866, 1589, 12, 2603, 16, 508, 4672, 309, 1081, 18, 1589, 480, 5588, 1330, 18, 862, 58, 4842, 58, 20, 30, 309, 486, 5588, 1330, 90, 21, 30, 1894, 24899, 2932, 8551, 30, 12430, 87, 11, 4692, 5588, 1330, 740, 404, 7923, 738, 508, 13, 1327, 5588, 1330, 90, 21, 30, 1894, 24899, 2932, 8551, 30, 12430, 87, 11, 4692, 5588, 1330, 740, 374, 7923, 738, 508, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 866, 1589, 12, 2603, 16, 508, 4672, 309, 1081, 18, 1589, 480, 5588, 1330, 18, 862, 58, 4842, 58, 20, 30, 309, 486, 5588, 1330, 90, 21, 30, 1894, 24899, 2932, 8551, 30, 12430, 87, 11, 4692, 5588, 1330, 740, 404, 7923, 738, 508, 13, 1327, 5588, 1330, 90, 21, 30, 1894, 24899, 2932, 8551, 30, 12430, 87, 11, 4692, 5588, 1330, 740, 374, 7923, 738, 508, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
print "Group order now ",n1*n2,"=",n1,"*",n2
print "Subgroup order is now ",n1*n2,"=",n1,"*",n2
def abelian_group(self, debug=False): r""" Returns the abelian group structure of the group of points on this elliptic curve.
612ce215a92d5ed7d78f8ea65721e4b7aaf9e3ad /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/9417/612ce215a92d5ed7d78f8ea65721e4b7aaf9e3ad/ell_finite_field.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1223, 292, 2779, 67, 1655, 12, 2890, 16, 1198, 33, 8381, 4672, 436, 8395, 2860, 326, 1223, 292, 2779, 1041, 3695, 434, 326, 1041, 434, 3143, 603, 333, 415, 549, 21507, 8882, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1223, 292, 2779, 67, 1655, 12, 2890, 16, 1198, 33, 8381, 4672, 436, 8395, 2860, 326, 1223, 292, 2779, 1041, 3695, 434, 326, 1041, 434, 3143, 603, 333, 415, 549, 21507, 8882, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
task = self._remove(pkg, changeset, locked, pending, WEIGHT_NONE)
task = self.TaskRemove(roottask, pkg, changeset, locked, pending, WEIGHT_NONE, WEIGHT_NONE)
def run(self):
c2ff0e2fa3473e5898baf091e7a39f94abf28732 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8317/c2ff0e2fa3473e5898baf091e7a39f94abf28732/transaction.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1086, 12, 2890, 4672, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1086, 12, 2890, 4672, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self.service.connectionLost(self.name)
self.service.connectionLost(self.name, self.transport.pid)
def processEnded(self, reason): if not self.empty: self.output.dataReceived('\n') self.service.connectionLost(self.name)
e63be4be40c2fa73dfc4b4e37611c16cfc14ca76 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/12595/e63be4be40c2fa73dfc4b4e37611c16cfc14ca76/procmon.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1207, 28362, 12, 2890, 16, 3971, 4672, 309, 486, 365, 18, 5531, 30, 365, 18, 2844, 18, 892, 8872, 2668, 64, 82, 6134, 365, 18, 3278, 18, 4071, 19024, 12, 2890, 18, 529, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1207, 28362, 12, 2890, 16, 3971, 4672, 309, 486, 365, 18, 5531, 30, 365, 18, 2844, 18, 892, 8872, 2668, 64, 82, 6134, 365, 18, 3278, 18, 4071, 19024, 12, 2890, 18, 529, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
def hide_window(self, window):
def __hide_window(self, window):
def hide_window(self, window): window.__position = window.get_position() window.hide()
1518cc810432a6e15b3d9f134759190405b665ce /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/4764/1518cc810432a6e15b3d9f134759190405b665ce/trayicon.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 11248, 67, 5668, 12, 2890, 16, 2742, 4672, 2742, 16186, 3276, 273, 2742, 18, 588, 67, 3276, 1435, 2742, 18, 11248, 1435, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 11248, 67, 5668, 12, 2890, 16, 2742, 4672, 2742, 16186, 3276, 273, 2742, 18, 588, 67, 3276, 1435, 2742, 18, 11248, 1435, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
phi_cur )
phi_cur )
def __init__( self , ref_el , degree ): entity_ids = {} nodes = []
085ed27cab51351290d3dac63b340f8baecc46a8 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/625/085ed27cab51351290d3dac63b340f8baecc46a8/brezzi_douglas_marini.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 365, 269, 1278, 67, 292, 269, 10782, 262, 30, 1522, 67, 2232, 273, 2618, 2199, 273, 5378, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 365, 269, 1278, 67, 292, 269, 10782, 262, 30, 1522, 67, 2232, 273, 2618, 2199, 273, 5378, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
floppy = self.floppy_contents(node,True)
floppy_text = self.floppy_contents(node,True)
def hexa2 (c): return chr((c>>4)+65) + chr ((c&16)+65)
c8a588799344db08a0317644ebb9ebfc6ebf9860 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/7598/c8a588799344db08a0317644ebb9ebfc6ebf9860/GetBootMedium.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3827, 69, 22, 261, 71, 4672, 327, 4513, 12443, 71, 9778, 24, 27921, 9222, 13, 397, 4513, 14015, 71, 10, 2313, 27921, 9222, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3827, 69, 22, 261, 71, 4672, 327, 4513, 12443, 71, 9778, 24, 27921, 9222, 13, 397, 4513, 14015, 71, 10, 2313, 27921, 9222, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
def longtitude(self):
def longitude(self):
def longtitude(self): "(float) Get the longtitude value of the geo-tag. See also .location()" lat, lon = self.location() return lon
cb4068d44da7ae94cbf2c55a70b62c50ed2d4210 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/5609/cb4068d44da7ae94cbf2c55a70b62c50ed2d4210/__init__.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 9192, 12, 2890, 4672, 7751, 5659, 13, 968, 326, 1525, 88, 3540, 460, 434, 326, 7856, 17, 2692, 18, 2164, 2546, 263, 3562, 10031, 2516, 16, 4281, 273, 365, 18, 3562, 1435, 327, 4281, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 9192, 12, 2890, 4672, 7751, 5659, 13, 968, 326, 1525, 88, 3540, 460, 434, 326, 7856, 17, 2692, 18, 2164, 2546, 263, 3562, 10031, 2516, 16, 4281, 273, 365, 18, 3562, 1435, 327, 4281, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
with open(sys.argv[3], "w") as metadata:
cacheName = sys.argv[3] cacheHash = cacheName.split("/")[1] with open(cacheName + ".metadata", "w") as metadata:
def add_tag(tags, metadata, read_name, write_name): if read_name in tags: tag = tags.tags[read_name] tag = tag[0] if isinstance(tag, tuple): # m4a files seem to return track number as a tuple: (tracknumber, totaltracks) (tag, _ignore) = tag metadata.write("%s\n" % write_name) metadata.write("%s\n" % tag)
fe944cd97c5a194b1f09eb9e582b56eb756bbb7b /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/13015/fe944cd97c5a194b1f09eb9e582b56eb756bbb7b/get_metadata.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 527, 67, 2692, 12, 4156, 16, 1982, 16, 855, 67, 529, 16, 1045, 67, 529, 4672, 309, 855, 67, 529, 316, 2342, 30, 1047, 273, 2342, 18, 4156, 63, 896, 67, 529, 65, 1047, 273, 1047, 63, 20, 65, 225, 309, 1549, 12, 2692, 16, 3193, 4672, 468, 312, 24, 69, 1390, 19264, 358, 327, 3298, 1300, 487, 279, 3193, 30, 261, 4101, 2696, 16, 2078, 21499, 13, 261, 2692, 16, 389, 6185, 13, 273, 1047, 225, 1982, 18, 2626, 27188, 87, 64, 82, 6, 738, 1045, 67, 529, 13, 1982, 18, 2626, 27188, 87, 64, 82, 6, 738, 1047, 13, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 527, 67, 2692, 12, 4156, 16, 1982, 16, 855, 67, 529, 16, 1045, 67, 529, 4672, 309, 855, 67, 529, 316, 2342, 30, 1047, 273, 2342, 18, 4156, 63, 896, 67, 529, 65, 1047, 273, 1047, 63, 20, 65, 225, 309, 1549, 12, 2692, 16, 3193, 4672, 468, 312, 24, 69, 1390, 19264, 358, 327, 3298, 1300, 487, 279, 3193, 30, 261, 4101, 2696, 16, 2078, 21499, 13, 261, 2692, 16, 389, 6185, 13, 273, 1047, 225, 1982, 18, 2626, 27188, 87, 64, 82, 6, 738, 1045, 67, 529, 13, 1982, 18, 2626, 27188, 87, 64, 82, 6, 738, 1047, 13, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
u2 = random()
if not 1e-7 < u1 < .9999999: continue u2 = 1.0 - random()
def gammavariate(self, alpha, beta): """Gamma distribution. Not the gamma function!
873612d58c61fd253556a4f323b4657233abc867 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/3187/873612d58c61fd253556a4f323b4657233abc867/random.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 23411, 20689, 297, 3840, 12, 2890, 16, 4190, 16, 6796, 4672, 3536, 31300, 7006, 18, 225, 2288, 326, 9601, 445, 5, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 23411, 20689, 297, 3840, 12, 2890, 16, 4190, 16, 6796, 4672, 3536, 31300, 7006, 18, 225, 2288, 326, 9601, 445, 5, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
super(Function, self).__init__(**kwargs)
super(Report, self).__init__(**kwargs)
def __init__(self, model, name, string, **kwargs): self.model = model self.name = name self.string = string super(Function, self).__init__(**kwargs)
8aa21c08364419edcb84a55d7c721137b1575353 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/12853/8aa21c08364419edcb84a55d7c721137b1575353/yaml_test.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 938, 16, 508, 16, 533, 16, 2826, 4333, 4672, 365, 18, 2284, 273, 938, 365, 18, 529, 273, 508, 365, 18, 1080, 273, 533, 2240, 12, 2083, 16, 365, 2934, 972, 2738, 972, 12, 636, 4333, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 938, 16, 508, 16, 533, 16, 2826, 4333, 4672, 365, 18, 2284, 273, 938, 365, 18, 529, 273, 508, 365, 18, 1080, 273, 533, 2240, 12, 2083, 16, 365, 2934, 972, 2738, 972, 12, 636, 4333, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
def setupResponse(self, pingResult, method): if method == "POST": return {'status_code' : pingResult.status_code, 'headers' : pingResult.headers, 'content' : pingResult.content } else: result = {} result['status_code'] = 200 result['headers'] = { 'Content-Type' : "text/plain" } result['content'] = str(pingResult.status_code) + "\n" for header in pingResult.headers.keys(): result['content'] += header + ": " + pingResult.headers[header] + "\n" result['content'] += "\n" + pingResult.content return result
def setupRequest(self, method): qs = self.request.query_string parsedQs = cgi.parse_qs(qs) params = {} if parsedQs.has_key('hub') and parsedQs.has_key('topic'): params['success'] = True params['url'] = urllib.unquote(parsedQs['hub'][0]) params['method'] = "POST" params['body'] = urllib.urlencode( { "hub.mode" : "publish", "hub.url" : parsedQs['topic']}, True ) params['headers'] = { "Content-Type" : "application/x-www-form-urlencoded" } return params else: params['success'] = False return params
9d5b73c8c3d2f92800ab621cc1824db9a52e9ca5 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/13890/9d5b73c8c3d2f92800ab621cc1824db9a52e9ca5/urlreq.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3875, 691, 12, 2890, 16, 707, 4672, 8719, 273, 365, 18, 2293, 18, 2271, 67, 1080, 2707, 53, 87, 273, 276, 10052, 18, 2670, 67, 12926, 12, 12926, 13, 225, 859, 273, 2618, 225, 309, 2707, 53, 87, 18, 5332, 67, 856, 2668, 14986, 6134, 471, 2707, 53, 87, 18, 5332, 67, 856, 2668, 10476, 11, 4672, 859, 3292, 4768, 3546, 273, 1053, 859, 3292, 718, 3546, 273, 11527, 18, 318, 6889, 12, 10817, 53, 87, 3292, 14986, 3546, 63, 20, 5717, 859, 3292, 2039, 3546, 273, 315, 3798, 6, 859, 3292, 3432, 3546, 273, 11527, 18, 718, 3015, 12, 288, 315, 14986, 18, 3188, 6, 294, 315, 6543, 3113, 315, 14986, 18, 718, 6, 294, 2707, 53, 87, 3292, 10476, 3546, 5779, 1053, 262, 859, 3292, 2485, 3546, 273, 288, 315, 1350, 17, 559, 6, 294, 315, 3685, 19, 92, 17, 5591, 17, 687, 17, 19690, 6, 289, 327, 859, 469, 30, 859, 3292, 4768, 3546, 273, 1083, 327, 859, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3875, 691, 12, 2890, 16, 707, 4672, 8719, 273, 365, 18, 2293, 18, 2271, 67, 1080, 2707, 53, 87, 273, 276, 10052, 18, 2670, 67, 12926, 12, 12926, 13, 225, 859, 273, 2618, 225, 309, 2707, 53, 87, 18, 5332, 67, 856, 2668, 14986, 6134, 471, 2707, 53, 87, 18, 5332, 67, 856, 2668, 10476, 11, 4672, 859, 3292, 4768, 3546, 273, 1053, 859, 3292, 718, 3546, 273, 11527, 18, 318, 6889, 12, 10817, 53, 87, 3292, 14986, 3546, 63, 20, 5717, 859, 3292, 2039, 3546, 273, 315, 3798, 6, 859, 3292, 3432, 3546, 273, 11527, 18, 718, 3015, 12, 288, 315, 14986, 18, 3188, 6, 294, 315, 6543, 3113, 315, 14986, 18, 718, 6, 294, 2707, 53, 2 ]
else :
if job.runningJob.errors is None or job.runningJob.errors == [] :
def getWMSOutput( self, jobList, outdir, service ): """ Manage objects to retrieve the output """
4821f3f07603aad958a2ac1c2b4b60bcaa7f40d3 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/8886/4821f3f07603aad958a2ac1c2b4b60bcaa7f40d3/SchedulerGLiteAPI.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 13876, 3537, 1447, 12, 365, 16, 1719, 682, 16, 225, 15398, 16, 1156, 262, 30, 3536, 24247, 2184, 358, 4614, 326, 876, 3536, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 13876, 3537, 1447, 12, 365, 16, 1719, 682, 16, 225, 15398, 16, 1156, 262, 30, 3536, 24247, 2184, 358, 4614, 326, 876, 3536, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
rmChans = list() for channel in user.channels: rmChans.append(channel) for channel in rmChans:
for channel in list(user.channels):
def removeUser(self, user): # perform all the cleanup that needs to be done to get a user out of the system log(self, "Removing %s from server" % user, 3) if(user in self.users): self.users.remove(user) else: log(self, "WARNING: %s wasn't in userlist" % user, 3) log(self, "Removing %s from channels %s" % (user, user.channels), 3) rmChans = list() for channel in user.channels: rmChans.append(channel) for channel in rmChans: channel.removeUser(user) if(user.connection.type == self.IRC_Connection.CLIENT): user.connection.sock.close() user.connection.closed = True self.connections.remove(user.connection)
f7836eee8ed9a994dc76e64b7a339f7cab876ec9 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/11670/f7836eee8ed9a994dc76e64b7a339f7cab876ec9/IRC_Server.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1206, 1299, 12, 2890, 16, 729, 4672, 468, 3073, 777, 326, 6686, 716, 4260, 358, 506, 2731, 358, 336, 279, 729, 596, 434, 326, 2619, 613, 12, 2890, 16, 315, 18939, 738, 87, 628, 1438, 6, 738, 729, 16, 890, 13, 309, 12, 1355, 316, 365, 18, 5577, 4672, 365, 18, 5577, 18, 4479, 12, 1355, 13, 469, 30, 613, 12, 2890, 16, 315, 9511, 30, 738, 87, 14487, 1404, 316, 26860, 6, 738, 729, 16, 890, 13, 613, 12, 2890, 16, 315, 18939, 738, 87, 628, 5750, 738, 87, 6, 738, 261, 1355, 16, 729, 18, 9114, 3631, 890, 13, 364, 1904, 316, 666, 12, 1355, 18, 9114, 4672, 1904, 18, 4479, 1299, 12, 1355, 13, 309, 12, 1355, 18, 4071, 18, 723, 422, 365, 18, 30240, 67, 1952, 18, 11935, 4672, 729, 18, 4071, 18, 15031, 18, 4412, 1435, 729, 18, 4071, 18, 12204, 273, 1053, 365, 18, 13313, 18, 4479, 12, 1355, 18, 4071, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1206, 1299, 12, 2890, 16, 729, 4672, 468, 3073, 777, 326, 6686, 716, 4260, 358, 506, 2731, 358, 336, 279, 729, 596, 434, 326, 2619, 613, 12, 2890, 16, 315, 18939, 738, 87, 628, 1438, 6, 738, 729, 16, 890, 13, 309, 12, 1355, 316, 365, 18, 5577, 4672, 365, 18, 5577, 18, 4479, 12, 1355, 13, 469, 30, 613, 12, 2890, 16, 315, 9511, 30, 738, 87, 14487, 1404, 316, 26860, 6, 738, 729, 16, 890, 13, 613, 12, 2890, 16, 315, 18939, 738, 87, 628, 5750, 738, 87, 6, 738, 261, 1355, 16, 729, 18, 9114, 3631, 890, 13, 364, 1904, 316, 666, 12, 1355, 18, 9114, 4672, 1904, 18, 4479, 1299, 12, 1355, 13, 309, 2 ]
source = source.replace('/', os.sep) destination = destination.replace('/', os.sep) self._copy_dir(source, destination) self._info("Copied directory from '%s' to '%s'" % (source, destination)) def _copy_dir(self, source, destination):
source, destination = self._copy_dir(source, destination) self._info("Copied directory from '%s' to '%s'" % (source, destination)) def move_directory(self, source, destination): """Moves the source directory into a destination. If a destination exists, the source is moved under it. Otherwise the destination directory and the possible missing intermediate directories are created. """ source, destination = self._copy_dir(source, destination) shutil.rmtree(source) self._info("Moved directory from '%s' to '%s'" % (source, destination)) def _copy_dir(self, source, dest): source = self._absnorm(source) dest = self._absnorm(dest)
def copy_directory(self, source, destination): """Copies the source directory into the destination. If the destination exists, the source is copied under it. Otherwise the destination directory and the possible missing intermediate directories are created. """ source = source.replace('/', os.sep) destination = destination.replace('/', os.sep) self._copy_dir(source, destination) self._info("Copied directory from '%s' to '%s'" % (source, destination))
4e92df2860c270b97129fb5577b1caec2faab8a2 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/6988/4e92df2860c270b97129fb5577b1caec2faab8a2/OperatingSystem.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1610, 67, 5149, 12, 2890, 16, 1084, 16, 2929, 4672, 3536, 15670, 326, 1084, 1867, 1368, 326, 2929, 18, 225, 971, 326, 2929, 1704, 16, 326, 1084, 353, 9268, 3613, 518, 18, 5272, 326, 2929, 1867, 471, 326, 3323, 3315, 12110, 6402, 854, 2522, 18, 3536, 1084, 273, 1084, 18, 2079, 2668, 19, 2187, 1140, 18, 10814, 13, 2929, 273, 2929, 18, 2079, 2668, 19, 2187, 1140, 18, 10814, 13, 365, 6315, 3530, 67, 1214, 12, 3168, 16, 2929, 13, 365, 6315, 1376, 2932, 28127, 1867, 628, 1995, 87, 11, 358, 1995, 87, 4970, 738, 261, 3168, 16, 2929, 3719, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1610, 67, 5149, 12, 2890, 16, 1084, 16, 2929, 4672, 3536, 15670, 326, 1084, 1867, 1368, 326, 2929, 18, 225, 971, 326, 2929, 1704, 16, 326, 1084, 353, 9268, 3613, 518, 18, 5272, 326, 2929, 1867, 471, 326, 3323, 3315, 12110, 6402, 854, 2522, 18, 3536, 1084, 273, 1084, 18, 2079, 2668, 19, 2187, 1140, 18, 10814, 13, 2929, 273, 2929, 18, 2079, 2668, 19, 2187, 1140, 18, 10814, 13, 365, 6315, 3530, 67, 1214, 12, 3168, 16, 2929, 13, 365, 6315, 1376, 2932, 28127, 1867, 628, 1995, 87, 11, 358, 1995, 87, 4970, 738, 261, 3168, 16, 2929, 3719, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if sys.platform in ('os2emx', 'riscos') or sys.platform[:4] == 'java':
if sys.platform in ('os2emx', 'riscos') or _is_jython:
def addsitepackages(known_paths, sys_prefix=sys.prefix, exec_prefix=sys.exec_prefix): """Add site-packages (and possibly site-python) to sys.path""" prefixes = [os.path.join(sys_prefix, "local"), sys_prefix] if exec_prefix != sys_prefix: prefixes.append(os.path.join(exec_prefix, "local")) for prefix in prefixes: if prefix: if sys.platform in ('os2emx', 'riscos') or sys.platform[:4] == 'java': sitedirs = [os.path.join(prefix, "Lib", "site-packages")] elif sys.platform == 'darwin' and prefix == sys_prefix: if prefix.startswith("/System/Library/Frameworks/"): # Apple's Python sitedirs = [os.path.join("/Library/Python", sys.version[:3], "site-packages"), os.path.join(prefix, "Extras", "lib", "python")] else: # any other Python distros on OSX work this way sitedirs = [os.path.join(prefix, "lib", "python" + sys.version[:3], "site-packages")] elif os.sep == '/': sitedirs = [os.path.join(prefix, "lib", "python" + sys.version[:3], "site-packages"), os.path.join(prefix, "lib", "site-python"), os.path.join(prefix, "python" + sys.version[:3], "lib-dynload")] lib64_dir = os.path.join(prefix, "lib64", "python" + sys.version[:3], "site-packages") if (os.path.exists(lib64_dir) and os.path.realpath(lib64_dir) not in [os.path.realpath(p) for p in sitedirs]): sitedirs.append(lib64_dir) try: # sys.getobjects only available in --with-pydebug build sys.getobjects sitedirs.insert(0, os.path.join(sitedirs[0], 'debug')) except AttributeError: pass else: sitedirs = [prefix, os.path.join(prefix, "lib", "site-packages")] if sys.platform == 'darwin': # for framework builds *only* we add the standard Apple # locations. Currently only per-user, but /Library and # /Network/Library could be added too if 'Python.framework' in prefix: home = os.environ.get('HOME') if home: sitedirs.append( os.path.join(home, 'Library', 'Python', sys.version[:3], 'site-packages')) for sitedir in sitedirs: if os.path.isdir(sitedir): addsitedir(sitedir, known_paths) return None
b540d6409f5bc0644c60737801c207a532d5d7e6 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/12981/b540d6409f5bc0644c60737801c207a532d5d7e6/site.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 4831, 305, 881, 484, 1023, 12, 2994, 67, 4481, 16, 2589, 67, 3239, 33, 9499, 18, 3239, 16, 1196, 67, 3239, 33, 9499, 18, 4177, 67, 3239, 4672, 3536, 986, 2834, 17, 10308, 261, 464, 10016, 2834, 17, 8103, 13, 358, 2589, 18, 803, 8395, 9419, 273, 306, 538, 18, 803, 18, 5701, 12, 9499, 67, 3239, 16, 315, 3729, 6, 3631, 2589, 67, 3239, 65, 309, 1196, 67, 3239, 480, 2589, 67, 3239, 30, 9419, 18, 6923, 12, 538, 18, 803, 18, 5701, 12, 4177, 67, 3239, 16, 315, 3729, 6, 3719, 225, 364, 1633, 316, 9419, 30, 309, 1633, 30, 309, 2589, 18, 9898, 316, 7707, 538, 22, 351, 92, 2187, 296, 18387, 14445, 6134, 578, 389, 291, 67, 78, 18490, 30, 10982, 329, 10539, 273, 306, 538, 18, 803, 18, 5701, 12, 3239, 16, 315, 5664, 3113, 315, 4256, 17, 10308, 7923, 65, 1327, 2589, 18, 9898, 422, 296, 28076, 11, 471, 1633, 422, 2589, 67, 3239, 30, 225, 309, 1633, 18, 17514, 1918, 2932, 19, 3163, 19, 9313, 19, 13701, 87, 4898, 4672, 468, 1716, 1802, 1807, 6600, 225, 10982, 329, 10539, 273, 306, 538, 18, 803, 18, 5701, 2932, 19, 9313, 19, 15774, 3113, 2589, 18, 1589, 10531, 23, 6487, 315, 4256, 17, 10308, 6, 3631, 1140, 18, 803, 18, 5701, 12, 3239, 16, 315, 30020, 3113, 315, 2941, 3113, 315, 8103, 7923, 65, 225, 469, 30, 468, 1281, 1308, 6600, 2411, 6973, 603, 5932, 60, 1440, 333, 4031, 10982, 329, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 4831, 305, 881, 484, 1023, 12, 2994, 67, 4481, 16, 2589, 67, 3239, 33, 9499, 18, 3239, 16, 1196, 67, 3239, 33, 9499, 18, 4177, 67, 3239, 4672, 3536, 986, 2834, 17, 10308, 261, 464, 10016, 2834, 17, 8103, 13, 358, 2589, 18, 803, 8395, 9419, 273, 306, 538, 18, 803, 18, 5701, 12, 9499, 67, 3239, 16, 315, 3729, 6, 3631, 2589, 67, 3239, 65, 309, 1196, 67, 3239, 480, 2589, 67, 3239, 30, 9419, 18, 6923, 12, 538, 18, 803, 18, 5701, 12, 4177, 67, 3239, 16, 315, 3729, 6, 3719, 225, 364, 1633, 316, 9419, 30, 309, 1633, 30, 309, 2589, 18, 9898, 316, 7707, 538, 22, 351, 92, 2187, 296, 18387, 14445, 6134, 578, 2 ]
pass
self.maxDepth = 20 self.fileRoot = "" self.urlRoot = "" self.urlIndex = []
def __init__(self): pass
9d1220abfbcbc31806deb9a0809fb045a329b4e4 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/5718/9d1220abfbcbc31806deb9a0809fb045a329b4e4/Wget.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 4672, 1342, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 4672, 1342, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
container = self.get_object(path)
try: container = self.get_object(path) except LookupError: return False
def has_object(self, path): if not isinstance(path, Path): path = Path(path)
1449102c2f834e3ac8b136a5c7e2f703264a4f82 /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/12681/1449102c2f834e3ac8b136a5c7e2f703264a4f82/base.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 711, 67, 1612, 12, 2890, 16, 589, 4672, 309, 486, 1549, 12, 803, 16, 2666, 4672, 589, 273, 2666, 12, 803, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 711, 67, 1612, 12, 2890, 16, 589, 4672, 309, 486, 1549, 12, 803, 16, 2666, 4672, 589, 273, 2666, 12, 803, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
fxd.title = fxd.str2XML(rec_prog.title)
fxd.title = rec_prog.title
def create_fxd(self,rec_prog): from util.fxdimdb import FxdImdb, makeVideo fxd = FxdImdb() fxd.setFxdFile(config.TV_RECORD_DIR + '/' + rec_prog.filename, overwrite = True)
827c9366310a81a7745a4e6dfbada9e07ffbceea /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/11399/827c9366310a81a7745a4e6dfbada9e07ffbceea/recordserver.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 752, 67, 74, 7669, 12, 2890, 16, 3927, 67, 14654, 4672, 628, 1709, 18, 19595, 3509, 1966, 1930, 478, 7669, 1170, 1966, 16, 1221, 10083, 284, 7669, 273, 478, 7669, 1170, 1966, 1435, 284, 7669, 18, 542, 42, 7669, 812, 12, 1425, 18, 15579, 67, 22261, 67, 4537, 397, 2023, 397, 1950, 67, 14654, 18, 3459, 16, 6156, 273, 1053, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 752, 67, 74, 7669, 12, 2890, 16, 3927, 67, 14654, 4672, 628, 1709, 18, 19595, 3509, 1966, 1930, 478, 7669, 1170, 1966, 16, 1221, 10083, 284, 7669, 273, 478, 7669, 1170, 1966, 1435, 284, 7669, 18, 542, 42, 7669, 812, 12, 1425, 18, 15579, 67, 22261, 67, 4537, 397, 2023, 397, 1950, 67, 14654, 18, 3459, 16, 6156, 273, 1053, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
"""Get taxon labels.""" self.taxlabels=[] opts=CharBuffer(options) while True: taxon=quotestrip(opts.next_word()) if not taxon: break self.taxlabels.append(taxon)
"""Get taxon labels. As the taxon names are already in the matrix, this is superflous except for transpose matrices, which are currently unspupported anyway. Thus, we ignore the taxlabels command to make handling of duplicate taxon names easier.i """ pass
def _taxlabels(self,options): """Get taxon labels.""" self.taxlabels=[] opts=CharBuffer(options) while True: taxon=quotestrip(opts.next_word()) if not taxon: break self.taxlabels.append(taxon)
09503d19fb7097018edce666588847fe56dc3231 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/7167/09503d19fb7097018edce666588847fe56dc3231/Nexus.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 8066, 5336, 12, 2890, 16, 2116, 4672, 3536, 967, 25458, 3249, 12123, 365, 18, 8066, 5336, 33, 8526, 1500, 33, 2156, 1892, 12, 2116, 13, 1323, 1053, 30, 25458, 33, 18653, 25125, 12, 4952, 18, 4285, 67, 1095, 10756, 309, 486, 25458, 30, 898, 365, 18, 8066, 5336, 18, 6923, 12, 8066, 265, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 8066, 5336, 12, 2890, 16, 2116, 4672, 3536, 967, 25458, 3249, 12123, 365, 18, 8066, 5336, 33, 8526, 1500, 33, 2156, 1892, 12, 2116, 13, 1323, 1053, 30, 25458, 33, 18653, 25125, 12, 4952, 18, 4285, 67, 1095, 10756, 309, 486, 25458, 30, 898, 365, 18, 8066, 5336, 18, 6923, 12, 8066, 265, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
subprocess.Popen('hg parents --template {date|date}'.split(), stdout=out).wait()
cmd = '%s parents --template {date|date}' % (hgloc) cmd = cmd.split() print cmd subprocess.Popen(cmd, stdout=out).wait()
def build(file, work): print "Building..." if ( need_to_update(file, work) ): print " Writing tempfile:", work make_directory_for_output(work) temp = open(work, "wb") temp.write(get_hg_id()) temp.flush() temp.close() print " Writing output file:", file make_directory_for_output(file) out = open(file, "wb") out.write("const wchar_t *HGVersion = L\"") out.flush() out.write(get_hg_id()) out.flush() out.write("\";\nconst wchar_t *HGDate = L\"") out.flush() subprocess.Popen('hg parents --template {date|date}'.split(), stdout=out).wait() out.flush() out.write('";\n') out.close() print " Done" else: print " Up to date"
28fabf177fb94b1161310db40dd45aa975737292 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/6977/28fabf177fb94b1161310db40dd45aa975737292/version.cpp.maker.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1361, 12, 768, 16, 1440, 4672, 1172, 315, 16713, 7070, 309, 261, 1608, 67, 869, 67, 2725, 12, 768, 16, 1440, 13, 262, 30, 1172, 315, 10423, 310, 13275, 2773, 16, 1440, 1221, 67, 5149, 67, 1884, 67, 2844, 12, 1252, 13, 1906, 273, 1696, 12, 1252, 16, 315, 9464, 7923, 1906, 18, 2626, 12, 588, 67, 26981, 67, 350, 10756, 1906, 18, 11330, 1435, 1906, 18, 4412, 1435, 225, 1172, 315, 10423, 310, 876, 585, 2773, 16, 585, 1221, 67, 5149, 67, 1884, 67, 2844, 12, 768, 13, 596, 273, 1696, 12, 768, 16, 315, 9464, 7923, 596, 18, 2626, 2932, 10248, 341, 3001, 67, 88, 380, 44, 43, 1444, 273, 511, 2412, 7923, 596, 18, 11330, 1435, 225, 596, 18, 2626, 12, 588, 67, 26981, 67, 350, 10756, 596, 18, 11330, 1435, 225, 596, 18, 2626, 2932, 2412, 9747, 82, 10248, 341, 3001, 67, 88, 380, 44, 43, 1626, 273, 511, 2412, 7923, 596, 18, 11330, 1435, 225, 1797, 273, 1995, 87, 6298, 1493, 3202, 288, 712, 96, 712, 1713, 738, 261, 26981, 1829, 13, 1797, 273, 1797, 18, 4939, 1435, 1172, 1797, 6652, 18, 52, 3190, 12, 4172, 16, 3909, 33, 659, 2934, 7048, 1435, 596, 18, 11330, 1435, 225, 596, 18, 2626, 22076, 9747, 82, 6134, 596, 18, 4412, 1435, 1172, 315, 8677, 6, 469, 30, 1172, 315, 1948, 358, 1509, 6, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1361, 12, 768, 16, 1440, 4672, 1172, 315, 16713, 7070, 309, 261, 1608, 67, 869, 67, 2725, 12, 768, 16, 1440, 13, 262, 30, 1172, 315, 10423, 310, 13275, 2773, 16, 1440, 1221, 67, 5149, 67, 1884, 67, 2844, 12, 1252, 13, 1906, 273, 1696, 12, 1252, 16, 315, 9464, 7923, 1906, 18, 2626, 12, 588, 67, 26981, 67, 350, 10756, 1906, 18, 11330, 1435, 1906, 18, 4412, 1435, 225, 1172, 315, 10423, 310, 876, 585, 2773, 16, 585, 1221, 67, 5149, 67, 1884, 67, 2844, 12, 768, 13, 596, 273, 1696, 12, 768, 16, 315, 9464, 7923, 596, 18, 2626, 2932, 10248, 341, 3001, 67, 88, 380, 44, 43, 1444, 273, 511, 2412, 7923, 596, 18, 11330, 2 ]
def close_data(self):
def close_data(self):
def close_data(self):
f1d302d15f45741d8b0d5e81b4b0e5a61c6fa580 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/3187/f1d302d15f45741d8b0d5e81b4b0e5a61c6fa580/binhex.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1746, 67, 892, 12, 2890, 4672, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1746, 67, 892, 12, 2890, 4672, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
return 1
return 1
def is_acquired(ob, hasattr=hasattr, aq_base=aq_base, absattr=absattr): # Return true if this object is not a direct # subobject of its aq_parent object. if not hasattr(ob, 'aq_parent'): return 0 parent = aq_base(ob.aq_parent) absId = absattr(ob.id) if hasattr(parent,'_objects'): if absId+' ' in parent.objectIds(): return 0 if hasattr(parent, absId): return 0 if hasattr(aq_base(ob), 'isTopLevelPrincipiaApplicationObject') and \ ob.isTopLevelPrincipiaApplicationObject: return 0 return 1
caffc57c633e1357305c97c70b16eab181721275 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/9658/caffc57c633e1357305c97c70b16eab181721275/Common.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 353, 67, 1077, 1402, 12, 947, 16, 3859, 33, 5332, 1747, 16, 279, 85, 67, 1969, 33, 69, 85, 67, 1969, 16, 2417, 1747, 33, 5113, 1747, 4672, 468, 2000, 638, 309, 333, 733, 353, 486, 279, 2657, 468, 720, 1612, 434, 2097, 279, 85, 67, 2938, 733, 18, 309, 486, 3859, 12, 947, 16, 296, 69, 85, 67, 2938, 11, 4672, 327, 374, 225, 982, 273, 279, 85, 67, 1969, 12, 947, 18, 69, 85, 67, 2938, 13, 2417, 548, 225, 273, 2417, 1747, 12, 947, 18, 350, 13, 225, 309, 3859, 12, 2938, 11189, 67, 6911, 11, 4672, 309, 2417, 548, 6797, 296, 316, 982, 18, 1612, 2673, 13332, 327, 374, 225, 309, 3859, 12, 2938, 16, 2417, 548, 4672, 327, 374, 309, 3859, 12, 69, 85, 67, 1969, 12, 947, 3631, 296, 291, 27046, 2050, 4613, 1155, 3208, 921, 6134, 471, 521, 3768, 18, 291, 27046, 2050, 4613, 1155, 3208, 921, 30, 327, 374, 327, 404, 282, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 353, 67, 1077, 1402, 12, 947, 16, 3859, 33, 5332, 1747, 16, 279, 85, 67, 1969, 33, 69, 85, 67, 1969, 16, 2417, 1747, 33, 5113, 1747, 4672, 468, 2000, 638, 309, 333, 733, 353, 486, 279, 2657, 468, 720, 1612, 434, 2097, 279, 85, 67, 2938, 733, 18, 309, 486, 3859, 12, 947, 16, 296, 69, 85, 67, 2938, 11, 4672, 327, 374, 225, 982, 273, 279, 85, 67, 1969, 12, 947, 18, 69, 85, 67, 2938, 13, 2417, 548, 225, 273, 2417, 1747, 12, 947, 18, 350, 13, 225, 309, 3859, 12, 2938, 11189, 67, 6911, 11, 4672, 309, 2417, 548, 6797, 296, 316, 982, 18, 1612, 2673, 13332, 327, 374, 225, 309, 3859, 12, 2938, 2 ]
print '===========PAGES=============' print self.pages print '=======ACTIVE LAYER==========' print self.active_layer print '============================='
def load_Completed(self): if not self.layers: self.layers = [Layer(_("Layer 1"))] if self.active_layer is None: for layer in self.layers: if layer.CanSelect(): self.active_layer = layer break add_guide_layer = add_grid_layer = 1 for layer in self.layers: layer.SetDocument(self) if isinstance(layer, GuideLayer): self.guide_layer = layer add_guide_layer = 0 if isinstance(layer, GridLayer): self.snap_grid = layer add_grid_layer = 0 if add_guide_layer: self.layers.append(self.guide_layer) if add_grid_layer: self.layers.append(self.snap_grid) self.extract_pages() self.RearrangeLayers() print '===========PAGES=============' print self.pages print '=======ACTIVE LAYER==========' print self.active_layer print '============================='
f3b38dcaa225be26b84c603a5004f9f430d24dad /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/3123/f3b38dcaa225be26b84c603a5004f9f430d24dad/document.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1262, 67, 9556, 12, 2890, 4672, 309, 486, 365, 18, 10396, 30, 365, 18, 10396, 273, 306, 4576, 24899, 2932, 4576, 404, 6, 3719, 65, 309, 365, 18, 3535, 67, 6363, 353, 599, 30, 364, 3018, 316, 365, 18, 10396, 30, 309, 3018, 18, 2568, 3391, 13332, 365, 18, 3535, 67, 6363, 273, 3018, 898, 527, 67, 12118, 67, 6363, 273, 527, 67, 5222, 67, 6363, 273, 404, 364, 3018, 316, 365, 18, 10396, 30, 3018, 18, 694, 2519, 12, 2890, 13, 309, 1549, 12, 6363, 16, 13018, 4576, 4672, 365, 18, 12118, 67, 6363, 273, 3018, 527, 67, 12118, 67, 6363, 273, 374, 309, 1549, 12, 6363, 16, 7145, 4576, 4672, 365, 18, 28449, 67, 5222, 273, 3018, 527, 67, 5222, 67, 6363, 273, 374, 309, 527, 67, 12118, 67, 6363, 30, 365, 18, 10396, 18, 6923, 12, 2890, 18, 12118, 67, 6363, 13, 309, 527, 67, 5222, 67, 6363, 30, 365, 18, 10396, 18, 6923, 12, 2890, 18, 28449, 67, 5222, 13, 365, 18, 8004, 67, 7267, 1435, 365, 18, 426, 297, 3676, 9282, 1435, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1262, 67, 9556, 12, 2890, 4672, 309, 486, 365, 18, 10396, 30, 365, 18, 10396, 273, 306, 4576, 24899, 2932, 4576, 404, 6, 3719, 65, 309, 365, 18, 3535, 67, 6363, 353, 599, 30, 364, 3018, 316, 365, 18, 10396, 30, 309, 3018, 18, 2568, 3391, 13332, 365, 18, 3535, 67, 6363, 273, 3018, 898, 527, 67, 12118, 67, 6363, 273, 527, 67, 5222, 67, 6363, 273, 404, 364, 3018, 316, 365, 18, 10396, 30, 3018, 18, 694, 2519, 12, 2890, 13, 309, 1549, 12, 6363, 16, 13018, 4576, 4672, 365, 18, 12118, 67, 6363, 273, 3018, 527, 67, 12118, 67, 6363, 273, 374, 309, 1549, 12, 6363, 16, 7145, 4576, 4672, 365, 18, 28449, 67, 5222, 273, 2 ]
newdrs = self.presupp_drs.replace(self.presupp_variable, self.antecedent_ref, True)
newdrs = self.presupp_drs.replace(self.presupp_variable, self.antecedent_cond.argument, True)
def __call__(self, drs): """Put all conditions from the presupposition DRS (if presupposition condition is a proper name: except the proper name itself) into the drs, and replace the presupposition condition referent in them with antecedent_ref""" #print "BINDING, drs", drs newdrs = self.presupp_drs.replace(self.presupp_variable, self.antecedent_ref, True) # There will be referents and conditions to move # if there is a relative clause modifying the noun that has triggered the presuppositon drs.refs.extend([ref for ref in newdrs.refs \ if ref != self.antecedent_ref.variable]) conds_to_move = [cond for cond in newdrs.conds \ if not is_unary_predicate(cond) or cond.function.variable.name != self.presupp_funcname] # TODO: in these condiitons, variables must be replaced, too. Or is it already done by InnerReplace? # Put the conditions at the position of the original presupposition DRS if self.condition_index is None: # it is an index, it can be zero drs.conds.extend(conds_to_move) else: drs.conds = drs.conds[:self.condition_index+1]+conds_to_move+drs.conds[self.condition_index+1:] return drs
e0d42a5635f01a40f30bb776fbf09ab5ee84e327 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/2768/e0d42a5635f01a40f30bb776fbf09ab5ee84e327/temporaldrt.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 1991, 972, 12, 2890, 16, 5081, 87, 4672, 3536, 6426, 777, 4636, 628, 326, 4075, 416, 3276, 463, 13225, 261, 430, 4075, 416, 3276, 2269, 353, 279, 5338, 508, 30, 1335, 326, 5338, 508, 6174, 13, 1368, 326, 5081, 87, 16, 471, 1453, 326, 4075, 416, 3276, 2269, 283, 3518, 316, 2182, 598, 392, 736, 3263, 319, 67, 1734, 8395, 468, 1188, 315, 2739, 16, 5081, 87, 3113, 5081, 87, 394, 3069, 87, 273, 365, 18, 12202, 416, 84, 67, 3069, 87, 18, 2079, 12, 2890, 18, 12202, 416, 84, 67, 6105, 16, 365, 18, 7974, 3263, 319, 67, 10013, 18, 3446, 16, 1053, 13, 468, 6149, 903, 506, 283, 3518, 87, 471, 4636, 358, 3635, 468, 309, 1915, 353, 279, 3632, 6591, 21920, 326, 27771, 716, 711, 10861, 326, 4075, 416, 1724, 265, 5081, 87, 18, 9316, 18, 14313, 3816, 1734, 364, 1278, 316, 394, 3069, 87, 18, 9316, 521, 309, 1278, 480, 365, 18, 7974, 3263, 319, 67, 1734, 18, 6105, 5717, 30958, 67, 869, 67, 8501, 273, 306, 10013, 364, 6941, 316, 394, 3069, 87, 18, 20874, 521, 309, 486, 353, 67, 318, 814, 67, 18344, 12, 10013, 13, 578, 6941, 18, 915, 18, 6105, 18, 529, 480, 365, 18, 12202, 416, 84, 67, 644, 529, 65, 468, 2660, 30, 316, 4259, 356, 3211, 305, 7008, 16, 3152, 1297, 506, 8089, 16, 4885, 18, 2965, 353, 518, 1818, 2731, 635, 19494, 5729, 35, 468, 4399, 326, 4636, 622, 326, 1754, 434, 326, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 1991, 972, 12, 2890, 16, 5081, 87, 4672, 3536, 6426, 777, 4636, 628, 326, 4075, 416, 3276, 463, 13225, 261, 430, 4075, 416, 3276, 2269, 353, 279, 5338, 508, 30, 1335, 326, 5338, 508, 6174, 13, 1368, 326, 5081, 87, 16, 471, 1453, 326, 4075, 416, 3276, 2269, 283, 3518, 316, 2182, 598, 392, 736, 3263, 319, 67, 1734, 8395, 468, 1188, 315, 2739, 16, 5081, 87, 3113, 5081, 87, 394, 3069, 87, 273, 365, 18, 12202, 416, 84, 67, 3069, 87, 18, 2079, 12, 2890, 18, 12202, 416, 84, 67, 6105, 16, 365, 18, 7974, 3263, 319, 67, 10013, 18, 3446, 16, 1053, 13, 468, 6149, 903, 506, 283, 3518, 87, 471, 4636, 358, 3635, 468, 2 ]
return new_price
return new_price
def _compute_price(self, cursor, user, from_uom, price, to_uom=False): """ Convert price for given uom's. from_uom and to_uom should be browse records. """ if not from_uom or not price or not to_uom: return price if from_uom.category.id <> to_uom.category.id: return price if from_uom.factor_data: new_price = float(price) / from_uom.factor_data else: new_price = float(price) * from_uom.factor
1c3eb8968b62e8d0dd32434c2ed5ad19c170cb2e /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/9285/1c3eb8968b62e8d0dd32434c2ed5ad19c170cb2e/uom.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 9200, 67, 8694, 12, 2890, 16, 3347, 16, 729, 16, 628, 67, 89, 362, 16, 6205, 16, 358, 67, 89, 362, 33, 8381, 4672, 3536, 4037, 6205, 364, 864, 582, 362, 1807, 18, 628, 67, 89, 362, 471, 358, 67, 89, 362, 1410, 506, 21670, 3853, 18, 3536, 309, 486, 628, 67, 89, 362, 578, 486, 6205, 578, 486, 358, 67, 89, 362, 30, 327, 6205, 309, 628, 67, 89, 362, 18, 4743, 18, 350, 2813, 358, 67, 89, 362, 18, 4743, 18, 350, 30, 327, 6205, 309, 628, 67, 89, 362, 18, 6812, 67, 892, 30, 394, 67, 8694, 273, 1431, 12, 8694, 13, 342, 628, 67, 89, 362, 18, 6812, 67, 892, 469, 30, 394, 67, 8694, 273, 1431, 12, 8694, 13, 380, 628, 67, 89, 362, 18, 6812, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 9200, 67, 8694, 12, 2890, 16, 3347, 16, 729, 16, 628, 67, 89, 362, 16, 6205, 16, 358, 67, 89, 362, 33, 8381, 4672, 3536, 4037, 6205, 364, 864, 582, 362, 1807, 18, 628, 67, 89, 362, 471, 358, 67, 89, 362, 1410, 506, 21670, 3853, 18, 3536, 309, 486, 628, 67, 89, 362, 578, 486, 6205, 578, 486, 358, 67, 89, 362, 30, 327, 6205, 309, 628, 67, 89, 362, 18, 4743, 18, 350, 2813, 358, 67, 89, 362, 18, 4743, 18, 350, 30, 327, 6205, 309, 628, 67, 89, 362, 18, 6812, 67, 892, 30, 394, 67, 8694, 273, 1431, 12, 8694, 13, 342, 628, 67, 89, 362, 18, 6812, 67, 892, 469, 30, 394, 2 ]
print "SpamBayes: Watching for new messages in folder", name
print "SpamBayes: Watching (for %s) in '%s'" % (what, name)
def _HookFolderEvents(self, folder_ids, include_sub, HandlerClass): new_hooks = {} for msgstore_folder in self.manager.message_store.GetFolderGenerator( folder_ids, include_sub): existing = self.folder_hooks.get(msgstore_folder.id) if existing is None or existing.__class__ != HandlerClass: name = msgstore_folder.GetFQName() try: folder = msgstore_folder.GetOutlookItem() except self.manager.message_store.MsgStoreException, details: # Exceptions here are most likely when the folder is valid # and available to MAPI, but not via the Outlook. # One good way to provoke this is to configure Outlook's # profile so default delivery is set to "None". Then, # when you start Outlook, it immediately displays an # error and terminates. During this process, the addin # is initialized, attempts to get the folders, and fails. print "FAILED to open the Outlook folder '%s' " \ "to hook events" % name print details continue # Ensure the field is created before we hook the folder # events, else there is a chance our event handler will # see the temporary message we create. try: self.manager.EnsureOutlookFieldsForFolder(msgstore_folder.GetID()) except: # An exception checking that Outlook's folder has a # 'spam' field is not fatal, nor really even worth # telling the user about, nor even worth a traceback # (as it is likely a COM error). print "ERROR: Failed to check folder '%s' for " \ "Spam field" % name etype, value, tb = sys.exc_info() tb = None # dont want it, and nuke circular ref traceback.print_exception(etype, value, tb) # now setup the hook. try: new_hook = DispatchWithEvents(folder.Items, HandlerClass) except ValueError: print "WARNING: Folder '%s' can not hook events" % (name,) new_hook = None if new_hook is not None: new_hook.Init(msgstore_folder, self.application, self.manager) new_hooks[msgstore_folder.id] = new_hook print "SpamBayes: Watching for new messages in folder", name else: new_hooks[msgstore_folder.id] = existing existing.ReInit() return new_hooks
54e586400b93724e781110ac3a96d9911643ea6f /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/9857/54e586400b93724e781110ac3a96d9911643ea6f/addin.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 5394, 3899, 3783, 12, 2890, 16, 3009, 67, 2232, 16, 2341, 67, 1717, 16, 4663, 797, 4672, 394, 67, 10468, 273, 2618, 364, 1234, 2233, 67, 5609, 316, 365, 18, 4181, 18, 2150, 67, 2233, 18, 967, 3899, 3908, 12, 3009, 67, 2232, 16, 2341, 67, 1717, 4672, 2062, 273, 365, 18, 5609, 67, 10468, 18, 588, 12, 3576, 2233, 67, 5609, 18, 350, 13, 309, 2062, 353, 599, 578, 2062, 16186, 1106, 972, 480, 4663, 797, 30, 508, 273, 1234, 2233, 67, 5609, 18, 967, 42, 13688, 1435, 775, 30, 3009, 273, 1234, 2233, 67, 5609, 18, 967, 1182, 7330, 1180, 1435, 1335, 365, 18, 4181, 18, 2150, 67, 2233, 18, 3332, 21151, 16, 3189, 30, 468, 12781, 2674, 854, 4486, 10374, 1347, 326, 3009, 353, 923, 468, 471, 2319, 358, 490, 2557, 16, 1496, 486, 3970, 326, 2976, 7330, 18, 468, 6942, 7494, 4031, 358, 17197, 3056, 333, 353, 358, 5068, 2976, 7330, 1807, 468, 3042, 1427, 805, 7912, 353, 444, 358, 315, 7036, 9654, 225, 9697, 16, 468, 1347, 1846, 787, 2976, 7330, 16, 518, 7636, 22461, 392, 468, 555, 471, 30559, 18, 225, 463, 4017, 333, 1207, 16, 326, 527, 267, 468, 353, 6454, 16, 7531, 358, 336, 326, 9907, 16, 471, 6684, 18, 1172, 315, 11965, 358, 1696, 326, 2976, 7330, 3009, 1995, 87, 11, 315, 521, 315, 869, 3953, 2641, 6, 738, 508, 1172, 3189, 1324, 468, 7693, 326, 652, 353, 2522, 1865, 732, 3953, 326, 3009, 468, 2641, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 5394, 3899, 3783, 12, 2890, 16, 3009, 67, 2232, 16, 2341, 67, 1717, 16, 4663, 797, 4672, 394, 67, 10468, 273, 2618, 364, 1234, 2233, 67, 5609, 316, 365, 18, 4181, 18, 2150, 67, 2233, 18, 967, 3899, 3908, 12, 3009, 67, 2232, 16, 2341, 67, 1717, 4672, 2062, 273, 365, 18, 5609, 67, 10468, 18, 588, 12, 3576, 2233, 67, 5609, 18, 350, 13, 309, 2062, 353, 599, 578, 2062, 16186, 1106, 972, 480, 4663, 797, 30, 508, 273, 1234, 2233, 67, 5609, 18, 967, 42, 13688, 1435, 775, 30, 3009, 273, 1234, 2233, 67, 5609, 18, 967, 1182, 7330, 1180, 1435, 1335, 365, 18, 4181, 18, 2150, 67, 2233, 18, 3332, 21151, 16, 3189, 30, 2 ]
if context.get('action_id', False): picking = picking_obj.browse(cr, uid, [context['action_id']])[0]
if context.get('active_id', False): picking = picking_obj.browse(cr, uid, [context['active_id']])[0]
def _get_picking_address(self, cr, uid, context=None): picking_obj = self.pool.get('stock.picking') if context is None: context = {} if context.get('action_id', False): picking = picking_obj.browse(cr, uid, [context['action_id']])[0] return picking.address_id and picking.address_id.id or False return False
a22787cadf9fdef396f44178ea5b249acbdced9c /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/7397/a22787cadf9fdef396f44178ea5b249acbdced9c/stock.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 588, 67, 11503, 310, 67, 2867, 12, 2890, 16, 4422, 16, 4555, 16, 819, 33, 7036, 4672, 6002, 310, 67, 2603, 273, 365, 18, 6011, 18, 588, 2668, 15381, 18, 11503, 310, 6134, 309, 819, 353, 599, 30, 819, 273, 2618, 309, 819, 18, 588, 2668, 3535, 67, 350, 2187, 1083, 4672, 6002, 310, 273, 6002, 310, 67, 2603, 18, 25731, 12, 3353, 16, 4555, 16, 306, 2472, 3292, 3535, 67, 350, 3546, 5717, 63, 20, 65, 327, 6002, 310, 18, 2867, 67, 350, 471, 6002, 310, 18, 2867, 67, 350, 18, 350, 578, 1083, 327, 1083, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 588, 67, 11503, 310, 67, 2867, 12, 2890, 16, 4422, 16, 4555, 16, 819, 33, 7036, 4672, 6002, 310, 67, 2603, 273, 365, 18, 6011, 18, 588, 2668, 15381, 18, 11503, 310, 6134, 309, 819, 353, 599, 30, 819, 273, 2618, 309, 819, 18, 588, 2668, 3535, 67, 350, 2187, 1083, 4672, 6002, 310, 273, 6002, 310, 67, 2603, 18, 25731, 12, 3353, 16, 4555, 16, 306, 2472, 3292, 3535, 67, 350, 3546, 5717, 63, 20, 65, 327, 6002, 310, 18, 2867, 67, 350, 471, 6002, 310, 18, 2867, 67, 350, 18, 350, 578, 1083, 327, 1083, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self.assertAlmostEqual(cmath.pi, pi_expected, 9, "cmath.pi is %s; should be %s" % (cmath.pi, pi_expected)) self.assertAlmostEqual(cmath.e, e_expected, 9, "cmath.e is %s; should be %s" % (cmath.e, e_expected))
self.assertAlmostEqual(cmath.pi, pi_expected, places=9, msg="cmath.pi is %s; should be %s" % (cmath.pi, pi_expected)) self.assertAlmostEqual(cmath.e, e_expected, places=9, msg="cmath.e is %s; should be %s" % (cmath.e, e_expected))
def test_constants(self): e_expected = 2.71828182845904523536 pi_expected = 3.14159265358979323846 self.assertAlmostEqual(cmath.pi, pi_expected, 9, "cmath.pi is %s; should be %s" % (cmath.pi, pi_expected)) self.assertAlmostEqual(cmath.e, e_expected, 9, "cmath.e is %s; should be %s" % (cmath.e, e_expected))
29306fe1dcc8ce448637486d570e6a1b2f7c9ac2 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/3187/29306fe1dcc8ce448637486d570e6a1b2f7c9ac2/test_cmath.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 13358, 12, 2890, 4672, 425, 67, 3825, 273, 576, 18, 27, 2643, 6030, 28246, 5193, 6162, 3028, 25, 30803, 5718, 4790, 67, 3825, 273, 890, 18, 3461, 24872, 30281, 4763, 6675, 7235, 1578, 17295, 26, 365, 18, 11231, 1067, 10329, 5812, 12, 7670, 421, 18, 7259, 16, 4790, 67, 3825, 16, 2468, 16, 315, 7670, 421, 18, 7259, 353, 738, 87, 31, 1410, 506, 738, 87, 6, 738, 261, 7670, 421, 18, 7259, 16, 4790, 67, 3825, 3719, 365, 18, 11231, 1067, 10329, 5812, 12, 7670, 421, 18, 73, 16, 225, 425, 67, 3825, 16, 2468, 16, 315, 7670, 421, 18, 73, 353, 738, 87, 31, 1410, 506, 738, 87, 6, 738, 261, 7670, 421, 18, 73, 16, 425, 67, 3825, 3719, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 13358, 12, 2890, 4672, 425, 67, 3825, 273, 576, 18, 27, 2643, 6030, 28246, 5193, 6162, 3028, 25, 30803, 5718, 4790, 67, 3825, 273, 890, 18, 3461, 24872, 30281, 4763, 6675, 7235, 1578, 17295, 26, 365, 18, 11231, 1067, 10329, 5812, 12, 7670, 421, 18, 7259, 16, 4790, 67, 3825, 16, 2468, 16, 315, 7670, 421, 18, 7259, 353, 738, 87, 31, 1410, 506, 738, 87, 6, 738, 261, 7670, 421, 18, 7259, 16, 4790, 67, 3825, 3719, 365, 18, 11231, 1067, 10329, 5812, 12, 7670, 421, 18, 73, 16, 225, 425, 67, 3825, 16, 2468, 16, 315, 7670, 421, 18, 73, 353, 738, 87, 31, 1410, 506, 738, 87, 6, 738, 261, 7670, 421, 18, 2 ]
output = p.stdout.readline() if output is not None and output != "" : self.log.write(output) self.log.flush()
if self.intercept_output : output = p.stdout.readline() if output is not None and output != "" : self.log.write(output) self.log.flush()
def run (self) : p = subprocess.Popen(args=[self.command], stdout=subprocess.PIPE, stderr=subprocess.PIPE, shell=True) while True : if p.poll() is not None : break output = p.stdout.readline() if output is not None and output != "" : self.log.write(output) self.log.flush() self._alive = False
7fa4f9c53b20fc1fc9f0a2b2509c49a9f9056261 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/696/7fa4f9c53b20fc1fc9f0a2b2509c49a9f9056261/xmlrpc_utils.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1086, 261, 2890, 13, 294, 293, 273, 6652, 18, 52, 3190, 12, 1968, 22850, 2890, 18, 3076, 6487, 3909, 33, 1717, 2567, 18, 27602, 16, 4514, 33, 1717, 2567, 18, 27602, 16, 5972, 33, 5510, 13, 1323, 1053, 294, 309, 293, 18, 13835, 1435, 353, 486, 599, 294, 898, 309, 365, 18, 27481, 67, 2844, 294, 876, 273, 293, 18, 10283, 18, 896, 1369, 1435, 309, 876, 353, 486, 599, 471, 876, 480, 1408, 294, 365, 18, 1330, 18, 2626, 12, 2844, 13, 365, 18, 1330, 18, 11330, 1435, 365, 6315, 11462, 273, 1083, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1086, 261, 2890, 13, 294, 293, 273, 6652, 18, 52, 3190, 12, 1968, 22850, 2890, 18, 3076, 6487, 3909, 33, 1717, 2567, 18, 27602, 16, 4514, 33, 1717, 2567, 18, 27602, 16, 5972, 33, 5510, 13, 1323, 1053, 294, 309, 293, 18, 13835, 1435, 353, 486, 599, 294, 898, 309, 365, 18, 27481, 67, 2844, 294, 876, 273, 293, 18, 10283, 18, 896, 1369, 1435, 309, 876, 353, 486, 599, 471, 876, 480, 1408, 294, 365, 18, 1330, 18, 2626, 12, 2844, 13, 365, 18, 1330, 18, 11330, 1435, 365, 6315, 11462, 273, 1083, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
def __getitem(self, name):
def __getitem__(self, name):
def __getitem(self, name): raise SyntaxError
8e87afb329f04d5381e5a8f3c2f7cd48b954e26f /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/3187/8e87afb329f04d5381e5a8f3c2f7cd48b954e26f/test_operator.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 31571, 972, 12, 2890, 16, 508, 4672, 1002, 18453, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 31571, 972, 12, 2890, 16, 508, 4672, 1002, 18453, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self.slider.Enable(state)
if self.slider.IsEnabled() != state: self.slider.Enable(state)
def showEnable(self): state = self.isEnabled() self.slider.Enable(state)
7bd16236b92beb431ca02effaa58fbc7fa4cbb00 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/11522/7bd16236b92beb431ca02effaa58fbc7fa4cbb00/__init__.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2405, 8317, 12, 2890, 4672, 919, 273, 365, 18, 291, 1526, 1435, 309, 365, 18, 28372, 18, 2520, 1526, 1435, 480, 919, 30, 365, 18, 28372, 18, 8317, 12, 2019, 13, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2405, 8317, 12, 2890, 4672, 919, 273, 365, 18, 291, 1526, 1435, 309, 365, 18, 28372, 18, 2520, 1526, 1435, 480, 919, 30, 365, 18, 28372, 18, 8317, 12, 2019, 13, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
raise TypeError, "Rebinning axis 2 must be a NessiList!"
raise TypeError("Rebinning axis 2 must be a NessiList!")
def rebin_axis_2D(obj,axis1_out,axis2_out): """ This function rebins two primary axes for a SOM or a SO based on the given NessiList axis1 and axis2. Parameters: ---------- -> obj is the SOM or SO to be rebinned -> axis1_out is a NessiList containing the 1st axis to rebin the SOM or SO to -> axis2_out is a NessiList containing the 2nd axis to rebin the SOM or SO to Returns: ------- <- A SOM or SO that has been rebinned according to the provided axis Exceptions: ---------- <- TypeError is raised if the rebinning axis given is not a NessiList <- TypeError is raised if object being rebinned is not a SOM or a SO """ # import the helper functions import hlr_utils # set up for working through data try: axis1_out.__type__ except AttributeError: raise TypeError, "Rebinning axis 1 must be a NessiList!" try: axis2_out.__type__ except AttributeError: raise TypeError, "Rebinning axis 2 must be a NessiList!" (o_descr,d_descr)=hlr_utils.get_descr(obj) if o_descr == "number" or o_descr == "list": raise TypeError, "Do not know how to handle given type %s" %\ o_descr else: pass (result,res_descr)=hlr_utils.empty_result(obj) result=hlr_utils.copy_som_attr(result,res_descr,obj,o_descr) # iterate through the values import axis_manip for i in range(hlr_utils.get_length(obj)): axis1_in = hlr_utils.get_value(obj,i,o_descr,"x",0) axis2_in = hlr_utils.get_value(obj,i,o_descr,"x",1) val = hlr_utils.get_value(obj,i,o_descr) err2 = hlr_utils.get_err2(obj,i,o_descr) value=axis_manip.rebin_axis_2D(axis1_in, axis2_in, val, err2, axis1_out, axis2_out) xvals=[] xvals.append(axis1_out) xvals.append(axis2_out) map_so = hlr_utils.get_map_so(obj,None,i) hlr_utils.result_insert(result,res_descr,value,map_so,"all",0,xvals) return result
2b591660dbdfac3a152b52f87f0a3b8c577328f0 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/763/2b591660dbdfac3a152b52f87f0a3b8c577328f0/hlr_rebin_axis_2D.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 283, 4757, 67, 4890, 67, 22, 40, 12, 2603, 16, 4890, 21, 67, 659, 16, 4890, 22, 67, 659, 4672, 3536, 1220, 445, 283, 11862, 2795, 3354, 6515, 364, 279, 348, 1872, 578, 279, 7460, 2511, 603, 326, 864, 423, 403, 77, 682, 2654, 21, 471, 2654, 22, 18, 225, 7012, 30, 12181, 317, 1081, 353, 326, 348, 1872, 578, 7460, 358, 506, 283, 4757, 11748, 317, 2654, 21, 67, 659, 353, 279, 423, 403, 77, 682, 4191, 326, 404, 334, 2654, 358, 283, 4757, 326, 348, 1872, 578, 7460, 358, 317, 2654, 22, 67, 659, 353, 279, 423, 403, 77, 682, 4191, 326, 576, 4880, 2654, 358, 283, 4757, 326, 348, 1872, 578, 7460, 358, 225, 2860, 30, 18365, 3290, 432, 348, 1872, 578, 7460, 716, 711, 2118, 283, 4757, 11748, 4888, 358, 326, 2112, 2654, 225, 12781, 30, 12181, 3290, 3580, 353, 11531, 309, 326, 283, 4757, 2093, 2654, 864, 353, 486, 279, 423, 403, 77, 682, 3290, 3580, 353, 11531, 309, 733, 3832, 283, 4757, 11748, 353, 486, 279, 348, 1872, 578, 279, 7460, 3536, 225, 468, 1930, 326, 4222, 4186, 1930, 366, 10826, 67, 5471, 225, 468, 444, 731, 364, 5960, 3059, 501, 775, 30, 2654, 21, 67, 659, 16186, 723, 972, 1335, 6394, 30, 1002, 3580, 16, 315, 426, 4757, 2093, 2654, 404, 1297, 506, 279, 423, 403, 77, 682, 4442, 225, 775, 30, 2654, 22, 67, 659, 16186, 723, 972, 1335, 6394, 30, 1002, 3580, 2932, 426, 4757, 2093, 2654, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 283, 4757, 67, 4890, 67, 22, 40, 12, 2603, 16, 4890, 21, 67, 659, 16, 4890, 22, 67, 659, 4672, 3536, 1220, 445, 283, 11862, 2795, 3354, 6515, 364, 279, 348, 1872, 578, 279, 7460, 2511, 603, 326, 864, 423, 403, 77, 682, 2654, 21, 471, 2654, 22, 18, 225, 7012, 30, 12181, 317, 1081, 353, 326, 348, 1872, 578, 7460, 358, 506, 283, 4757, 11748, 317, 2654, 21, 67, 659, 353, 279, 423, 403, 77, 682, 4191, 326, 404, 334, 2654, 358, 283, 4757, 326, 348, 1872, 578, 7460, 358, 317, 2654, 22, 67, 659, 353, 279, 423, 403, 77, 682, 4191, 326, 576, 4880, 2654, 358, 283, 4757, 326, 348, 1872, 578, 7460, 358, 225, 2860, 2 ]
content.append(Choice())
content.append(Choice(self))
def fromDom(self, node): self.setAttributes(node) contents = self.getContents(node) content = []
0f22280071ba54237b2f9c645f8fa9542d57d244 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/14538/0f22280071ba54237b2f9c645f8fa9542d57d244/XMLSchema.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 628, 8832, 12, 2890, 16, 756, 4672, 365, 18, 542, 2498, 12, 2159, 13, 2939, 273, 365, 18, 588, 6323, 12, 2159, 13, 913, 273, 5378, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 628, 8832, 12, 2890, 16, 756, 4672, 365, 18, 542, 2498, 12, 2159, 13, 2939, 273, 365, 18, 588, 6323, 12, 2159, 13, 913, 273, 5378, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
look.i = next.i + krawli
look.i = goto.i + krawli
def movebaddy(enemy): "Tactical movement for the bad guys." next = coord(); look = coord() irun = False # This should probably be just (game.quadrant in game.state.kcmdr) + (game.state.kscmdr==game.quadrant) if game.skill >= SKILL_EXPERT: nbaddys = (((game.quadrant in game.state.kcmdr)*2 + (game.state.kscmdr==game.quadrant)*2+game.klhere*1.23+game.irhere*1.5)/2.0) else: nbaddys = (game.quadrant in game.state.kcmdr) + (game.state.kscmdr==game.quadrant) dist1 = enemy.kdist mdist = int(dist1 + 0.5); # Nearest integer distance # If SC, check with spy to see if should hi-tail it if enemy.type=='S' and \ (enemy.power <= 500.0 or (game.condition=="docked" and not damaged(DPHOTON))): irun = True motion = -QUADSIZE else: # decide whether to advance, retreat, or hold position forces = enemy.power+100.0*len(game.enemies)+400*(nbaddys-1) if not game.shldup: forces += 1000; # Good for enemy if shield is down! if not damaged(DPHASER) or not damaged(DPHOTON): if damaged(DPHASER): # phasers damaged forces += 300.0 else: forces -= 0.2*(game.energy - 2500.0) if damaged(DPHOTON): # photon torpedoes damaged forces += 300.0 else: forces -= 50.0*game.torps else: # phasers and photon tubes both out! forces += 1000.0 motion = 0 if forces <= 1000.0 and game.condition != "docked": # Typical situation motion = ((forces + randreal(200))/150.0) - 5.0 else: if forces > 1000.0: # Very strong -- move in for kill motion = (1.0 - randreal())**2 * dist1 + 1.0 if game.condition=="docked" and (game.options & OPTION_BASE): # protected by base -- back off ! motion -= game.skill*(2.0-randreal()**2) if idebug: proutn("=== MOTION = %d, FORCES = %1.2f, " % (motion, forces)) # don't move if no motion if motion==0: return # Limit motion according to skill if abs(motion) > game.skill: if motion < 0: motion = -game.skill else: motion = game.skill # calculate preferred number of steps nsteps = abs(int(motion)) if motion > 0 and nsteps > mdist: nsteps = mdist; # don't overshoot if nsteps > QUADSIZE: nsteps = QUADSIZE; # This shouldn't be necessary if nsteps < 1: nsteps = 1; # This shouldn't be necessary if idebug: proutn("NSTEPS = %d:" % nsteps) # Compute preferred values of delta X and Y m = game.sector - enemy.location if 2.0 * abs(m.i) < abs(m.j): m.i = 0 if 2.0 * abs(m.j) < abs(game.sector.i-enemy.location.i): m.j = 0 m = (motion * m).sgn() next = enemy.location # main move loop for ll in range(nsteps): if idebug: proutn(" %d" % (ll+1)) # Check if preferred position available look = next + m if m.i < 0: krawli = 1 else: krawli = -1 if m.j < 0: krawlj = 1 else: krawlj = -1 success = False attempts = 0; # Settle mysterious hang problem while attempts < 20 and not success: attempts += 1 if look.i < 0 or look.i >= QUADSIZE: if motion < 0 and tryexit(enemy, look, irun): return if krawli == m.i or m.j == 0: break look.i = next.i + krawli krawli = -krawli elif look.j < 0 or look.j >= QUADSIZE: if motion < 0 and tryexit(enemy, look, irun): return if krawlj == m.j or m.i == 0: break look.j = next.j + krawlj krawlj = -krawlj elif (game.options & OPTION_RAMMING) and game.quad[look.i][look.j] != '.': # See if enemy should ram ship if game.quad[look.i][look.j] == game.ship and \ (enemy.type == 'C' or enemy.type == 'S'): collision(rammed=True, enemy=enemy) return if krawli != m.i and m.j != 0: look.i = next.i + krawli krawli = -krawli elif krawlj != m.j and m.i != 0: look.j = next.j + krawlj krawlj = -krawlj else: break; # we have failed else: success = True if success: next = look if idebug: proutn(`next`) else: break; # done early if idebug: skip(1) if enemy.move(next): if not damaged(DSRSENS) or game.condition == "docked": proutn(_("*** %s from Sector %s") % (cramen(enemy.type), enemy.location)) if enemy.kdist < dist1: proutn(_(" advances to ")) else: proutn(_(" retreats to ")) prout("Sector %s." % next)
eafdd35f1af1e4e93d3609a0adbe768b562907e0 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/3176/eafdd35f1af1e4e93d3609a0adbe768b562907e0/sst.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3635, 70, 31934, 12, 275, 351, 93, 4672, 315, 56, 621, 1706, 26017, 364, 326, 5570, 3058, 1900, 1199, 1024, 273, 2745, 5621, 2324, 273, 2745, 1435, 277, 2681, 273, 1083, 468, 1220, 1410, 8656, 506, 2537, 261, 13957, 18, 21733, 6890, 316, 7920, 18, 2019, 18, 79, 4172, 86, 13, 397, 261, 13957, 18, 2019, 18, 79, 1017, 1264, 86, 631, 13957, 18, 21733, 6890, 13, 309, 7920, 18, 7771, 737, 1545, 12038, 15125, 67, 2294, 3194, 56, 30, 4264, 1289, 1900, 273, 261, 12443, 13957, 18, 21733, 6890, 316, 7920, 18, 2019, 18, 79, 4172, 86, 17653, 22, 397, 261, 13957, 18, 2019, 18, 79, 1017, 1264, 86, 631, 13957, 18, 21733, 6890, 17653, 22, 15, 13957, 18, 16391, 14852, 14, 21, 18, 4366, 15, 13957, 18, 481, 14852, 14, 21, 18, 25, 13176, 22, 18, 20, 13, 469, 30, 4264, 1289, 1900, 273, 261, 13957, 18, 21733, 6890, 316, 7920, 18, 2019, 18, 79, 4172, 86, 13, 397, 261, 13957, 18, 2019, 18, 79, 1017, 1264, 86, 631, 13957, 18, 21733, 6890, 13, 2411, 21, 273, 570, 351, 93, 18, 79, 4413, 3481, 376, 273, 509, 12, 4413, 21, 397, 374, 18, 25, 1769, 468, 7455, 8945, 3571, 3888, 468, 971, 8795, 16, 866, 598, 21459, 358, 2621, 309, 1410, 10118, 17, 13101, 518, 309, 570, 351, 93, 18, 723, 18920, 55, 11, 471, 521, 261, 275, 351, 93, 18, 12238, 1648, 6604, 18, 20, 578, 261, 13957, 18, 4175, 31713, 72, 975, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3635, 70, 31934, 12, 275, 351, 93, 4672, 315, 56, 621, 1706, 26017, 364, 326, 5570, 3058, 1900, 1199, 1024, 273, 2745, 5621, 2324, 273, 2745, 1435, 277, 2681, 273, 1083, 468, 1220, 1410, 8656, 506, 2537, 261, 13957, 18, 21733, 6890, 316, 7920, 18, 2019, 18, 79, 4172, 86, 13, 397, 261, 13957, 18, 2019, 18, 79, 1017, 1264, 86, 631, 13957, 18, 21733, 6890, 13, 309, 7920, 18, 7771, 737, 1545, 12038, 15125, 67, 2294, 3194, 56, 30, 4264, 1289, 1900, 273, 261, 12443, 13957, 18, 21733, 6890, 316, 7920, 18, 2019, 18, 79, 4172, 86, 17653, 22, 397, 261, 13957, 18, 2019, 18, 79, 1017, 1264, 86, 631, 13957, 18, 21733, 6890, 17653, 22, 15, 2 ]
for i in xrange(uni_len, len(token)): if token[i] == " ": continue elif self.__uc_char > 0: self.__uc_char -= 1 else: return uni_char + token[i:]
return uni_char + self.__remove_uc_chars(uni_len, token)
def __unicode_process(self, token): #change scope in if token == '\{': self.__uc_value.append(self.__uc_value[-1]) #basic error handling self.__reini_utf8_counters() return token #change scope out: evaluate dict and rebuild elif token == '\}': #self.__uc_value.pop() self.__reini_utf8_counters() return token #add a uc control elif token[:3] == '\uc': self.__uc_value[-1] = int(token[3:]) self.__reini_utf8_counters() return token #handle uc skippable char elif self.__uc_char: #if token[:1] == "\" and token[:1] == "\" pass #go for real \u token match_obj = self.__utf_exp.match(token) if match_obj is not None: #get value and handle negative case uni_char = int(match_obj.group(1)) uni_len = len(match_obj.group(1)) + 2 if uni_char < 0: uni_char += 65536 uni_char = unichr(uni_char).encode('ascii', 'xmlcharrefreplace') #if not uc0 if self.__uc_value[-1]: self.__uc_char = self.__uc_value[-1] #there is only an unicode char if len(token)<= uni_len: return uni_char #an unicode char and something else #must be after as it is splited on \ elif not self.__uc_value[-1]: print('not only token uc0 token: ' + uni_char + token[uni_len:]) return uni_char + token[uni_len:] #if not uc0 and chars else: for i in xrange(uni_len, len(token)): if token[i] == " ": continue elif self.__uc_char > 0: self.__uc_char -= 1 else: return uni_char + token[i:] #print('uc: ' + str(self.__uc_value) + 'uni: ' + str(uni_char) + 'token: ' + token) #default return token
7c70914ad30fc358bfcd7c099494b0a43682ba27 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/9125/7c70914ad30fc358bfcd7c099494b0a43682ba27/tokenize.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 9124, 67, 2567, 12, 2890, 16, 1147, 4672, 468, 3427, 2146, 316, 309, 1147, 422, 2337, 95, 4278, 365, 16186, 5286, 67, 1132, 18, 6923, 12, 2890, 16186, 5286, 67, 1132, 18919, 21, 5717, 468, 13240, 555, 5057, 365, 16186, 266, 8767, 67, 3158, 28, 67, 23426, 1435, 327, 1147, 468, 3427, 2146, 596, 30, 5956, 2065, 471, 13419, 1327, 1147, 422, 2337, 1713, 30, 468, 2890, 16186, 5286, 67, 1132, 18, 5120, 1435, 365, 16186, 266, 8767, 67, 3158, 28, 67, 23426, 1435, 327, 1147, 468, 1289, 279, 6232, 3325, 1327, 1147, 10531, 23, 65, 422, 2337, 5286, 4278, 365, 16186, 5286, 67, 1132, 18919, 21, 65, 273, 509, 12, 2316, 63, 23, 30, 5717, 365, 16186, 266, 8767, 67, 3158, 28, 67, 23426, 1435, 327, 1147, 468, 4110, 6232, 2488, 19586, 1149, 1327, 365, 16186, 5286, 67, 3001, 30, 468, 430, 1147, 10531, 21, 65, 422, 7023, 471, 1147, 10531, 21, 65, 422, 7023, 1342, 468, 3240, 364, 2863, 521, 89, 1147, 845, 67, 2603, 273, 365, 16186, 3158, 67, 2749, 18, 1916, 12, 2316, 13, 309, 845, 67, 2603, 353, 486, 599, 30, 468, 588, 460, 471, 1640, 6092, 648, 7738, 67, 3001, 273, 509, 12, 1916, 67, 2603, 18, 1655, 12, 21, 3719, 7738, 67, 1897, 273, 562, 12, 1916, 67, 2603, 18, 1655, 12, 21, 3719, 397, 576, 309, 7738, 67, 3001, 411, 374, 30, 7738, 67, 3001, 1011, 28652, 7738, 67, 3001, 273, 640, 1354, 86, 12, 318, 77, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 9124, 67, 2567, 12, 2890, 16, 1147, 4672, 468, 3427, 2146, 316, 309, 1147, 422, 2337, 95, 4278, 365, 16186, 5286, 67, 1132, 18, 6923, 12, 2890, 16186, 5286, 67, 1132, 18919, 21, 5717, 468, 13240, 555, 5057, 365, 16186, 266, 8767, 67, 3158, 28, 67, 23426, 1435, 327, 1147, 468, 3427, 2146, 596, 30, 5956, 2065, 471, 13419, 1327, 1147, 422, 2337, 1713, 30, 468, 2890, 16186, 5286, 67, 1132, 18, 5120, 1435, 365, 16186, 266, 8767, 67, 3158, 28, 67, 23426, 1435, 327, 1147, 468, 1289, 279, 6232, 3325, 1327, 1147, 10531, 23, 65, 422, 2337, 5286, 4278, 365, 16186, 5286, 67, 1132, 18919, 21, 65, 273, 509, 12, 2316, 63, 23, 30, 5717, 365, 2 ]
try: body = [output, extra] except NameError: body = [output]
body = [output]
def perform_modifyaccountstatus(req, userID, email_user_pattern, limit_to, maxpage, page, callback='yes', confirm=0): """set a disabled account to enabled and opposite""" (auth_code, auth_message) = is_adminuser(req) if auth_code != 0: return mustloginpage(req, auth_message) res = run_sql("SELECT id, email, note, password FROM user WHERE id=%s" % userID) output = "" if res: if res[0][2] in [0, "0", None]: res2 = run_sql("UPDATE user SET note=1 WHERE id=%s" % userID) output += """<b><span class="info">The account '%s' has been activated.</span></b>""" % res[0][1] if CFG_ACCESS_CONTROL_NOTIFY_USER_ABOUT_ACTIVATION == 1: emailsent = sendAccountActivatedMessage(res[0][1], res[0][1], res[0][3]) if emailsent: output += """<br><b><span class="info">An email has been sent to the owner of the account.</span></b>""" else: output += """<br><b><span class="info">Could not send an email to the owner of the account.</span></b>""" elif res[0][2] in [1, "1"]: res2 = run_sql("UPDATE user SET note=0 WHERE id=%s" % userID) output += """<b><span class="info">The account '%s' has been set inactive.</span></b>""" % res[0][1] else: output += '<b><span class="info">The account id given does not exist.</span></b>' try: body = [output, extra] except NameError: body = [output] if callback: return perform_modifyaccounts(req, email_user_pattern, limit_to, maxpage, page, content=output, callback='yes') else: return addadminbox(subtitle, body)
8e6aa1042563d2e1f44b1ffbe6e50d6cd67dbacc /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/1931/8e6aa1042563d2e1f44b1ffbe6e50d6cd67dbacc/webaccessadmin_lib.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3073, 67, 17042, 4631, 2327, 12, 3658, 16, 16299, 16, 2699, 67, 1355, 67, 4951, 16, 1800, 67, 869, 16, 943, 2433, 16, 1363, 16, 1348, 2218, 9707, 2187, 6932, 33, 20, 4672, 3536, 542, 279, 5673, 2236, 358, 3696, 471, 20759, 8395, 225, 261, 1944, 67, 710, 16, 1357, 67, 2150, 13, 273, 353, 67, 3666, 1355, 12, 3658, 13, 309, 1357, 67, 710, 480, 374, 30, 327, 1297, 5819, 2433, 12, 3658, 16, 1357, 67, 2150, 13, 225, 400, 273, 1086, 67, 4669, 2932, 4803, 612, 16, 2699, 16, 4721, 16, 2201, 4571, 729, 4852, 612, 5095, 87, 6, 738, 16299, 13, 876, 273, 1408, 309, 400, 30, 309, 400, 63, 20, 6362, 22, 65, 316, 306, 20, 16, 315, 20, 3113, 599, 14542, 400, 22, 273, 1086, 67, 4669, 2932, 8217, 729, 7855, 4721, 33, 21, 4852, 612, 5095, 87, 6, 738, 16299, 13, 876, 1011, 3536, 32, 70, 4438, 3969, 667, 1546, 1376, 6441, 1986, 2236, 1995, 87, 11, 711, 2118, 14892, 17347, 3969, 4695, 70, 2984, 3660, 738, 400, 63, 20, 6362, 21, 65, 309, 7577, 67, 13204, 67, 18248, 67, 4400, 12096, 67, 4714, 67, 2090, 5069, 67, 22271, 2689, 422, 404, 30, 2699, 7569, 273, 1366, 3032, 28724, 1079, 12, 455, 63, 20, 6362, 21, 6487, 400, 63, 20, 6362, 21, 6487, 400, 63, 20, 6362, 23, 5717, 309, 2699, 7569, 30, 876, 1011, 3536, 32, 2848, 4438, 70, 4438, 3969, 667, 1546, 1376, 6441, 979, 2699, 711, 2118, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3073, 67, 17042, 4631, 2327, 12, 3658, 16, 16299, 16, 2699, 67, 1355, 67, 4951, 16, 1800, 67, 869, 16, 943, 2433, 16, 1363, 16, 1348, 2218, 9707, 2187, 6932, 33, 20, 4672, 3536, 542, 279, 5673, 2236, 358, 3696, 471, 20759, 8395, 225, 261, 1944, 67, 710, 16, 1357, 67, 2150, 13, 273, 353, 67, 3666, 1355, 12, 3658, 13, 309, 1357, 67, 710, 480, 374, 30, 327, 1297, 5819, 2433, 12, 3658, 16, 1357, 67, 2150, 13, 225, 400, 273, 1086, 67, 4669, 2932, 4803, 612, 16, 2699, 16, 4721, 16, 2201, 4571, 729, 4852, 612, 5095, 87, 6, 738, 16299, 13, 876, 273, 1408, 309, 400, 30, 309, 400, 63, 20, 6362, 22, 65, 316, 2 ]
self.pick_initial_filename(suffix="", torrent=True)
try: self.pick_initial_filename(suffix="", torrent=True) except (OSError, IOError): raise RuntimeError
def got_metainfo(self): # FIXME: If the client is stopped before a BT download gets # its metadata, we never run this. It's not a huge deal # because it only affects the incomplete filename if not self.restarting: try: metainfo = lt.bdecode(self.metainfo) # if we don't get valid torrent metadata back, then the # metainfo is None. treat that like a runtime error. if not metainfo: raise RuntimeError() name = metainfo['info']['name'] except RuntimeError: self.handle_corrupt_torrent() return self.shortFilename = utf8_to_filename(name) self.pick_initial_filename(suffix="", torrent=True) self.update_client() self._resume_torrent()
fca7189bda6a17bc7b00cada10c6179aeb649663 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/12354/fca7189bda6a17bc7b00cada10c6179aeb649663/download.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2363, 67, 10578, 28935, 12, 2890, 4672, 468, 9852, 30, 971, 326, 1004, 353, 9627, 1865, 279, 605, 56, 4224, 5571, 468, 3639, 2097, 1982, 16, 732, 5903, 1086, 333, 18, 2597, 1807, 486, 279, 366, 21627, 10490, 468, 3639, 2724, 518, 1338, 30058, 326, 14715, 1544, 309, 486, 365, 18, 266, 18526, 30, 775, 30, 5100, 28935, 273, 13489, 18, 70, 3922, 12, 2890, 18, 10578, 28935, 13, 468, 309, 732, 2727, 1404, 336, 923, 17351, 1982, 1473, 16, 1508, 326, 468, 5100, 28935, 353, 599, 18, 225, 10116, 716, 3007, 279, 3099, 555, 18, 309, 486, 5100, 28935, 30, 1002, 7265, 1435, 508, 273, 5100, 28935, 3292, 1376, 21712, 529, 3546, 1335, 7265, 30, 365, 18, 4110, 67, 3850, 10433, 67, 13039, 547, 1435, 327, 365, 18, 6620, 5359, 273, 7718, 28, 67, 869, 67, 3459, 12, 529, 13, 775, 30, 365, 18, 11503, 67, 6769, 67, 3459, 12, 8477, 1546, 3113, 17351, 33, 5510, 13, 377, 1335, 261, 4618, 668, 16, 8340, 4672, 1002, 7265, 365, 18, 2725, 67, 2625, 1435, 365, 6315, 25158, 67, 13039, 547, 1435, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2363, 67, 10578, 28935, 12, 2890, 4672, 468, 9852, 30, 971, 326, 1004, 353, 9627, 1865, 279, 605, 56, 4224, 5571, 468, 3639, 2097, 1982, 16, 732, 5903, 1086, 333, 18, 2597, 1807, 486, 279, 366, 21627, 10490, 468, 3639, 2724, 518, 1338, 30058, 326, 14715, 1544, 309, 486, 365, 18, 266, 18526, 30, 775, 30, 5100, 28935, 273, 13489, 18, 70, 3922, 12, 2890, 18, 10578, 28935, 13, 468, 309, 732, 2727, 1404, 336, 923, 17351, 1982, 1473, 16, 1508, 326, 468, 5100, 28935, 353, 599, 18, 225, 10116, 716, 3007, 279, 3099, 555, 18, 309, 486, 5100, 28935, 30, 1002, 7265, 1435, 508, 273, 5100, 28935, 3292, 1376, 21712, 529, 3546, 1335, 7265, 30, 365, 18, 2 ]
return False
def _flowable(self, node): if node.localName=='para': style = self.styles.para_style_get(node) return platypus.Paragraph(self._textual(node), style, **(utils.attr_get(node, [], {'bulletText':'str'}))) elif node.localName=='barCode': try: from reportlab.graphics.barcode import code128 from reportlab.graphics.barcode import code39 from reportlab.graphics.barcode import code93 from reportlab.graphics.barcode import common from reportlab.graphics.barcode import fourstate from reportlab.graphics.barcode import usps except Exception, e: print 'Warning: Reportlab barcode extension not installed !' return None args = utils.attr_get(node, [], {'ratio':'float','xdim':'unit','height':'unit','checksum':'bool','quiet':'bool'}) codes = { 'codabar': lambda x: common.Codabar(x, **args), 'code11': lambda x: common.Code11(x, **args), 'code128': lambda x: code128.Code128(x, **args), 'standard39': lambda x: code39.Standard39(x, **args), 'standard93': lambda x: code93.Standard93(x, **args), 'i2of5': lambda x: common.I2of5(x, **args), 'extended39': lambda x: code39.Extended39(x, **args), 'extended93': lambda x: code93.Extended93(x, **args), 'msi': lambda x: common.MSI(x, **args), 'fim': lambda x: usps.FIM(x, **args), 'postnet': lambda x: usps.POSTNET(x, **args), } code = 'code128' if node.hasAttribute('code'): code = node.getAttribute('code').lower() return codes[code](self._textual(node)) elif node.localName=='name': self.styles.names[ node.getAttribute('id')] = node.getAttribute('value') return None elif node.localName=='xpre': style = self.styles.para_style_get(node) return platypus.XPreformatted(self._textual(node), style, **(utils.attr_get(node, [], {'bulletText':'str','dedent':'int','frags':'int'}))) elif node.localName=='pre': style = self.styles.para_style_get(node) return platypus.Preformatted(self._textual(node), style, **(utils.attr_get(node, [], {'bulletText':'str','dedent':'int'}))) elif node.localName=='illustration': return self._illustration(node) elif node.localName=='blockTable': return self._table(node) elif node.localName=='title': styles = reportlab.lib.styles.getSampleStyleSheet() style = styles['Title'] return platypus.Paragraph(self._textual(node), style, **(utils.attr_get(node, [], {'bulletText':'str'}))) elif node.localName=='h1': styles = reportlab.lib.styles.getSampleStyleSheet() style = styles['Heading1'] return platypus.Paragraph(self._textual(node), style, **(utils.attr_get(node, [], {'bulletText':'str'}))) elif node.localName=='h2': styles = reportlab.lib.styles.getSampleStyleSheet() style = styles['Heading2'] return platypus.Paragraph(self._textual(node), style, **(utils.attr_get(node, [], {'bulletText':'str'}))) elif node.localName=='h3': styles = reportlab.lib.styles.getSampleStyleSheet() style = styles['Heading3'] return platypus.Paragraph(self._textual(node), style, **(utils.attr_get(node, [], {'bulletText':'str'}))) elif node.localName=='image': if not node.hasAttribute('file'): if node.hasAttribute('name'): image_data = self.doc.images[node.getAttribute('name')].read() else: import base64 image_data = base64.decodestring(node.firstChild.nodeValue) image = StringIO.StringIO(image_data) return platypus.Image(image, mask=(250,255,250,255,250,255), **(utils.attr_get(node, ['width','height']))) else: return platypus.Image(node.getAttribute('file'), mask=(250,255,250,255,250,255), **(utils.attr_get(node, ['width','height'])))
e809ecd3d58900ecd3010b0a6efd77ec67e70de0 /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/7397/e809ecd3d58900ecd3010b0a6efd77ec67e70de0/trml2pdf.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 2426, 429, 12, 2890, 16, 756, 4672, 309, 756, 18, 3729, 461, 18920, 25072, 4278, 2154, 273, 365, 18, 10218, 18, 25072, 67, 4060, 67, 588, 12, 2159, 13, 327, 29838, 879, 407, 18, 17719, 12, 2890, 6315, 955, 1462, 12, 2159, 3631, 2154, 16, 2826, 12, 5471, 18, 1747, 67, 588, 12, 2159, 16, 5378, 16, 13666, 70, 19994, 1528, 11, 2497, 701, 11, 97, 20349, 1327, 756, 18, 3729, 461, 18920, 3215, 1085, 4278, 775, 30, 628, 2605, 7411, 18, 31586, 18, 3215, 710, 1930, 981, 10392, 628, 2605, 7411, 18, 31586, 18, 3215, 710, 1930, 981, 5520, 628, 2605, 7411, 18, 31586, 18, 3215, 710, 1930, 981, 11180, 628, 2605, 7411, 18, 31586, 18, 3215, 710, 1930, 2975, 628, 2605, 7411, 18, 31586, 18, 3215, 710, 1930, 12792, 2019, 628, 2605, 7411, 18, 31586, 18, 3215, 710, 1930, 584, 1121, 1335, 1185, 16, 425, 30, 1172, 296, 6210, 30, 8706, 7411, 21231, 2710, 486, 5876, 401, 11, 327, 599, 833, 273, 2990, 18, 1747, 67, 588, 12, 2159, 16, 5378, 16, 13666, 9847, 11, 2497, 5659, 17023, 92, 3509, 11, 2497, 4873, 17023, 4210, 11, 2497, 4873, 17023, 15149, 11, 2497, 6430, 17023, 20380, 11, 2497, 6430, 11, 6792, 6198, 273, 288, 296, 1559, 378, 297, 4278, 3195, 619, 30, 2975, 18, 29633, 378, 297, 12, 92, 16, 2826, 1968, 3631, 296, 710, 2499, 4278, 3195, 619, 30, 2975, 18, 1085, 2499, 12, 92, 16, 2826, 1968, 3631, 296, 710, 10392, 4278, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 2426, 429, 12, 2890, 16, 756, 4672, 309, 756, 18, 3729, 461, 18920, 25072, 4278, 2154, 273, 365, 18, 10218, 18, 25072, 67, 4060, 67, 588, 12, 2159, 13, 327, 29838, 879, 407, 18, 17719, 12, 2890, 6315, 955, 1462, 12, 2159, 3631, 2154, 16, 2826, 12, 5471, 18, 1747, 67, 588, 12, 2159, 16, 5378, 16, 13666, 70, 19994, 1528, 11, 2497, 701, 11, 97, 20349, 1327, 756, 18, 3729, 461, 18920, 3215, 1085, 4278, 775, 30, 628, 2605, 7411, 18, 31586, 18, 3215, 710, 1930, 981, 10392, 628, 2605, 7411, 18, 31586, 18, 3215, 710, 1930, 981, 5520, 628, 2605, 7411, 18, 31586, 18, 3215, 710, 1930, 981, 11180, 628, 2605, 7411, 18, 31586, 18, 2 ]
'There is no Python module or object named "%s".' % path)
'No Python documentation found for %s.' % repr(path))
def do_GET(self): path = self.path if path[-5:] == '.html': path = path[:-5] if path[:1] == '/': path = path[1:] if path and path != '.': try: p, x = locate(path) except DocImportError, value: self.send_document(path, html.escape( 'problem with %s - %s' % (value.filename, value.args))) return if x: self.send_document(describe(x), html.document(x)) else: self.send_document(path,
c59006cf0425a2636c8284ef2601f7f489fad815 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/3187/c59006cf0425a2636c8284ef2601f7f489fad815/pydoc.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 741, 67, 3264, 12, 2890, 4672, 589, 273, 365, 18, 803, 309, 589, 18919, 25, 26894, 422, 2418, 2620, 4278, 589, 273, 589, 10531, 17, 25, 65, 309, 589, 10531, 21, 65, 422, 2023, 30, 589, 273, 589, 63, 21, 26894, 309, 589, 471, 589, 480, 2611, 30, 775, 30, 293, 16, 619, 273, 10627, 12, 803, 13, 1335, 3521, 5010, 668, 16, 460, 30, 365, 18, 4661, 67, 5457, 12, 803, 16, 1729, 18, 6939, 12, 296, 18968, 598, 738, 87, 300, 738, 87, 11, 738, 261, 1132, 18, 3459, 16, 460, 18, 1968, 20349, 327, 309, 619, 30, 365, 18, 4661, 67, 5457, 12, 22748, 12, 92, 3631, 1729, 18, 5457, 12, 92, 3719, 469, 30, 365, 18, 4661, 67, 5457, 12, 803, 16, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 741, 67, 3264, 12, 2890, 4672, 589, 273, 365, 18, 803, 309, 589, 18919, 25, 26894, 422, 2418, 2620, 4278, 589, 273, 589, 10531, 17, 25, 65, 309, 589, 10531, 21, 65, 422, 2023, 30, 589, 273, 589, 63, 21, 26894, 309, 589, 471, 589, 480, 2611, 30, 775, 30, 293, 16, 619, 273, 10627, 12, 803, 13, 1335, 3521, 5010, 668, 16, 460, 30, 365, 18, 4661, 67, 5457, 12, 803, 16, 1729, 18, 6939, 12, 296, 18968, 598, 738, 87, 300, 738, 87, 11, 738, 261, 1132, 18, 3459, 16, 460, 18, 1968, 20349, 327, 309, 619, 30, 365, 18, 4661, 67, 5457, 12, 22748, 12, 92, 3631, 1729, 18, 5457, 12, 92, 3719, 469, 30, 2 ]
"""
'''
def testFile(self): path = os.path.join(tests_path, 'testfiles', 'test.pt')
1cfc7ddd1cac0110cca3e909215477e1c59bbca3 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/9523/1cfc7ddd1cac0110cca3e909215477e1c59bbca3/test_directives.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 812, 12, 2890, 4672, 589, 273, 1140, 18, 803, 18, 5701, 12, 16341, 67, 803, 16, 296, 3813, 2354, 2187, 296, 3813, 18, 337, 6134, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 812, 12, 2890, 4672, 589, 273, 1140, 18, 803, 18, 5701, 12, 16341, 67, 803, 16, 296, 3813, 2354, 2187, 296, 3813, 18, 337, 6134, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
'anchor': ('AjaxForeignKey', ["orm['datatree.DataTree']"], {}),
'anchor': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['datatree.DataTree']"}),
def backwards(self, orm): # Deleting model 'StudentClassRegModuleInfo' db.delete_table('modules_studentclassregmoduleinfo') # Deleting model 'RemoteProfile' db.delete_table('modules_remoteprofile') # Deleting model 'ClassRegModuleInfo' db.delete_table('modules_classregmoduleinfo') # Deleting model 'SATPrepTeacherModuleInfo' db.delete_table('modules_satprepteachermoduleinfo') # Deleting model 'ProgramModuleObj' db.delete_table('modules_programmoduleobj') # Deleting model 'CreditCardModuleInfo' db.delete_table('modules_creditcardmoduleinfo') # Deleting model 'SATPrepAdminModuleInfo' db.delete_table('modules_satprepadminmoduleinfo') # Deleting model 'DBReceipt' db.delete_table('modules_dbreceipt') # Dropping ManyToManyField 'RemoteProfile.volunteer_times' db.delete_table('modules_remoteprofile_volunteer_times') # Dropping ManyToManyField 'RemoteProfile.bus_runs' db.delete_table('modules_remoteprofile_bus_runs')
2ef0cc4f8263d0a1c5513b549ab9d107a9531d54 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/12041/2ef0cc4f8263d0a1c5513b549ab9d107a9531d54/0001_initial.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 12727, 12, 2890, 16, 13969, 4672, 225, 468, 20988, 310, 938, 296, 19943, 319, 797, 1617, 3120, 966, 11, 1319, 18, 3733, 67, 2121, 2668, 6400, 67, 26240, 1106, 1574, 2978, 1376, 6134, 225, 468, 20988, 310, 938, 296, 5169, 4029, 11, 1319, 18, 3733, 67, 2121, 2668, 6400, 67, 7222, 5040, 6134, 225, 468, 20988, 310, 938, 296, 797, 1617, 3120, 966, 11, 1319, 18, 3733, 67, 2121, 2668, 6400, 67, 1106, 1574, 2978, 1376, 6134, 225, 468, 20988, 310, 938, 296, 55, 789, 15543, 56, 13798, 264, 3120, 966, 11, 1319, 18, 3733, 67, 2121, 2668, 6400, 67, 12973, 1484, 337, 13798, 1035, 369, 725, 1376, 6134, 225, 468, 20988, 310, 938, 296, 9459, 3120, 2675, 11, 1319, 18, 3733, 67, 2121, 2668, 6400, 67, 12890, 2978, 2603, 6134, 225, 468, 20988, 310, 938, 296, 16520, 6415, 3120, 966, 11, 1319, 18, 3733, 67, 2121, 2668, 6400, 67, 20688, 3327, 2978, 1376, 6134, 225, 468, 20988, 310, 938, 296, 55, 789, 15543, 4446, 3120, 966, 11, 1319, 18, 3733, 67, 2121, 2668, 6400, 67, 12973, 19109, 3666, 2978, 1376, 6134, 225, 468, 20988, 310, 938, 296, 2290, 15636, 11, 1319, 18, 3733, 67, 2121, 2668, 6400, 67, 1966, 8606, 8138, 6134, 225, 468, 10895, 1382, 19903, 12601, 974, 296, 5169, 4029, 18, 15416, 318, 736, 264, 67, 8293, 11, 1319, 18, 3733, 67, 2121, 2668, 6400, 67, 7222, 5040, 67, 15416, 318, 736, 264, 67, 8293, 6134, 225, 468, 10895, 1382, 19903, 12601, 974, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 12727, 12, 2890, 16, 13969, 4672, 225, 468, 20988, 310, 938, 296, 19943, 319, 797, 1617, 3120, 966, 11, 1319, 18, 3733, 67, 2121, 2668, 6400, 67, 26240, 1106, 1574, 2978, 1376, 6134, 225, 468, 20988, 310, 938, 296, 5169, 4029, 11, 1319, 18, 3733, 67, 2121, 2668, 6400, 67, 7222, 5040, 6134, 225, 468, 20988, 310, 938, 296, 797, 1617, 3120, 966, 11, 1319, 18, 3733, 67, 2121, 2668, 6400, 67, 1106, 1574, 2978, 1376, 6134, 225, 468, 20988, 310, 938, 296, 55, 789, 15543, 56, 13798, 264, 3120, 966, 11, 1319, 18, 3733, 67, 2121, 2668, 6400, 67, 12973, 1484, 337, 13798, 1035, 369, 725, 1376, 6134, 225, 468, 20988, 310, 938, 296, 9459, 3120, 2675, 2 ]
result = ll_math_modf(10.1)
result = Implementation.ll_math_modf(10.1)
def test_ll_modf(): result = ll_math_modf(10.1) assert result.item0 == math.modf(10.1)[0] assert result.item1 == math.modf(10.1)[1]
dead949a8590d718166a0efd74e0cb7a9160bcc3 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/6934/dead949a8590d718166a0efd74e0cb7a9160bcc3/test_ll_math.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 2906, 67, 1711, 74, 13332, 563, 273, 25379, 18, 2906, 67, 15949, 67, 1711, 74, 12, 2163, 18, 21, 13, 1815, 563, 18, 1726, 20, 422, 4233, 18, 1711, 74, 12, 2163, 18, 21, 25146, 20, 65, 1815, 563, 18, 1726, 21, 422, 4233, 18, 1711, 74, 12, 2163, 18, 21, 25146, 21, 65, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 2906, 67, 1711, 74, 13332, 563, 273, 25379, 18, 2906, 67, 15949, 67, 1711, 74, 12, 2163, 18, 21, 13, 1815, 563, 18, 1726, 20, 422, 4233, 18, 1711, 74, 12, 2163, 18, 21, 25146, 20, 65, 1815, 563, 18, 1726, 21, 422, 4233, 18, 1711, 74, 12, 2163, 18, 21, 25146, 21, 65, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
Type to use in computing the standard deviation. For arrays of integer type the default is float32, for arrays of float types it is the same as the array type.
Type to use in computing the standard deviation. For arrays of integer type the default is float32, for arrays of float types it is the same as the array type.
def std(a, axis=None, dtype=None, out=None): """Compute the standard deviation along the specified axis. *Description* Returns the standard deviation of the array elements, a measure of the spread of a distribution. The standard deviation is computed for the flattened array by default, otherwise over the specified axis. *Parameters*: axis : integer Axis along which the standard deviation is computed. The default is to compute the standard deviation of the flattened array. dtype : type Type to use in computing the standard deviation. For arrays of integer type the default is float32, for arrays of float types it is the same as the array type. out : ndarray Alternative output array in which to place the result. It must have the same shape as the expected output but the type will be cast if necessary. *Returns*: standard_deviation : The return type varies, see above. A new array holding the result is returned unless out is specified, in which case a reference to out is returned. *SeeAlso*: var Variance mean Average *Notes* The standard deviation is the square root of the average of the squared deviations from the mean, i.e. var = sqrt(mean((x - x.mean())**2)). The computed standard deviation is biased, i.e., the mean is computed by dividing by the number of elements, N, rather than by N-1. """ try: std = a.std except AttributeError: return _wrapit(a, 'std', axis, dtype, out) return std(axis, dtype, out)
fe2f8b811f8f87475f51396eca9a848d2746ab2b /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/14925/fe2f8b811f8f87475f51396eca9a848d2746ab2b/fromnumeric.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2044, 12, 69, 16, 2654, 33, 7036, 16, 3182, 33, 7036, 16, 596, 33, 7036, 4672, 3536, 7018, 326, 4529, 17585, 7563, 326, 1269, 2654, 18, 225, 380, 3291, 14, 225, 2860, 326, 4529, 17585, 434, 326, 526, 2186, 16, 279, 6649, 434, 326, 15103, 434, 279, 7006, 18, 1021, 4529, 17585, 353, 8470, 364, 326, 14171, 526, 635, 805, 16, 3541, 1879, 326, 1269, 2654, 18, 225, 380, 2402, 14, 30, 225, 2654, 294, 3571, 15509, 7563, 1492, 326, 4529, 17585, 353, 8470, 18, 1021, 805, 353, 358, 3671, 326, 4529, 17585, 434, 326, 14171, 526, 18, 225, 3182, 294, 618, 1412, 358, 999, 316, 20303, 326, 4529, 17585, 18, 2457, 5352, 434, 3571, 618, 326, 805, 353, 1431, 1578, 16, 364, 5352, 434, 1431, 1953, 518, 353, 326, 1967, 487, 326, 526, 618, 18, 225, 596, 294, 8304, 21498, 1535, 876, 526, 316, 1492, 358, 3166, 326, 563, 18, 2597, 1297, 1240, 326, 1967, 2179, 487, 326, 2665, 876, 1496, 326, 618, 903, 506, 4812, 309, 4573, 18, 225, 380, 1356, 14, 30, 225, 4529, 67, 323, 13243, 294, 1021, 327, 618, 569, 606, 16, 2621, 5721, 18, 432, 394, 526, 19918, 326, 563, 353, 2106, 3308, 596, 353, 1269, 16, 316, 1492, 648, 279, 2114, 358, 596, 353, 2106, 18, 225, 380, 9704, 1067, 2048, 14, 30, 225, 569, 11487, 1359, 3722, 27275, 225, 380, 18063, 14, 225, 1021, 4529, 17585, 353, 326, 8576, 1365, 434, 326, 8164, 434, 326, 21778, 27492, 1012, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2044, 12, 69, 16, 2654, 33, 7036, 16, 3182, 33, 7036, 16, 596, 33, 7036, 4672, 3536, 7018, 326, 4529, 17585, 7563, 326, 1269, 2654, 18, 225, 380, 3291, 14, 225, 2860, 326, 4529, 17585, 434, 326, 526, 2186, 16, 279, 6649, 434, 326, 15103, 434, 279, 7006, 18, 1021, 4529, 17585, 353, 8470, 364, 326, 14171, 526, 635, 805, 16, 3541, 1879, 326, 1269, 2654, 18, 225, 380, 2402, 14, 30, 225, 2654, 294, 3571, 15509, 7563, 1492, 326, 4529, 17585, 353, 8470, 18, 1021, 805, 353, 358, 3671, 326, 4529, 17585, 434, 326, 14171, 526, 18, 225, 3182, 294, 618, 1412, 358, 999, 316, 20303, 326, 4529, 17585, 18, 2457, 5352, 434, 3571, 618, 326, 805, 2 ]
7/2 1/2 3 4/3 2.82842712475 1
(7/2) (1/2) 3 (4/3) 2.82842712475 1
def test(): '''\ Test function for rat module. The expected output is (module some differences in floating precission): -1 -1 0 0L 0.1 (0.1+0j) [Rat(1,2), Rat(-3,10), Rat(1,25), Rat(1,4)] [Rat(-3,10), Rat(1,25), Rat(1,4), Rat(1,2)] 0 11/10 11/10 1.1 OK 2 1.5 3/2 (1.5+1.5j) 15707963/5000000 2 2 2.0 (2+0j) 4 0 4 1 4 0 3.5 0.5 3.0 1.33333333333 2.82842712475 1 7/2 1/2 3 4/3 2.82842712475 1 (3.5+1.5j) (0.5-1.5j) (3+3j) (0.666666666667-0.666666666667j) (1.43248815986+2.43884761145j) 1 1.5 1 1.5 (1.5+0j) 3.5 -0.5 3.0 0.75 2.25 -1 3.0 0.0 2.25 1.0 1.83711730709 0 3.0 0.0 2.25 1.0 1.83711730709 1 (3+1.5j) -1.5j (2.25+2.25j) (0.5-0.5j) (1.50768393746+1.04970907623j) -1 3/2 1 1.5 (1.5+0j) 7/2 -1/2 3 3/4 9/4 -1 3.0 0.0 2.25 1.0 1.83711730709 -1 3 0 9/4 1 1.83711730709 0 (3+1.5j) -1.5j (2.25+2.25j) (0.5-0.5j) (1.50768393746+1.04970907623j) -1 (1.5+1.5j) (1.5+1.5j) (3.5+1.5j) (-0.5+1.5j) (3+3j) (0.75+0.75j) 4.5j -1 (3+1.5j) 1.5j (2.25+2.25j) (1+1j) (1.18235814075+2.85446505899j) 1 (3+1.5j) 1.5j (2.25+2.25j) (1+1j) (1.18235814075+2.85446505899j) 1 (3+3j) 0j 4.5j (1+0j) (-0.638110484918+0.705394566962j) 0 ''' print rat(-1L, 1) print rat(1, -1) a = rat(1, 10) print int(a), long(a), float(a), complex(a) b = rat(2, 5) l = [a+b, a-b, a*b, a/b] print l l.sort() print l print rat(0, 1) print a+1 print a+1L print a+1.0 try: print rat(1, 0) raise SystemError, 'should have been ZeroDivisionError' except ZeroDivisionError: print 'OK' print rat(2), rat(1.5), rat(3, 2), rat(1.5+1.5j), rat(31415926,10000000) list = [2, 1.5, rat(3,2), 1.5+1.5j] for i in list: print i, if type(i) is not ComplexType: print int(i), float(i), print complex(i) print for j in list: print i + j, i - j, i * j, i / j, i ** j, cmp(i, j)
416d656b413374f6e692437040666218ecb0cce3 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8125/416d656b413374f6e692437040666218ecb0cce3/Rat.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 13332, 875, 8314, 7766, 445, 364, 15183, 1605, 18, 225, 1021, 2665, 876, 353, 261, 2978, 2690, 16440, 316, 13861, 13382, 19710, 4672, 300, 21, 300, 21, 374, 374, 48, 374, 18, 21, 261, 20, 18, 21, 15, 20, 78, 13, 306, 29635, 12, 21, 16, 22, 3631, 534, 270, 19236, 23, 16, 2163, 3631, 534, 270, 12, 21, 16, 2947, 3631, 534, 270, 12, 21, 16, 24, 25887, 306, 29635, 19236, 23, 16, 2163, 3631, 534, 270, 12, 21, 16, 2947, 3631, 534, 270, 12, 21, 16, 24, 3631, 534, 270, 12, 21, 16, 22, 25887, 374, 4648, 19, 2163, 4648, 19, 2163, 404, 18, 21, 7791, 576, 404, 18, 25, 890, 19, 22, 261, 21, 18, 25, 15, 21, 18, 25, 78, 13, 4711, 7301, 7235, 4449, 19, 25, 9449, 576, 576, 576, 18, 20, 261, 22, 15, 20, 78, 13, 225, 1059, 374, 1059, 404, 1059, 374, 890, 18, 25, 374, 18, 25, 890, 18, 20, 404, 18, 18094, 18094, 3707, 23, 576, 18, 11149, 5193, 5324, 24734, 5877, 404, 261, 27, 19, 22, 13, 261, 21, 19, 22, 13, 890, 261, 24, 19, 23, 13, 576, 18, 11149, 5193, 5324, 24734, 5877, 404, 261, 23, 18, 25, 15, 21, 18, 25, 78, 13, 261, 20, 18, 25, 17, 21, 18, 25, 78, 13, 261, 23, 15, 23, 78, 13, 261, 20, 18, 31684, 31684, 6028, 9599, 17, 20, 18, 31684, 31684, 6028, 9599, 78, 13, 261, 21, 18, 24, 1578, 24, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 13332, 875, 8314, 7766, 445, 364, 15183, 1605, 18, 225, 1021, 2665, 876, 353, 261, 2978, 2690, 16440, 316, 13861, 13382, 19710, 4672, 300, 21, 300, 21, 374, 374, 48, 374, 18, 21, 261, 20, 18, 21, 15, 20, 78, 13, 306, 29635, 12, 21, 16, 22, 3631, 534, 270, 19236, 23, 16, 2163, 3631, 534, 270, 12, 21, 16, 2947, 3631, 534, 270, 12, 21, 16, 24, 25887, 306, 29635, 19236, 23, 16, 2163, 3631, 534, 270, 12, 21, 16, 2947, 3631, 534, 270, 12, 21, 16, 24, 3631, 534, 270, 12, 21, 16, 22, 25887, 374, 4648, 19, 2163, 4648, 19, 2163, 404, 18, 21, 7791, 576, 404, 18, 25, 890, 19, 22, 261, 21, 2 ]
FieldLenField("len", None, length_of="data", fmt="B", adjust=lambda p,x:x+6),
FieldLenField("len", None, length_of="data", fmt="B", adjust=lambda p,x:x+2),
def __new__(cls, name, bases, dct): newcls = super(PPP_IPCP_Specific_Option_metaclass, cls).__new__(cls, name, bases, dct) PPP_IPCP_Option._register(newcls)
affecf331b2e4c074e658f4768b06d56fcab287d /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/7311/affecf331b2e4c074e658f4768b06d56fcab287d/ppp.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2704, 972, 12, 6429, 16, 508, 16, 8337, 16, 18253, 4672, 394, 6429, 273, 2240, 12, 6584, 52, 67, 2579, 4258, 67, 9969, 67, 1895, 67, 3901, 1106, 16, 2028, 2934, 972, 2704, 972, 12, 6429, 16, 508, 16, 8337, 16, 18253, 13, 453, 6584, 67, 2579, 4258, 67, 1895, 6315, 4861, 12, 2704, 6429, 13, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2704, 972, 12, 6429, 16, 508, 16, 8337, 16, 18253, 4672, 394, 6429, 273, 2240, 12, 6584, 52, 67, 2579, 4258, 67, 9969, 67, 1895, 67, 3901, 1106, 16, 2028, 2934, 972, 2704, 972, 12, 6429, 16, 508, 16, 8337, 16, 18253, 13, 453, 6584, 67, 2579, 4258, 67, 1895, 6315, 4861, 12, 2704, 6429, 13, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self._prompt_wait = [self._prompt] + [re.compile(x) for x in self._ask]
self._prompt_wait = [self._prompt] + [re.compile(x) for x in self._ask] + \ ['Break [0-9]+']
def __init__(self, script_subdirectory=None, logfile=None, server=None): """ Create an instance of the Maxima interpreter. """ # TODO: Input and output prompts in maxima can be changed by # setting inchar and outchar.. eval_using_file_cutoff = 256 self.__eval_using_file_cutoff = eval_using_file_cutoff STARTUP = '%s/local/bin/sage-maxima.lisp'%SAGE_ROOT if not os.path.exists(STARTUP): raise RuntimeError, 'You must get the file local/bin/sage-maxima.lisp' Expect.__init__(self, name = 'maxima', prompt = '\(\%i[0-9]+\)', command = 'maxima -p "%s"'%STARTUP, maxread = 10000, script_subdirectory = script_subdirectory, restart_on_ctrlc = False, verbose_start = False, init_code = ['display2d : false', # no ascii art output #'load("mactex-utilities")' # latex instead of plain tex from tex command (broken in maxima-5.11.0!) ], logfile = logfile, eval_using_file_cutoff=eval_using_file_cutoff) self._display_prompt = '<sage-display>' # must match what is in the file local/ibn/sage-maxima.lisp!! self._output_prompt_re = re.compile('\(\%o[0-9]+\)') self._ask = ['zero or nonzero?', 'an integer?', 'positive, negative, or zero?', 'positive or negative?'] self._prompt_wait = [self._prompt] + [re.compile(x) for x in self._ask] self._error_re = re.compile('(debugmode|Incorrect syntax|Maxima encountered a Lisp error)') self._display2d = False
c3fa2ccccfc81d125253bc58f7a5acd36a170369 /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/9890/c3fa2ccccfc81d125253bc58f7a5acd36a170369/maxima.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 2728, 67, 1717, 5149, 33, 7036, 16, 15204, 33, 7036, 16, 1438, 33, 7036, 4672, 3536, 1788, 392, 791, 434, 326, 4238, 13888, 16048, 18, 3536, 468, 2660, 30, 2741, 471, 876, 3012, 1092, 316, 943, 13888, 848, 506, 3550, 635, 468, 3637, 316, 3001, 471, 596, 3001, 838, 5302, 67, 9940, 67, 768, 67, 16131, 273, 8303, 365, 16186, 8622, 67, 9940, 67, 768, 67, 16131, 273, 5302, 67, 9940, 67, 768, 67, 16131, 10485, 3079, 273, 1995, 87, 19, 3729, 19, 4757, 19, 87, 410, 17, 1896, 13888, 18, 80, 23831, 11, 9, 55, 2833, 67, 9185, 309, 486, 1140, 18, 803, 18, 1808, 12, 7570, 3079, 4672, 1002, 7265, 16, 296, 6225, 1297, 336, 326, 585, 1191, 19, 4757, 19, 87, 410, 17, 1896, 13888, 18, 80, 23831, 11, 15510, 16186, 2738, 972, 12, 2890, 16, 508, 273, 296, 1896, 13888, 2187, 6866, 273, 2337, 4713, 9, 77, 63, 20, 17, 29, 26446, 13, 2187, 1296, 273, 296, 1896, 13888, 300, 84, 2213, 87, 5187, 9, 7570, 3079, 16, 943, 896, 273, 12619, 16, 2728, 67, 1717, 5149, 273, 2728, 67, 1717, 5149, 16, 7870, 67, 265, 67, 16277, 71, 273, 1083, 16, 3988, 67, 1937, 273, 1083, 16, 1208, 67, 710, 273, 10228, 5417, 22, 72, 294, 629, 2187, 225, 468, 1158, 11384, 3688, 876, 25767, 945, 2932, 81, 621, 338, 17, 1367, 1961, 31241, 282, 468, 25079, 3560, 434, 7351, 16573, 628, 16573, 1296, 261, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 2728, 67, 1717, 5149, 33, 7036, 16, 15204, 33, 7036, 16, 1438, 33, 7036, 4672, 3536, 1788, 392, 791, 434, 326, 4238, 13888, 16048, 18, 3536, 468, 2660, 30, 2741, 471, 876, 3012, 1092, 316, 943, 13888, 848, 506, 3550, 635, 468, 3637, 316, 3001, 471, 596, 3001, 838, 5302, 67, 9940, 67, 768, 67, 16131, 273, 8303, 365, 16186, 8622, 67, 9940, 67, 768, 67, 16131, 273, 5302, 67, 9940, 67, 768, 67, 16131, 10485, 3079, 273, 1995, 87, 19, 3729, 19, 4757, 19, 87, 410, 17, 1896, 13888, 18, 80, 23831, 11, 9, 55, 2833, 67, 9185, 309, 486, 1140, 18, 803, 18, 1808, 12, 7570, 3079, 4672, 1002, 7265, 2 ]
options={ 'otherTable' : self.otherClass.sqlmeta.table, 'otherID' : self.otherClass.sqlmeta.idName, 'interTable' : self.intermediateTable, 'table' : self.soClass.sqlmeta.table, 'ID' : self.soClass.sqlmeta.idName, 'joinCol' : self.joinColumn, 'otherCol' : self.otherColumn, 'idValue' : inst.id, } clause = '''\ %(otherTable)s.%(otherID)s = %(interTable)s.%(otherCol)s and %(interTable)s.%(joinCol)s = %(table)s.%(ID)s and %(table)s.%(ID)s = %(idValue)s''' % options if inst.sqlmeta._perConnection: conn = inst._connection else: conn = None results = self.otherClass.select(sqlbuilder.SQLConstant(clause), clauseTables=( options['table'], options['otherTable'], options['interTable'],
results = self.otherClass.select(sqlbuilder.AND( OtherTableToJoin( self.otherClass.sqlmeta.table, self.otherClass.sqlmeta.idName, self.intermediateTable, self.otherColumn
def performJoin(self, inst): options={ 'otherTable' : self.otherClass.sqlmeta.table, 'otherID' : self.otherClass.sqlmeta.idName, 'interTable' : self.intermediateTable, 'table' : self.soClass.sqlmeta.table, 'ID' : self.soClass.sqlmeta.idName, 'joinCol' : self.joinColumn, 'otherCol' : self.otherColumn, 'idValue' : inst.id, } clause = '''\
c46bdb4ca9c0ca6688b20cd27a7f2fe80c7f5052 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8798/c46bdb4ca9c0ca6688b20cd27a7f2fe80c7f5052/joins.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3073, 4572, 12, 2890, 16, 1804, 4672, 702, 5899, 296, 3011, 1388, 11, 294, 365, 18, 3011, 797, 18, 4669, 3901, 18, 2121, 16, 296, 3011, 734, 11, 294, 365, 18, 3011, 797, 18, 4669, 3901, 18, 350, 461, 16, 296, 2761, 1388, 11, 294, 365, 18, 2761, 6785, 1388, 16, 296, 2121, 11, 294, 365, 18, 2048, 797, 18, 4669, 3901, 18, 2121, 16, 296, 734, 11, 294, 365, 18, 2048, 797, 18, 4669, 3901, 18, 350, 461, 16, 296, 5701, 914, 11, 294, 365, 18, 5701, 1494, 16, 296, 3011, 914, 11, 294, 365, 18, 3011, 1494, 16, 296, 350, 620, 11, 294, 1804, 18, 350, 16, 289, 6591, 273, 875, 8314, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3073, 4572, 12, 2890, 16, 1804, 4672, 702, 5899, 296, 3011, 1388, 11, 294, 365, 18, 3011, 797, 18, 4669, 3901, 18, 2121, 16, 296, 3011, 734, 11, 294, 365, 18, 3011, 797, 18, 4669, 3901, 18, 350, 461, 16, 296, 2761, 1388, 11, 294, 365, 18, 2761, 6785, 1388, 16, 296, 2121, 11, 294, 365, 18, 2048, 797, 18, 4669, 3901, 18, 2121, 16, 296, 734, 11, 294, 365, 18, 2048, 797, 18, 4669, 3901, 18, 350, 461, 16, 296, 5701, 914, 11, 294, 365, 18, 5701, 1494, 16, 296, 3011, 914, 11, 294, 365, 18, 3011, 1494, 16, 296, 350, 620, 11, 294, 1804, 18, 350, 16, 289, 6591, 273, 875, 8314, 2, -100, -100, -100, -100 ]
objects[self.objtype, name] = self.env.docname
objects[key] = self.env.docname
def add_target_and_index(self, name, sig, signode): if name not in self.state.document.ids: signode['names'].append(name) signode['ids'].append(name) signode['first'] = (not self.names) self.state.document.note_explicit_target(signode)
8848faea55e18663fe95d1b3d8e897863f1a11d2 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/7032/8848faea55e18663fe95d1b3d8e897863f1a11d2/rst.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 527, 67, 3299, 67, 464, 67, 1615, 12, 2890, 16, 508, 16, 3553, 16, 1573, 390, 4672, 309, 508, 486, 316, 365, 18, 2019, 18, 5457, 18, 2232, 30, 1573, 390, 3292, 1973, 29489, 6923, 12, 529, 13, 1573, 390, 3292, 2232, 29489, 6923, 12, 529, 13, 1573, 390, 3292, 3645, 3546, 273, 261, 902, 365, 18, 1973, 13, 365, 18, 2019, 18, 5457, 18, 7652, 67, 16511, 67, 3299, 12, 2977, 390, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 527, 67, 3299, 67, 464, 67, 1615, 12, 2890, 16, 508, 16, 3553, 16, 1573, 390, 4672, 309, 508, 486, 316, 365, 18, 2019, 18, 5457, 18, 2232, 30, 1573, 390, 3292, 1973, 29489, 6923, 12, 529, 13, 1573, 390, 3292, 2232, 29489, 6923, 12, 529, 13, 1573, 390, 3292, 3645, 3546, 273, 261, 902, 365, 18, 1973, 13, 365, 18, 2019, 18, 5457, 18, 7652, 67, 16511, 67, 3299, 12, 2977, 390, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
def GenerateEventTask(view, days=30):
def GenerateEventTask(view, days=30, tzinfo=None):
def GenerateEventTask(view, days=30): """ Generate one Task/Event stamped item """ event = GenerateCalendarEvent(view, days) event.StampKind('add', pim.TaskMixin.getKind(event.itsView)) return event
7713aa38e29f26998048109963d046607527df00 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/9228/7713aa38e29f26998048109963d046607527df00/GenerateItems.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 6654, 1133, 2174, 12, 1945, 16, 4681, 33, 5082, 16, 15732, 33, 7036, 4672, 3536, 6654, 1245, 3837, 19, 1133, 14429, 329, 761, 3536, 871, 273, 6654, 7335, 1133, 12, 1945, 16, 4681, 13, 871, 18, 8860, 5677, 2668, 1289, 2187, 293, 381, 18, 2174, 14439, 18, 588, 5677, 12, 2575, 18, 1282, 1767, 3719, 327, 871, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 6654, 1133, 2174, 12, 1945, 16, 4681, 33, 5082, 16, 15732, 33, 7036, 4672, 3536, 6654, 1245, 3837, 19, 1133, 14429, 329, 761, 3536, 871, 273, 6654, 7335, 1133, 12, 1945, 16, 4681, 13, 871, 18, 8860, 5677, 2668, 1289, 2187, 293, 381, 18, 2174, 14439, 18, 588, 5677, 12, 2575, 18, 1282, 1767, 3719, 327, 871, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self.wire_id = Wire.wire_counter Wire.wire_counter += 1
self.wire_id = -1 self._add_connection(source_node) def _add_connection(self, node): if Wire.connection.has_key(node): wire_id = Wire.connection[node].get_wire_id() print "Node already connected to %d" %wire_id if self.wire_id >= 0: for node in Wire.connection.keys(): if Wire.connection[node].get_wire_id() == wire_id: Wire.connection[node].set_wire_id(self.wire_id) else: self.wire_id = wire_id else: if self.wire_id == -1: self.wire_id = Wire.counter Wire.counter += 1 Wire.connection[node] = self print "WIRE_ID = %d" %self.wire_id def set_wire_id(self, id): self.wire_id = id
def __init__(self, rootitem, source_node, x1, y1, x2, y2): self.rootitem = rootitem self.source_node = source_node self.target_node = None self.x1 = x1 self.y1 = y1 self.x2 = x2 self.y2 = y2 self.wire_item = self.rootitem.add( gnome.canvas.CanvasLine, points=( self.x1, self.y1, self.x2, self.y2), fill_color_rgba = 0xCC1111FFL, width_units=5.0 ) self.wire_item.connect("event", self.delete_wire, self) self.wire_id = Wire.wire_counter Wire.wire_counter += 1
50a1c4ff3e153605418587fa08322a3d7ce1b3e1 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/11306/50a1c4ff3e153605418587fa08322a3d7ce1b3e1/electric.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 1365, 1726, 16, 1084, 67, 2159, 16, 619, 21, 16, 677, 21, 16, 619, 22, 16, 677, 22, 4672, 365, 18, 3085, 1726, 273, 1365, 1726, 365, 18, 3168, 67, 2159, 273, 1084, 67, 2159, 365, 18, 3299, 67, 2159, 273, 599, 365, 18, 92, 21, 273, 619, 21, 365, 18, 93, 21, 273, 677, 21, 365, 18, 92, 22, 273, 619, 22, 365, 18, 93, 22, 273, 677, 22, 365, 18, 14538, 67, 1726, 273, 365, 18, 3085, 1726, 18, 1289, 12, 22908, 1742, 18, 15424, 18, 12971, 1670, 16, 3143, 28657, 365, 18, 92, 21, 16, 365, 18, 93, 21, 16, 365, 18, 92, 22, 16, 365, 18, 93, 22, 3631, 3636, 67, 3266, 67, 26198, 273, 374, 92, 6743, 23680, 2246, 48, 16, 1835, 67, 7705, 33, 25, 18, 20, 262, 365, 18, 14538, 67, 1726, 18, 3612, 2932, 2575, 3113, 365, 18, 3733, 67, 14538, 16, 365, 13, 365, 18, 14538, 67, 350, 273, 15454, 18, 14538, 67, 7476, 15454, 18, 14538, 67, 7476, 1011, 404, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 1365, 1726, 16, 1084, 67, 2159, 16, 619, 21, 16, 677, 21, 16, 619, 22, 16, 677, 22, 4672, 365, 18, 3085, 1726, 273, 1365, 1726, 365, 18, 3168, 67, 2159, 273, 1084, 67, 2159, 365, 18, 3299, 67, 2159, 273, 599, 365, 18, 92, 21, 273, 619, 21, 365, 18, 93, 21, 273, 677, 21, 365, 18, 92, 22, 273, 619, 22, 365, 18, 93, 22, 273, 677, 22, 365, 18, 14538, 67, 1726, 273, 365, 18, 3085, 1726, 18, 1289, 12, 22908, 1742, 18, 15424, 18, 12971, 1670, 16, 3143, 28657, 365, 18, 92, 21, 16, 365, 18, 93, 21, 16, 365, 18, 92, 22, 16, 365, 18, 93, 22, 2 ]
paths = [ os.path.join(base, p) for p in ['..','libraries'] ] add_paths(paths, to_beginning=True)
add_path(os.path.join(ROBOTDIR, 'libraries'), to_beginning=True) add_path(PARENTDIR, to_beginning=True) if fnmatch.fnmatchcase(os.path.basename(PARENTDIR), 'robotframework-*.egg'): add_path(os.path.dirname(PARENTDIR), to_beginning=True)
def remove_path(path): path = norm_path(path) while path in sys.path: sys.path.remove(path)
a2aaa73355ddc580ac9c1408cfa93d0ac35bc6ee /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/7408/a2aaa73355ddc580ac9c1408cfa93d0ac35bc6ee/pythonpathsetter.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1206, 67, 803, 12, 803, 4672, 589, 273, 4651, 67, 803, 12, 803, 13, 1323, 589, 316, 2589, 18, 803, 30, 2589, 18, 803, 18, 4479, 12, 803, 13, 282, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1206, 67, 803, 12, 803, 4672, 589, 273, 4651, 67, 803, 12, 803, 13, 1323, 589, 316, 2589, 18, 803, 30, 2589, 18, 803, 18, 4479, 12, 803, 13, 282, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
debug(" RFC 2965 cookies are switched off")
_debug(" RFC 2965 cookies are switched off")
def set_ok_version(self, cookie, request): if cookie.version is None: # Version is always set to 0 by parse_ns_headers if it's a Netscape # cookie, so this must be an invalid RFC 2965 cookie. debug(" Set-Cookie2 without version attribute (%s=%s)", cookie.name, cookie.value) return False if cookie.version > 0 and not self.rfc2965: debug(" RFC 2965 cookies are switched off") return False elif cookie.version == 0 and not self.netscape: debug(" Netscape cookies are switched off") return False return True
15f04d8bbaf4e2b7d0d25228ce9bc84f1e501e81 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/12029/15f04d8bbaf4e2b7d0d25228ce9bc84f1e501e81/cookielib.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 444, 67, 601, 67, 1589, 12, 2890, 16, 3878, 16, 590, 4672, 309, 3878, 18, 1589, 353, 599, 30, 468, 4049, 353, 3712, 444, 358, 374, 635, 1109, 67, 2387, 67, 2485, 309, 518, 1807, 279, 8503, 12476, 468, 3878, 16, 1427, 333, 1297, 506, 392, 2057, 8372, 12899, 9222, 3878, 18, 1198, 2932, 282, 1000, 17, 6151, 22, 2887, 1177, 1566, 6142, 87, 5095, 87, 2225, 16, 3878, 18, 529, 16, 3878, 18, 1132, 13, 327, 1083, 309, 3878, 18, 1589, 405, 374, 471, 486, 365, 18, 16784, 5540, 9222, 30, 389, 4148, 2932, 282, 8372, 12899, 9222, 7237, 854, 31665, 3397, 7923, 327, 1083, 1327, 3878, 18, 1589, 422, 374, 471, 486, 365, 18, 2758, 12476, 30, 1198, 2932, 282, 8503, 12476, 7237, 854, 31665, 3397, 7923, 327, 1083, 327, 1053, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 444, 67, 601, 67, 1589, 12, 2890, 16, 3878, 16, 590, 4672, 309, 3878, 18, 1589, 353, 599, 30, 468, 4049, 353, 3712, 444, 358, 374, 635, 1109, 67, 2387, 67, 2485, 309, 518, 1807, 279, 8503, 12476, 468, 3878, 16, 1427, 333, 1297, 506, 392, 2057, 8372, 12899, 9222, 3878, 18, 1198, 2932, 282, 1000, 17, 6151, 22, 2887, 1177, 1566, 6142, 87, 5095, 87, 2225, 16, 3878, 18, 529, 16, 3878, 18, 1132, 13, 327, 1083, 309, 3878, 18, 1589, 405, 374, 471, 486, 365, 18, 16784, 5540, 9222, 30, 389, 4148, 2932, 282, 8372, 12899, 9222, 7237, 854, 31665, 3397, 7923, 327, 1083, 1327, 3878, 18, 1589, 422, 374, 471, 486, 365, 18, 2758, 12476, 2 ]
def callInThread(self, callable, *args, **kwargs):
def callInThread(self, _callable, *args, **kwargs):
def callInThread(self, callable, *args, **kwargs): """See twisted.internet.interfaces.IReactorThreads.callInThread. """ if not self.threadpool: self._initThreadPool() self.threadpool.callInThread(callable, *args, **kwargs)
2be731a1ed281980caf599001b09591be5493949 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/12595/2be731a1ed281980caf599001b09591be5493949/base.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 745, 382, 3830, 12, 2890, 16, 389, 7293, 16, 380, 1968, 16, 2826, 4333, 4672, 3536, 9704, 2339, 25444, 18, 267, 14726, 18, 15898, 18, 45, 426, 3362, 13233, 18, 1991, 382, 3830, 18, 3536, 309, 486, 365, 18, 5930, 6011, 30, 365, 6315, 2738, 20621, 1435, 365, 18, 5930, 6011, 18, 1991, 382, 3830, 12, 7293, 16, 380, 1968, 16, 2826, 4333, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 745, 382, 3830, 12, 2890, 16, 389, 7293, 16, 380, 1968, 16, 2826, 4333, 4672, 3536, 9704, 2339, 25444, 18, 267, 14726, 18, 15898, 18, 45, 426, 3362, 13233, 18, 1991, 382, 3830, 18, 3536, 309, 486, 365, 18, 5930, 6011, 30, 365, 6315, 2738, 20621, 1435, 365, 18, 5930, 6011, 18, 1991, 382, 3830, 12, 7293, 16, 380, 1968, 16, 2826, 4333, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
file = open(filename)
try: file = open(filename) except IOError: return None
def synopsis(filename, cache={}): """Get the one-line summary out of a module file.""" mtime = os.stat(filename).st_mtime lastupdate, result = cache.get(filename, (0, None)) if lastupdate < mtime: info = inspect.getmoduleinfo(filename) file = open(filename) if info and 'b' in info[2]: # binary modules have to be imported try: module = imp.load_module('__temp__', file, filename, info[1:]) except: return None result = split(module.__doc__ or '', '\n')[0] del sys.modules['__temp__'] else: # text modules can be directly examined line = file.readline() while line[:1] == '#' or not strip(line): line = file.readline() if not line: break line = strip(line) if line[:4] == 'r"""': line = line[1:] if line[:3] == '"""': line = line[3:] if line[-1:] == '\\': line = line[:-1] while not strip(line): line = file.readline() if not line: break result = strip(split(line, '"""')[0]) else: result = None file.close() cache[filename] = (mtime, result) return result
3cdbbe3e8f2ff5bc293c51458f9eb11ffe046a12 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/12029/3cdbbe3e8f2ff5bc293c51458f9eb11ffe046a12/pydoc.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 6194, 29522, 12, 3459, 16, 1247, 12938, 4672, 3536, 967, 326, 1245, 17, 1369, 4916, 596, 434, 279, 1605, 585, 12123, 13158, 273, 1140, 18, 5642, 12, 3459, 2934, 334, 67, 10838, 1142, 2725, 16, 563, 273, 1247, 18, 588, 12, 3459, 16, 261, 20, 16, 599, 3719, 309, 1142, 2725, 411, 13158, 30, 1123, 273, 5334, 18, 588, 2978, 1376, 12, 3459, 13, 775, 30, 585, 273, 1696, 12, 3459, 13, 1335, 8340, 30, 225, 327, 599, 309, 1123, 471, 296, 70, 11, 316, 1123, 63, 22, 14542, 468, 3112, 4381, 1240, 358, 506, 9101, 775, 30, 1605, 273, 1646, 18, 945, 67, 2978, 2668, 972, 5814, 972, 2187, 585, 16, 1544, 16, 1123, 63, 21, 30, 5717, 1335, 30, 327, 599, 563, 273, 1416, 12, 2978, 16186, 2434, 972, 578, 10226, 2337, 82, 6134, 63, 20, 65, 1464, 2589, 18, 6400, 3292, 972, 5814, 972, 3546, 469, 30, 468, 977, 4381, 848, 506, 5122, 19707, 1920, 980, 273, 585, 18, 896, 1369, 1435, 1323, 980, 10531, 21, 65, 422, 6501, 578, 486, 2569, 12, 1369, 4672, 980, 273, 585, 18, 896, 1369, 1435, 309, 486, 980, 30, 898, 980, 273, 2569, 12, 1369, 13, 309, 980, 10531, 24, 65, 422, 296, 86, 8395, 4278, 980, 273, 980, 63, 21, 26894, 309, 980, 10531, 23, 65, 422, 2119, 3660, 4278, 980, 273, 980, 63, 23, 26894, 309, 980, 18919, 21, 26894, 422, 3718, 4278, 980, 273, 980, 10531, 17, 21, 65, 1323, 486, 2569, 12, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 6194, 29522, 12, 3459, 16, 1247, 12938, 4672, 3536, 967, 326, 1245, 17, 1369, 4916, 596, 434, 279, 1605, 585, 12123, 13158, 273, 1140, 18, 5642, 12, 3459, 2934, 334, 67, 10838, 1142, 2725, 16, 563, 273, 1247, 18, 588, 12, 3459, 16, 261, 20, 16, 599, 3719, 309, 1142, 2725, 411, 13158, 30, 1123, 273, 5334, 18, 588, 2978, 1376, 12, 3459, 13, 775, 30, 585, 273, 1696, 12, 3459, 13, 1335, 8340, 30, 225, 327, 599, 309, 1123, 471, 296, 70, 11, 316, 1123, 63, 22, 14542, 468, 3112, 4381, 1240, 358, 506, 9101, 775, 30, 1605, 273, 1646, 18, 945, 67, 2978, 2668, 972, 5814, 972, 2187, 585, 16, 1544, 16, 1123, 63, 21, 30, 2 ]
style = win32con.WS_OVERLAPPED | win32con.WS_SYSMENU self.hwnd = CreateWindow(classAtom, "SpamBayes", style, 0, 0, win32con.CW_USEDEFAULT, win32con.CW_USEDEFAULT, 0, 0, hinst, None) UpdateWindow(self.hwnd)
hinst = GetModuleHandle(None) dialogTemplate = [['SpamBayes', (14, 10, 246, 187), -1865809852 & ~win32con.WS_VISIBLE, None, (8, 'Tahoma')],] self.hwnd = CreateDialogIndirect(hinst, dialogTemplate, 0, message_map)
def __init__(self): # The ordering here is important - it is the order that they will # appear in the menu. As dicts don't have an order, this means # that the order is controlled by the id. Any items were the # function is None will appear as separators. self.control_functions = {1024 : ("Start SpamBayes", self.StartStop), 1025 : ("-", None), 1026 : ("View information ...", self.OpenInterface), 1027 : ("Configure ...", self.OpenConfig), 1028 : ("-", None), 1029 : ("Exit SpamBayes", self.OnExit), } message_map = { win32con.WM_DESTROY: self.OnDestroy, win32con.WM_COMMAND: self.OnCommand, win32con.WM_USER+20 : self.OnTaskbarNotify, }
dee0c4d20c1b073d14b6a18a484058719c5c30ec /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/9857/dee0c4d20c1b073d14b6a18a484058719c5c30ec/pop3proxy_tray.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 4672, 468, 1021, 9543, 2674, 353, 10802, 300, 518, 353, 326, 1353, 716, 2898, 903, 468, 9788, 316, 326, 3824, 18, 225, 2970, 15838, 2727, 1404, 1240, 392, 1353, 16, 333, 4696, 468, 716, 326, 1353, 353, 25934, 635, 326, 612, 18, 225, 5502, 1516, 4591, 326, 468, 445, 353, 599, 903, 9788, 487, 14815, 18, 365, 18, 7098, 67, 10722, 273, 288, 2163, 3247, 294, 7566, 1685, 5878, 301, 38, 528, 281, 3113, 365, 18, 1685, 4947, 3631, 1728, 2947, 294, 7566, 17, 3113, 599, 3631, 1728, 5558, 294, 7566, 1767, 1779, 1372, 3113, 365, 18, 3678, 1358, 3631, 1728, 5324, 294, 7566, 11207, 1372, 3113, 365, 18, 3678, 809, 3631, 1728, 6030, 294, 7566, 17, 3113, 599, 3631, 1728, 5540, 294, 7566, 6767, 5878, 301, 38, 528, 281, 3113, 365, 18, 1398, 6767, 3631, 289, 883, 67, 1458, 273, 288, 5657, 1578, 591, 18, 25173, 67, 1639, 25870, 61, 30, 365, 18, 1398, 10740, 16, 5657, 1578, 591, 18, 25173, 67, 19104, 30, 365, 18, 1398, 2189, 16, 5657, 1578, 591, 18, 25173, 67, 4714, 15, 3462, 294, 365, 18, 1398, 2174, 3215, 9168, 16, 289, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 4672, 468, 1021, 9543, 2674, 353, 10802, 300, 518, 353, 326, 1353, 716, 2898, 903, 468, 9788, 316, 326, 3824, 18, 225, 2970, 15838, 2727, 1404, 1240, 392, 1353, 16, 333, 4696, 468, 716, 326, 1353, 353, 25934, 635, 326, 612, 18, 225, 5502, 1516, 4591, 326, 468, 445, 353, 599, 903, 9788, 487, 14815, 18, 365, 18, 7098, 67, 10722, 273, 288, 2163, 3247, 294, 7566, 1685, 5878, 301, 38, 528, 281, 3113, 365, 18, 1685, 4947, 3631, 1728, 2947, 294, 7566, 17, 3113, 599, 3631, 1728, 5558, 294, 7566, 1767, 1779, 1372, 3113, 365, 18, 3678, 1358, 3631, 1728, 5324, 294, 7566, 11207, 1372, 3113, 365, 18, 3678, 809, 3631, 1728, 2 ]
self.reportProgress(30)
os.system('svn --set-depth infinity up "%s/trunk/l10n-kde4/%s/docmessages"' % (localsvnroot, langlang)) self.reportProgress(15) os.system('svn --set-depth infinity up "%s/trunk/l10n-kde4/%s"' % (localsvnroot, langlang))
def validatePage(self): if self.existing.isChecked(): return True if os.system('which svn')!=0: KMessageBox.error(self,i18n("Please install 'subversion' package\nto have Lokalize download KDE translation files."),i18n("Subversion client not found")) return False
4fff230674ead7cc7c99d83ee717306bc218b272 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/1688/4fff230674ead7cc7c99d83ee717306bc218b272/newprojectwizard.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1954, 1964, 12, 2890, 4672, 309, 365, 18, 11711, 18, 291, 11454, 13332, 327, 1053, 309, 1140, 18, 4299, 2668, 12784, 5893, 82, 6134, 5, 33, 20, 30, 1475, 27647, 18, 1636, 12, 2890, 16, 77, 2643, 82, 2932, 8496, 3799, 296, 1717, 1589, 11, 2181, 64, 496, 83, 1240, 511, 601, 287, 554, 4224, 1475, 1639, 4794, 1390, 1199, 3631, 77, 2643, 82, 2932, 1676, 1589, 1004, 486, 1392, 6, 3719, 327, 1083, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1954, 1964, 12, 2890, 4672, 309, 365, 18, 11711, 18, 291, 11454, 13332, 327, 1053, 309, 1140, 18, 4299, 2668, 12784, 5893, 82, 6134, 5, 33, 20, 30, 1475, 27647, 18, 1636, 12, 2890, 16, 77, 2643, 82, 2932, 8496, 3799, 296, 1717, 1589, 11, 2181, 64, 496, 83, 1240, 511, 601, 287, 554, 4224, 1475, 1639, 4794, 1390, 1199, 3631, 77, 2643, 82, 2932, 1676, 1589, 1004, 486, 1392, 6, 3719, 327, 1083, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
def _Clone(self, revision, url, verbose=False):
def _Clone(self, revision, url, options):
def _Clone(self, revision, url, verbose=False): """Clone a git repository from the given URL.
e603c688da503d6a6db9690684aa49a1b2a54706 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/6076/e603c688da503d6a6db9690684aa49a1b2a54706/gclient_scm.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 10930, 12, 2890, 16, 6350, 16, 880, 16, 702, 4672, 3536, 10930, 279, 5071, 3352, 628, 326, 864, 1976, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 10930, 12, 2890, 16, 6350, 16, 880, 16, 702, 4672, 3536, 10930, 279, 5071, 3352, 628, 326, 864, 1976, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
"cancel": (self.cancel, _("exit network adapter setup menu")), "ok": (self.ok, _("select menu entry")),
"cancel": (self.keyCancel, _("exit network adapter configuration")), "ok": (self.keySave, _("activate network adapter configuration")),
def __init__(self, session, networkinfo, essid=None, aplist=None): Screen.__init__(self, session) HelpableScreen.__init__(self) self.session = session if isinstance(networkinfo, (list, tuple)): self.iface = networkinfo[0] self.essid = networkinfo[1] self.aplist = networkinfo[2] else: self.iface = networkinfo self.essid = essid self.aplist = aplist self.extended = None self.applyConfigRef = None self.finished_cb = None self.oktext = _("Press OK on your remote control to continue.") self.oldInterfaceState = iNetwork.getAdapterAttribute(self.iface, "up")
f741c4cc282f2f99b86e6ec305604f27216087ba /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/6652/f741c4cc282f2f99b86e6ec305604f27216087ba/NetworkSetup.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 1339, 16, 2483, 1376, 16, 18518, 350, 33, 7036, 16, 279, 17842, 33, 7036, 4672, 10146, 16186, 2738, 972, 12, 2890, 16, 1339, 13, 11288, 429, 7956, 16186, 2738, 972, 12, 2890, 13, 365, 18, 3184, 273, 1339, 309, 1549, 12, 5185, 1376, 16, 261, 1098, 16, 3193, 3719, 30, 365, 18, 31479, 273, 2483, 1376, 63, 20, 65, 365, 18, 403, 350, 273, 2483, 1376, 63, 21, 65, 365, 18, 69, 17842, 273, 2483, 1376, 63, 22, 65, 469, 30, 365, 18, 31479, 273, 2483, 1376, 365, 18, 403, 350, 273, 18518, 350, 365, 18, 69, 17842, 273, 279, 17842, 365, 18, 14948, 273, 599, 365, 18, 9010, 809, 1957, 273, 599, 365, 18, 13527, 67, 7358, 273, 599, 365, 18, 601, 955, 273, 389, 2932, 11840, 7791, 603, 3433, 2632, 3325, 358, 1324, 1199, 13, 365, 18, 1673, 1358, 1119, 273, 277, 3906, 18, 588, 4216, 1499, 12, 2890, 18, 31479, 16, 315, 416, 7923, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 1339, 16, 2483, 1376, 16, 18518, 350, 33, 7036, 16, 279, 17842, 33, 7036, 4672, 10146, 16186, 2738, 972, 12, 2890, 16, 1339, 13, 11288, 429, 7956, 16186, 2738, 972, 12, 2890, 13, 365, 18, 3184, 273, 1339, 309, 1549, 12, 5185, 1376, 16, 261, 1098, 16, 3193, 3719, 30, 365, 18, 31479, 273, 2483, 1376, 63, 20, 65, 365, 18, 403, 350, 273, 2483, 1376, 63, 21, 65, 365, 18, 69, 17842, 273, 2483, 1376, 63, 22, 65, 469, 30, 365, 18, 31479, 273, 2483, 1376, 365, 18, 403, 350, 273, 18518, 350, 365, 18, 69, 17842, 273, 279, 17842, 365, 18, 14948, 273, 599, 365, 18, 9010, 809, 1957, 273, 2 ]
if ('M' in flags): say_date = False
if ('T' in flags): say_time = False
def say(self, str, args = [], kw = {}):
d3dc2a4b9977fedcd280ebc5d5981fcdc2921ec2 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/3136/d3dc2a4b9977fedcd280ebc5d5981fcdc2921ec2/__init__.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 12532, 12, 2890, 16, 609, 16, 833, 273, 5378, 16, 5323, 273, 2618, 4672, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 12532, 12, 2890, 16, 609, 16, 833, 273, 5378, 16, 5323, 273, 2618, 4672, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
print "end tag tr"
def endTagTr(self, name="tr"): if self.parser.elementInScope("tr", True): print "end tag tr" self.clearStackToTableRowContext() self.parser.openElements.pop() self.parser.switchInsertionMode("inTableBody") else: # innerHTML case self.parser.parseError()
787af9f1621cbb26f490880bec265bcadcc03f25 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/10463/787af9f1621cbb26f490880bec265bcadcc03f25/parser.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 29765, 1070, 12, 2890, 16, 508, 1546, 313, 6, 4672, 309, 365, 18, 4288, 18, 2956, 382, 3876, 2932, 313, 3113, 1053, 4672, 365, 18, 8507, 2624, 774, 30650, 1042, 1435, 365, 18, 4288, 18, 3190, 3471, 18, 5120, 1435, 365, 18, 4288, 18, 9610, 29739, 2309, 2932, 267, 1388, 2250, 7923, 469, 30, 468, 14129, 648, 365, 18, 4288, 18, 2670, 668, 1435, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 29765, 1070, 12, 2890, 16, 508, 1546, 313, 6, 4672, 309, 365, 18, 4288, 18, 2956, 382, 3876, 2932, 313, 3113, 1053, 4672, 365, 18, 8507, 2624, 774, 30650, 1042, 1435, 365, 18, 4288, 18, 3190, 3471, 18, 5120, 1435, 365, 18, 4288, 18, 9610, 29739, 2309, 2932, 267, 1388, 2250, 7923, 469, 30, 468, 14129, 648, 365, 18, 4288, 18, 2670, 668, 1435, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self.statusBar.SetStatusText (os.getcwd ())
self.statusBar.SetStatusText (os.getcwdu ())
def __init__ (self, parent, id, title): wx.Frame.__init__ (self, parent, -1, title)
5f003fa66305ac8935c5608a773efc5e9baee6db /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/9028/5f003fa66305ac8935c5608a773efc5e9baee6db/candy.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 261, 2890, 16, 982, 16, 612, 16, 2077, 4672, 7075, 18, 3219, 16186, 2738, 972, 261, 2890, 16, 982, 16, 300, 21, 16, 2077, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 261, 2890, 16, 982, 16, 612, 16, 2077, 4672, 7075, 18, 3219, 16186, 2738, 972, 261, 2890, 16, 982, 16, 300, 21, 16, 2077, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self.assert_(stderr.startswith(b"UnicodeEncodeError: " b"'utf-8' codec can't encode character '\\udcff' in " b"position 7: surrogates not allowed"), stderr)
self.assert_(b"UnicodeEncodeError:" in stderr, "%r not in %s" % (b"UniodeEncodeError:", ascii(stderr)))
def test_main_invalid_unicode(self): import locale non_decodable = b"\xff" encoding = locale.getpreferredencoding() try: non_decodable.decode(encoding) except UnicodeDecodeError: pass else: self.skipTest('%r is decodable with encoding %s' % (non_decodable, encoding)) code = b'print("' + non_decodable + b'")' p = subprocess.Popen([sys.executable, "-c", code], stderr=subprocess.PIPE) stdout, stderr = p.communicate() self.assertEqual(p.returncode, 1) self.assert_(stderr.startswith(b"UnicodeEncodeError: " b"'utf-8' codec can't encode character '\\udcff' in " b"position 7: surrogates not allowed"), stderr)
c0983856c6814272a5e6004bd50b429afba3f3b4 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/8546/c0983856c6814272a5e6004bd50b429afba3f3b4/test_sys.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 5254, 67, 5387, 67, 9124, 12, 2890, 4672, 1930, 2573, 1661, 67, 323, 1559, 429, 273, 324, 12691, 5297, 6, 2688, 273, 2573, 18, 588, 23616, 5999, 1435, 775, 30, 1661, 67, 323, 1559, 429, 18, 3922, 12, 5999, 13, 1335, 26311, 30, 1342, 469, 30, 365, 18, 7457, 4709, 29909, 86, 353, 443, 1559, 429, 598, 2688, 738, 87, 11, 738, 261, 5836, 67, 323, 1559, 429, 16, 2688, 3719, 981, 273, 324, 11, 1188, 29823, 397, 1661, 67, 323, 1559, 429, 397, 324, 4970, 2506, 293, 273, 6652, 18, 52, 3190, 3816, 9499, 18, 17751, 16, 3701, 71, 3113, 981, 6487, 4514, 33, 1717, 2567, 18, 27602, 13, 3909, 16, 4514, 273, 293, 18, 5702, 318, 2659, 1435, 365, 18, 11231, 5812, 12, 84, 18, 2463, 710, 16, 404, 13, 365, 18, 11231, 67, 12, 11241, 18, 17514, 1918, 12, 70, 6, 16532, 5509, 668, 30, 315, 324, 5187, 3158, 17, 28, 11, 9196, 848, 1404, 2017, 3351, 3718, 1100, 71, 1403, 11, 316, 315, 324, 6, 3276, 2371, 30, 5056, 303, 28139, 486, 2935, 6, 3631, 4514, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 5254, 67, 5387, 67, 9124, 12, 2890, 4672, 1930, 2573, 1661, 67, 323, 1559, 429, 273, 324, 12691, 5297, 6, 2688, 273, 2573, 18, 588, 23616, 5999, 1435, 775, 30, 1661, 67, 323, 1559, 429, 18, 3922, 12, 5999, 13, 1335, 26311, 30, 1342, 469, 30, 365, 18, 7457, 4709, 29909, 86, 353, 443, 1559, 429, 598, 2688, 738, 87, 11, 738, 261, 5836, 67, 323, 1559, 429, 16, 2688, 3719, 981, 273, 324, 11, 1188, 29823, 397, 1661, 67, 323, 1559, 429, 397, 324, 4970, 2506, 293, 273, 6652, 18, 52, 3190, 3816, 9499, 18, 17751, 16, 3701, 71, 3113, 981, 6487, 4514, 33, 1717, 2567, 18, 27602, 13, 3909, 16, 4514, 273, 293, 18, 2 ]
def on_plugin_about_close(self, widget):
def on_plugin_about_close(self, widget, *args):
def on_plugin_about_close(self, widget): """Close the PluginAboutDialog.""" self.plugin_about_dialog.hide()
967023748625d5d6d6d0b2aef98301cfc91182bb /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/7036/967023748625d5d6d6d0b2aef98301cfc91182bb/preferences.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 603, 67, 4094, 67, 21071, 67, 4412, 12, 2890, 16, 3604, 16, 380, 1968, 4672, 3536, 4605, 326, 6258, 24813, 6353, 12123, 365, 18, 4094, 67, 21071, 67, 12730, 18, 11248, 1435, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 603, 67, 4094, 67, 21071, 67, 4412, 12, 2890, 16, 3604, 16, 380, 1968, 4672, 3536, 4605, 326, 6258, 24813, 6353, 12123, 365, 18, 4094, 67, 21071, 67, 12730, 18, 11248, 1435, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
want to silent this exception.
want to silence this exception.
def copytree(src, dst, symlinks=False, ignore=None, copy_function=copy2, ignore_dangling_symlinks=False): """Recursively copy a directory tree. The destination directory must not already exist. If exception(s) occur, an Error is raised with a list of reasons. If the optional symlinks flag is true, symbolic links in the source tree result in symbolic links in the destination tree; if it is false, the contents of the files pointed to by symbolic links are copied. If the file pointed by the symlink doesn't exist, an exception will be added in the list of errors raised in an Error exception at the end of the copy process. You can set the optional ignore_dangling_symlinks flag to true if you want to silent this exception. The optional ignore argument is a callable. If given, it is called with the `src` parameter, which is the directory being visited by copytree(), and `names` which is the list of `src` contents, as returned by os.listdir(): callable(src, names) -> ignored_names Since copytree() is called recursively, the callable will be called once for each directory that is copied. It returns a list of names relative to the `src` directory that should not be copied. The optional copy_function argument is a callable that will be used to copy each file. It will be called with the source path and the destination path as arguments. By default, copy2() is used, but any function that supports the same signature (like copy()) can be used. """ names = os.listdir(src) if ignore is not None: ignored_names = ignore(src, names) else: ignored_names = set() os.makedirs(dst) errors = [] for name in names: if name in ignored_names: continue srcname = os.path.join(src, name) dstname = os.path.join(dst, name) try: if os.path.islink(srcname): linkto = os.readlink(srcname) if symlinks: os.symlink(linkto, dstname) else: # ignore dangling symlink if the flag is on if not os.path.exists(linkto) and ignore_dangling_symlinks: continue # otherwise let the copy occurs. copy2 will raise an error copy_function(srcname, dstname) elif os.path.isdir(srcname): copytree(srcname, dstname, symlinks, ignore, copy_function) else: # Will raise a SpecialFileError for unsupported file types copy_function(srcname, dstname) # catch the Error from the recursive copytree so that we can # continue with other files except Error as err: errors.extend(err.args[0]) except EnvironmentError as why: errors.append((srcname, dstname, str(why))) try: copystat(src, dst) except OSError as why: if WindowsError is not None and isinstance(why, WindowsError): # Copying file access times may fail on Windows pass else: errors.extend((src, dst, str(why))) if errors: raise Error(errors)
6cf3e616e4f0cbf78870b6907af8a256f8d2eee7 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/8546/6cf3e616e4f0cbf78870b6907af8a256f8d2eee7/shutil.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1610, 3413, 12, 4816, 16, 3046, 16, 23146, 33, 8381, 16, 2305, 33, 7036, 16, 1610, 67, 915, 33, 3530, 22, 16, 2305, 67, 72, 539, 2456, 67, 21278, 87, 33, 8381, 4672, 3536, 12474, 1610, 279, 1867, 2151, 18, 225, 1021, 2929, 1867, 1297, 486, 1818, 1005, 18, 971, 1520, 12, 87, 13, 3334, 16, 392, 1068, 353, 11531, 598, 279, 666, 434, 14000, 18, 225, 971, 326, 3129, 23146, 2982, 353, 638, 16, 16754, 4716, 316, 326, 1084, 2151, 563, 316, 16754, 4716, 316, 326, 2929, 2151, 31, 309, 518, 353, 629, 16, 326, 2939, 434, 326, 1390, 25874, 358, 635, 16754, 4716, 854, 9268, 18, 971, 326, 585, 25874, 635, 326, 10563, 3302, 1404, 1005, 16, 392, 1520, 903, 506, 3096, 316, 326, 666, 434, 1334, 11531, 316, 392, 1068, 1520, 622, 326, 679, 434, 326, 1610, 1207, 18, 225, 4554, 848, 444, 326, 3129, 2305, 67, 72, 539, 2456, 67, 21278, 87, 2982, 358, 638, 309, 1846, 2545, 358, 31468, 333, 1520, 18, 282, 1021, 3129, 2305, 1237, 353, 279, 4140, 18, 971, 864, 16, 518, 353, 2566, 598, 326, 1375, 4816, 68, 1569, 16, 1492, 353, 326, 1867, 3832, 9711, 635, 1610, 3413, 9334, 471, 1375, 1973, 68, 1492, 353, 326, 666, 434, 1375, 4816, 68, 2939, 16, 487, 2106, 635, 1140, 18, 1098, 1214, 13332, 225, 4140, 12, 4816, 16, 1257, 13, 317, 5455, 67, 1973, 225, 7897, 1610, 3413, 1435, 353, 2566, 8536, 16, 326, 4140, 903, 506, 2566, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1610, 3413, 12, 4816, 16, 3046, 16, 23146, 33, 8381, 16, 2305, 33, 7036, 16, 1610, 67, 915, 33, 3530, 22, 16, 2305, 67, 72, 539, 2456, 67, 21278, 87, 33, 8381, 4672, 3536, 12474, 1610, 279, 1867, 2151, 18, 225, 1021, 2929, 1867, 1297, 486, 1818, 1005, 18, 971, 1520, 12, 87, 13, 3334, 16, 392, 1068, 353, 11531, 598, 279, 666, 434, 14000, 18, 225, 971, 326, 3129, 23146, 2982, 353, 638, 16, 16754, 4716, 316, 326, 1084, 2151, 563, 316, 16754, 4716, 316, 326, 2929, 2151, 31, 309, 518, 353, 629, 16, 326, 2939, 434, 326, 1390, 25874, 358, 635, 16754, 4716, 854, 9268, 18, 971, 326, 585, 25874, 635, 326, 10563, 3302, 1404, 1005, 2 ]
self.interaction(frame, exc_tuple)
self.interaction(frame, exc_tuple)
def user_exception(self, frame, exc_tuple): """This function is called if an exception occurs, but only if we are to stop at or just below this level.""" frame.f_locals['__exc_tuple__'] = exc_tuple self.interaction(frame, exc_tuple)
e032f4d4e7d00a05fe0f27b0ce4695345bb987e0 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/12738/e032f4d4e7d00a05fe0f27b0ce4695345bb987e0/debugger.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 729, 67, 4064, 12, 2890, 16, 2623, 16, 3533, 67, 8052, 4672, 3536, 2503, 445, 353, 2566, 309, 392, 1520, 9938, 16, 1496, 1338, 309, 732, 854, 358, 2132, 622, 578, 2537, 5712, 333, 1801, 12123, 2623, 18, 74, 67, 17977, 3292, 972, 10075, 67, 8052, 972, 3546, 273, 3533, 67, 8052, 365, 18, 30303, 12, 3789, 16, 3533, 67, 8052, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 729, 67, 4064, 12, 2890, 16, 2623, 16, 3533, 67, 8052, 4672, 3536, 2503, 445, 353, 2566, 309, 392, 1520, 9938, 16, 1496, 1338, 309, 732, 854, 358, 2132, 622, 578, 2537, 5712, 333, 1801, 12123, 2623, 18, 74, 67, 17977, 3292, 972, 10075, 67, 8052, 972, 3546, 273, 3533, 67, 8052, 365, 18, 30303, 12, 3789, 16, 3533, 67, 8052, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
def recall(self, s): if self.history: self.history.recall(s)
def recall(self, s, event): self.text.undo_block_start() try: self.text.tag_remove("sel", "1.0", "end") self.text.mark_set("insert", "end-1c") s = s.strip() lines = s.split('\n') if lines: prefix = self.text.get("insert linestart","insert").rstrip() if prefix and prefix[-1]==':': self.newline_and_indent_event(event) self.text.insert("insert",lines[0].strip()) if len(lines) > 1: self.newline_and_indent_event(event) for line in lines[1:]: self.text.insert("insert", line.strip()) self.newline_and_indent_event(event) else: self.text.insert("insert", s) finally: self.text.see("insert") self.text.undo_block_stop()
def recall(self, s): if self.history: self.history.recall(s)
e88225f2d5060953d48573a5934561756edf7326 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8125/e88225f2d5060953d48573a5934561756edf7326/PyShell.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 20895, 12, 2890, 16, 272, 4672, 309, 365, 18, 8189, 30, 365, 18, 8189, 18, 266, 1991, 12, 87, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 20895, 12, 2890, 16, 272, 4672, 309, 365, 18, 8189, 30, 365, 18, 8189, 18, 266, 1991, 12, 87, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
ssn_data_quality = ET.SubElement(client, "ssn_data_quality") ssn_data_quality.text = "full ssn reported (hud)" def customizeClientPersonalIdentifiersForEntryExit(self,client,recordset): first_name = ET.SubElement(client, "first_name") first_name.text = recordset['First Name'] last_name = ET.SubElement(client, "last_name") last_name.text = recordset['Last Name'] if recordset['MI'] <> "": mi_initial = ET.SubElement(client, "mi_initial") mi_initial.text = self.fixMiddleInitial(recordset['MI']) fixedSSN = self.fixSSN(recordset['SSN']) if fixedSSN <> "": soc_sec_no = ET.SubElement(client, "soc_sec_no") soc_sec_no.text = fixedSSN
def customizeClientPersonalIdentifiers(self,client,recordset):
47d2884a8b5be4efadf798bbb2e71a3d5e993c3e /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/9116/47d2884a8b5be4efadf798bbb2e71a3d5e993c3e/svcpointxml_406_writer.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 20236, 1227, 8346, 287, 12745, 12, 2890, 16, 2625, 16, 3366, 542, 4672, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 20236, 1227, 8346, 287, 12745, 12, 2890, 16, 2625, 16, 3366, 542, 4672, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
return "svn diff %s %s" % (tag_url, url)
return "svn --non-interactive diff %s %s" % (tag_url, url)
def cmd_diff_last_commit_against_tag(self, version): url = self._svn_info() tag_url = self.tag_url(version) return "svn diff %s %s" % (tag_url, url)
aa4c18314fd665eda94c51eae897c2d35fd984e6 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/12067/aa4c18314fd665eda94c51eae897c2d35fd984e6/svn.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1797, 67, 5413, 67, 2722, 67, 7371, 67, 23095, 334, 67, 2692, 12, 2890, 16, 1177, 4672, 880, 273, 365, 6315, 31505, 67, 1376, 1435, 1047, 67, 718, 273, 365, 18, 2692, 67, 718, 12, 1589, 13, 327, 315, 31505, 3122, 738, 87, 738, 87, 6, 738, 261, 2692, 67, 718, 16, 880, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1797, 67, 5413, 67, 2722, 67, 7371, 67, 23095, 334, 67, 2692, 12, 2890, 16, 1177, 4672, 880, 273, 365, 6315, 31505, 67, 1376, 1435, 1047, 67, 718, 273, 365, 18, 2692, 67, 718, 12, 1589, 13, 327, 315, 31505, 3122, 738, 87, 738, 87, 6, 738, 261, 2692, 67, 718, 16, 880, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if self.outdir[-1:]==os.sep:
if self.outdir[-1:]==DV.sep:
def run(self): self.uris=self.getURI(self.sourceuri) self.abort=False if not self.abort: if True: Damnlog('Conversion routine starting, URI is',self.uris[0]) self.uri=self.uris[0] self.update(0) self.parent.thisvideo.append(self.parent.videos[self.parent.converting]) self.filename=unicodedata.normalize('NFKD',DamnUnicode(REGEX_FILE_CLEANUP_FILENAME.sub('',self.parent.meta[self.parent.videos[self.parent.converting]]['name']))).encode('utf8','ignore').replace('/','').replace('\\','').strip() self.profile=int(self.parent.meta[self.parent.videos[self.parent.converting]]['profile']) if os.path.exists(self.uri): Damnlog('We\'re dealing with a file stream here.') self.stream=self.uri # It's a file stream, ffmpeg will take care of it if self.outdir is None: self.outdir=DV.prefs.get('defaultoutdir') else: Damnlog('We\'re dealing with a network stream here.') self.stream='-' # It's another stream, spawn a downloader thread to take care of it and pipe the content to ffmpeg via stdin if self.outdir is None: self.outdir=DV.prefs.get('defaultweboutdir') if self.outdir[-1:]==os.sep: self.outdir=self.outdir[0:-1] if not os.path.exists(self.outdir): os.makedirs(self.outdir) elif not os.path.isdir(self.outdir): os.remove(self.outdir) os.makedirs(self.outdir) self.outdir=self.outdir+os.sep Damnlog('Profile is',self.profile,'; Output directory is',self.outdir) if self.profile==-1: # Do not encode, just copy Damnlog('We\'re in raw copy mode') if True: failed=False if self.stream=='-': # Spawn a downloader src=DamnURLPicker(self.uris) total=int(src.info()['Content-Length']) Damnlog('Total bytes:',total) ext='avi' try: if src.info()['Content-Type'].lower().find('audio')!=-1: ext='mp3' except: ext='avi' try: tmpuri=src.info()['Content-Disposition'][src.info()['Content-Disposition'].find('filename=')+9:] except: tmpuri='Video.'+ext # And pray for the best! Damnlog('Temp URI is',tmpuri) else: # Just copy the file, lol total=int(os.lstat(self.stream).st_size) src=open(self.stream,'rb') tmpuri=self.stream Damnlog('Total is',total,'; Temp URI is',tmpuri) if REGEX_URI_EXTENSION_EXTRACT.search(tmpuri): ext='.'+REGEX_URI_EXTENSION_EXTRACT.sub('\\1',tmpuri) else: ext='.avi' # And pray for the best again! self.filename=self.getfinalfilename(self.outdir,self.filename,ext) Damnlog('Filename is',self.filename,'; opening local stream.') dst=open(self.outdir+self.filename+ext,'wb') Damnlog(self.outdir+self.filename+ext,'opened.') keepgoing=True copied=0.0 lasttime=0.0 self.update(statustext=u'Copying '+DamnUnicode(self.parent.meta[self.parent.videos[self.parent.converting]]['name'])+u' to '+DamnUnicode(self.filename+ext)+u'...') Damnlog('Starting raw download of stream',src) while keepgoing and not self.abort: i=src.read(4096) if len(i): dst.write(i) copied+=4096.0 else: copied=float(total) keepgoing=False progress=min((100.0,copied/total*100.0)) nowtime=float(time.time()) if lasttime+.5<nowtime or not keepgoing: # Do not send a progress update more than 2 times per second, otherwise the event queue can get overloaded. On some platforms, time() is an int, but that doesn't matter; the progress will be updated once a second instead of 2 times, which is still acceptable. self.update(progress,status=self.parent.meta[self.parent.videos[self.parent.converting]]['status']+' ['+str(int(progress))+'%]') lasttime=nowtime Damnlog('Done downloading!') else: Damnlog('Raw download failed. Aborted?',self.abort) failed=True self.grabberrun=False if self.abort or failed: self.parent.meta[self.parent.videos[self.parent.converting]]['status']='Failure.' self.update(status='Failure.') else: self.parent.meta[self.parent.videos[self.parent.converting]]['status']='Success!' self.update(status='Success!') self.parent.resultlist.append((self.parent.meta[self.parent.videos[self.parent.converting]]['name'],self.outdir)) self.update(go=self.abort) return Damnlog('We\'re in on-the-fly conversion mode.') os_exe_ext='' if DV.os=='nt': os_exe_ext='.exe' elif DV.os=='mac': os_exe_ext='osx' if DV.bit64==True: os_exe_ext='64'+os_exe_ext self.passes=1 cmd=[DV.bin_path+'ffmpeg'+os_exe_ext,'-i','?DAMNVID_VIDEO_STREAM?','-y','-deinterlace','-passlogfile',DV.tmp_path+'pass'] for i in DV.preferences.keys(): if i[0:25]=='damnvid-profile:encoding_': i=i[16:] pref=DV.prefs.getp(self.profile,i) if pref: if type(DV.preferences['damnvid-profile:'+i]['kind']) in (type(''),type(u'')): if DV.preferences['damnvid-profile:'+i]['kind'][0]=='%': pref=str(round(float(pref),0)) # Round if i=='encoding_pass': pref='?DAMNVID_VIDEO_PASS?' if i[9:]=='b' and pref=='sameq': cmd.append('-sameq') else: cmd.extend(['-'+i[9:],pref]) self.encodevideo=DV.prefs.getp(self.profile,'video') self.encodeaudio=DV.prefs.getp(self.profile,'audio') if not self.encodevideo: cmd.append('-vn') if not self.encodeaudio: cmd.append('-an') vidformat=DV.prefs.getp(self.profile,'Encoding_f') self.vcodec=DV.prefs.getp(self.profile,'Encoding_vcodec') self.acodec=DV.prefs.getp(self.profile,'Encoding_acodec') self.totalpasses=DV.prefs.getp(self.profile,'Encoding_pass') if not self.totalpasses: self.totalpasses=1 else: self.totalpasses=int(self.totalpasses) if vidformat and DV.file_ext.has_key(vidformat): ext='.'+DV.file_ext[vidformat] else: if self.vcodec and self.encodevideo and DV.file_ext_by_codec.has_key(self.vcodec): ext='.'+DV.file_ext_by_codec[self.vcodec] elif self.encodeaudio and not self.encodevideo: if DV.file_ext_by_codec.has_key(self.acodec): ext='.'+DV.file_ext_by_codec[self.acodec] else: ext='.mp3' else: ext='.avi' flags=[] if self.vcodec and DV.codec_advanced_cl.has_key(self.vcodec): for o in DV.codec_advanced_cl[self.vcodec]: if type(o) in (type(''),type(u'')): if o not in flags: # If the flag is already there, don't add it again flags.append(o) else: if '-'+o[0] not in cmd: # If the option is already there, don't overwrite it cmd.extend(['-'+o[0],o[1]]) if len(flags): cmd.extend(['-flags',''.join(flags)]) self.filename=self.getfinalfilename(self.outdir,self.filename,ext) self.filenamenoext=self.filename self.tmpfilename=self.gettmpfilename(DV.tmp_path,self.filenamenoext.decode('utf8','ignore').encode('charmap','ignore'),ext) cmd.append('?DAMNVID_OUTPUT_FILE?') if len(self.moduleextraargs): cmd.extend(self.moduleextraargs) Damnlog('ffmpeg call has been generated:',cmd) self.filename=self.filenamenoext+ext self.duration=None self.update(statustext=u'Converting '+DamnUnicode(self.parent.meta[self.parent.videos[self.parent.converting]]['name'])+u' to '+DamnUnicode(self.filename.decode('utf8'))+u'...') while int(self.passes)<=int(self.totalpasses) and not self.abort: Damnlog('Starting pass',self.passes,'out of',self.totalpasses) if self.totalpasses!=1: self.parent.meta[self.parent.videos[self.parent.converting]]['status']='Pass '+str(self.passes)+'/'+str(self.totalpasses)+'...' self.update(status='Pass '+str(self.passes)+'/'+str(self.totalpasses)+'...') if self.stream=='-': if self.passes==1: self.tmppassfile=DV.tmp_path+self.gettmpfilename(DV.tmp_path,self.filenamenoext,ext) else: self.stream=self.tmppassfile if self.passes!=1: self.tmpfilename=self.gettmpfilename(DV.tmp_path,self.filenamenoext,ext) self.process=DamnSpawner(self.cmd2str(cmd),stderr=subprocess.PIPE,stdin=subprocess.PIPE,cwd=os.path.dirname(DV.tmp_path)) if self.stream=='-': if self.totalpasses!=1: self.feeder=DamnDownloader(self.uris,self.process.stdin,self.tmppassfile) else: self.feeder=DamnDownloader(self.uris,self.process.stdin) self.feeder.start() curline='' while self.process.poll()==None and not self.abort: c=self.process.stderr.read(1) curline+=c if c=='\r' or c=='\n': self.parseLine(curline) curline='' self.passes+=1 Damnlog('And we\'re done converting!') self.update(100) result=self.process.poll() # The process is complete, but .poll() still returns the process's return code time.sleep(.25) # Wait a bit self.grabberrun=False # That'll make the DamnConverterGrabber wake up just in case if result and os.path.exists(DV.tmp_path+self.tmpfilename): os.remove(DV.tmp_path+self.tmpfilename) # Delete the output file if ffmpeg has exitted with a bad return code Damnlog('All the routine completed successfully.') else: result=1 Damnlog('Error in main conversion routine.') Damnlog('Cleaning up after conversion.') for i in os.listdir(os.path.dirname(DV.tmp_path)): if i[0:8]=='damnvid-': i=i[8:] if i==self.tmpfilename and not result and not self.abort: try: os.rename(DV.tmp_path+i,self.outdir+self.filename) except: # Maybe the file still isn't unlocked, it happens... Wait moar and retry try: time.sleep(2) os.rename(DV.tmp_path+i,self.outdir+self.filename) except: # Now this is really bad, alert the user try: # Manual copy, might be needed if we're working on two different filesystems on a non-Windows platform src=open(DV.tmp_path+i,'rb') dst=open(self.outdir+self.filename,'wb') for fileline in src.readlines(): dst.write(fileline) try: # Another try block in order to avoid raising the huge except block with the dialog src.close() dst.close() os.remove(DV.tmp_path+i) except: pass except: self.update(dialog=(DV.l('Cannot move file!'),DV.l('locale:successfully-converted-file-but-ioerror')+'\n'+DV.tmp_path+i,wx.OK|wx.ICON_EXCLAMATION)) else: try: os.remove(DV.tmp_path+i) except: pass Damnlog('End cleanup, returning. Result?',result,'; Abort?',self.abort) if not result and not self.abort: self.parent.meta[self.parent.videos[self.parent.converting]]['status']=DV.l('Success!') self.parent.resultlist.append((self.parent.meta[self.parent.videos[self.parent.converting]]['name'],self.outdir)) self.update(status=DV.l('Success!'),go=self.abort) return self.parent.meta[self.parent.videos[self.parent.converting]]['status']=DV.l('Failure.') self.update(status=DV.l('Failure.'),go=self.abort)
18d91d3a382ccc85706a20ab0defe4fb663ef94f /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/11142/18d91d3a382ccc85706a20ab0defe4fb663ef94f/DamnVid.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1086, 12, 2890, 4672, 365, 18, 23510, 33, 2890, 18, 588, 3098, 12, 2890, 18, 3168, 1650, 13, 365, 18, 18623, 33, 8381, 309, 486, 365, 18, 18623, 30, 309, 1053, 30, 463, 301, 82, 1330, 2668, 6814, 12245, 5023, 16, 3699, 353, 2187, 2890, 18, 23510, 63, 20, 5717, 365, 18, 1650, 33, 2890, 18, 23510, 63, 20, 65, 365, 18, 2725, 12, 20, 13, 365, 18, 2938, 18, 2211, 9115, 18, 6923, 12, 2890, 18, 2938, 18, 6768, 538, 63, 2890, 18, 2938, 18, 6283, 310, 5717, 365, 18, 3459, 33, 9124, 892, 18, 12237, 2668, 50, 13121, 40, 2187, 40, 301, 82, 16532, 12, 12472, 67, 3776, 67, 39, 10439, 3079, 67, 16080, 18, 1717, 2668, 2187, 2890, 18, 2938, 18, 3901, 63, 2890, 18, 2938, 18, 6768, 538, 63, 2890, 18, 2938, 18, 6283, 310, 13563, 3292, 529, 3546, 3719, 2934, 3015, 2668, 3158, 28, 17023, 6185, 16063, 2079, 2668, 19, 2187, 6309, 2934, 2079, 2668, 1695, 2187, 6309, 2934, 6406, 1435, 365, 18, 5040, 33, 474, 12, 2890, 18, 2938, 18, 3901, 63, 2890, 18, 2938, 18, 6768, 538, 63, 2890, 18, 2938, 18, 6283, 310, 13563, 3292, 5040, 19486, 309, 1140, 18, 803, 18, 1808, 12, 2890, 18, 1650, 4672, 463, 301, 82, 1330, 2668, 3218, 3730, 266, 21964, 598, 279, 585, 1407, 2674, 1093, 13, 365, 18, 3256, 33, 2890, 18, 1650, 468, 2597, 1807, 279, 585, 1407, 16, 6875, 19951, 903, 4862, 7671, 434, 518, 309, 365, 18, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1086, 12, 2890, 4672, 365, 18, 23510, 33, 2890, 18, 588, 3098, 12, 2890, 18, 3168, 1650, 13, 365, 18, 18623, 33, 8381, 309, 486, 365, 18, 18623, 30, 309, 1053, 30, 463, 301, 82, 1330, 2668, 6814, 12245, 5023, 16, 3699, 353, 2187, 2890, 18, 23510, 63, 20, 5717, 365, 18, 1650, 33, 2890, 18, 23510, 63, 20, 65, 365, 18, 2725, 12, 20, 13, 365, 18, 2938, 18, 2211, 9115, 18, 6923, 12, 2890, 18, 2938, 18, 6768, 538, 63, 2890, 18, 2938, 18, 6283, 310, 5717, 365, 18, 3459, 33, 9124, 892, 18, 12237, 2668, 50, 13121, 40, 2187, 40, 301, 82, 16532, 12, 12472, 67, 3776, 67, 39, 10439, 3079, 67, 16080, 18, 1717, 2 ]
(6*sqrt(3)*t^3/7 + 6*sqrt(3)*t^2/7 + 6*t^2/7 + 2*sqrt(3)*t/7 + 6*t/7 + 2/7)/(2*sqrt(3) + 2)
(3*sqrt(3)*t^3/7 + 3*sqrt(3)*t^2/7 + 3*t^2/7 + sqrt(3)*t/7 + 3*t/7 + 1/7)/(sqrt(3) + 1)
def chinen_polynomial(self): """ Returns the Chinen zeta polynomial of the code.
a032d7219f7178e41cd3d1727a56c5a90f0201cf /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/9890/a032d7219f7178e41cd3d1727a56c5a90f0201cf/linear_code.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 462, 267, 275, 67, 3915, 13602, 12, 2890, 4672, 3536, 2860, 326, 1680, 267, 275, 998, 1066, 16991, 434, 326, 981, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 462, 267, 275, 67, 3915, 13602, 12, 2890, 4672, 3536, 2860, 326, 1680, 267, 275, 998, 1066, 16991, 434, 326, 981, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
ExplorerNodes.langStyleInfoReg.append( ('Text', 'text', TextSTCMix,
ExplorerNodes.langStyleInfoReg.append( ('Text', 'text', TextSTCMix,
def __init__(self, parent, model): EditorStyledTextCtrl.__init__(self, parent, wxID_TEXTVIEW, model, (), -1) TextSTCMix.__init__(self, wxID_TEXTVIEW) self.active = true
d9d7849efc5eb8e0d9d32209221846ef27372675 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/4325/d9d7849efc5eb8e0d9d32209221846ef27372675/SourceViews.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 982, 16, 938, 4672, 18451, 24273, 1259, 1528, 12418, 16186, 2738, 972, 12, 2890, 16, 982, 16, 7075, 734, 67, 5151, 12145, 16, 938, 16, 1832, 16, 300, 21, 13, 3867, 882, 9611, 697, 16186, 2738, 972, 12, 2890, 16, 7075, 734, 67, 5151, 12145, 13, 365, 18, 3535, 273, 638, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 982, 16, 938, 4672, 18451, 24273, 1259, 1528, 12418, 16186, 2738, 972, 12, 2890, 16, 982, 16, 7075, 734, 67, 5151, 12145, 16, 938, 16, 1832, 16, 300, 21, 13, 3867, 882, 9611, 697, 16186, 2738, 972, 12, 2890, 16, 7075, 734, 67, 5151, 12145, 13, 365, 18, 3535, 273, 638, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
`\\theta''+\\sin(\\theta)=0`, `\\theta(0)=\\frac 34`, `\\theta'(0) =
`\theta''+\sin(\theta)=0`, `\theta(0)=\frac 34`, `\theta'(0) =
def eulers_method_2x2_plot(f,g, t0, x0, y0, h, t1): """ This plots the soln in the rectangle ``(xrange[0],xrange[1]) x (yrange[0],yrange[1])`` and plots using Euler's method the numerical solution of the 1st order ODEs `x' = f(t,x,y)`, `x(a)=x_0`, `y' = g(t,x,y)`, `y(a) = y_0`. *For pedagogical purposes only.* EXAMPLES:: The following example plots the solution to `\\theta''+\\sin(\\theta)=0`, `\\theta(0)=\\frac 34`, `\\theta'(0) = 0`. Type ``P[0].show()`` to plot the solution, ``(P[0]+P[1]).show()`` to plot `(t,\\theta(t))` and `(t,\\theta'(t))`:: sage: from sage.calculus.desolvers import eulers_method_2x2_plot sage: f = lambda z : z[2]; g = lambda z : -sin(z[1]) sage: P = eulers_method_2x2_plot(f,g, 0.0, 0.75, 0.0, 0.1, 1.0) """ n=int((1.0)*(t1-t0)/h) t00 = t0; x00 = x0; y00 = y0 soln = [[t00,x00,y00]] for i in range(n+1): x01 = x00 + h*f([t00,x00,y00]) y00 = y00 + h*g([t00,x00,y00]) x00 = x01 t00 = t00 + h soln.append([t00,x00,y00]) Q1 = line([[x[0],x[1]] for x in soln], rgbcolor=(1/4,1/8,3/4)) Q2 = line([[x[0],x[2]] for x in soln], rgbcolor=(1/2,1/8,1/4)) return [Q1,Q2]
103e2c35756877269166b1784fa15fa439c899e5 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/9890/103e2c35756877269166b1784fa15fa439c899e5/desolvers.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 425, 332, 414, 67, 2039, 67, 22, 92, 22, 67, 4032, 12, 74, 16, 75, 16, 268, 20, 16, 619, 20, 16, 677, 20, 16, 366, 16, 268, 21, 4672, 3536, 1220, 17931, 326, 3704, 82, 316, 326, 11845, 12176, 12, 92, 3676, 63, 20, 6487, 92, 3676, 63, 21, 5717, 619, 261, 93, 3676, 63, 20, 6487, 93, 3676, 63, 21, 5717, 10335, 471, 17931, 1450, 512, 17040, 1807, 707, 326, 17409, 6959, 434, 326, 404, 334, 1353, 531, 1639, 87, 1375, 92, 11, 273, 284, 12, 88, 16, 92, 16, 93, 13, 9191, 1375, 92, 12, 69, 13, 33, 92, 67, 20, 9191, 1375, 93, 11, 273, 314, 12, 88, 16, 92, 16, 93, 13, 9191, 1375, 93, 12, 69, 13, 273, 677, 67, 20, 8338, 225, 380, 1290, 31840, 346, 717, 1706, 13694, 1338, 4509, 225, 5675, 8900, 11386, 2866, 225, 1021, 3751, 3454, 17931, 326, 6959, 358, 1375, 64, 14482, 6309, 16971, 21861, 4713, 14482, 13, 33, 20, 9191, 1375, 64, 14482, 12, 20, 13, 18206, 22187, 13438, 9191, 1375, 64, 14482, 11, 12, 20, 13, 273, 374, 8338, 225, 1412, 12176, 52, 63, 20, 8009, 4500, 1435, 10335, 358, 3207, 326, 6959, 16, 12176, 12, 52, 63, 20, 3737, 52, 63, 21, 65, 2934, 4500, 1435, 10335, 358, 3207, 1375, 12, 88, 16, 1695, 14482, 12, 88, 3719, 68, 471, 1375, 12, 88, 16, 1695, 14482, 11, 12, 88, 3719, 68, 2866, 225, 272, 410, 30, 628, 272, 410, 18, 12780, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 425, 332, 414, 67, 2039, 67, 22, 92, 22, 67, 4032, 12, 74, 16, 75, 16, 268, 20, 16, 619, 20, 16, 677, 20, 16, 366, 16, 268, 21, 4672, 3536, 1220, 17931, 326, 3704, 82, 316, 326, 11845, 12176, 12, 92, 3676, 63, 20, 6487, 92, 3676, 63, 21, 5717, 619, 261, 93, 3676, 63, 20, 6487, 93, 3676, 63, 21, 5717, 10335, 471, 17931, 1450, 512, 17040, 1807, 707, 326, 17409, 6959, 434, 326, 404, 334, 1353, 531, 1639, 87, 1375, 92, 11, 273, 284, 12, 88, 16, 92, 16, 93, 13, 9191, 1375, 92, 12, 69, 13, 33, 92, 67, 20, 9191, 1375, 93, 11, 273, 314, 12, 88, 16, 92, 16, 93, 13, 9191, 2 ]
if os.environ.has_key('CVSROOT'): cvsroot = os.environ['CVSROOT'] else: cvsroot = '' cvsroot = self.cvsCmdPrompt(cvsroot, cvsDir, help = 'Change the CVSROOT if necessary:') dlg = wxTextEntryDialog(self.list, 'Enter cvs password for '+cvsroot, 'CVS login', '', style = wxOK | wxCANCEL | wxCENTRE | wxTE_PASSWORD)
if not cvsroot: if os.environ.has_key('CVSROOT'): cvsroot = os.environ['CVSROOT'] else: cvsroot = '' cvsroot = self.cvsCmdPrompt(cvsroot, cvsDir, help='Change the CVSROOT if necessary:') dlg = wxTextEntryDialog(self.list, 'Enter cvs password for '+cvsroot, 'CVS login', '', style=wxOK|wxCANCEL|wxCENTRE|wxTE_PASSWORD)
def OnLoginCVS(self, event): cvsDir = self.list.node.resourcepath
b94d80a8d6380c520f64a27f00e364c24e6099b8 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/4325/b94d80a8d6380c520f64a27f00e364c24e6099b8/CVSExplorer.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2755, 5358, 39, 14640, 12, 2890, 16, 871, 4672, 276, 6904, 1621, 273, 365, 18, 1098, 18, 2159, 18, 3146, 803, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2755, 5358, 39, 14640, 12, 2890, 16, 871, 4672, 276, 6904, 1621, 273, 365, 18, 1098, 18, 2159, 18, 3146, 803, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
py_compile.compile(fullname, None, dfile)
ok = py_compile.compile(fullname, None, dfile)
def compile_dir(dir, maxlevels=10, ddir=None, force=0): """Byte-compile all modules in the given directory tree. Arguments (only dir is required): dir: the directory to byte-compile maxlevels: maximum recursion level (default 10) ddir: if given, purported directory name (this is the directory name that will show up in error messages) force: if 1, force compilation, even if timestamps are up-to-date """ print 'Listing', dir, '...' try: names = os.listdir(dir) except os.error: print "Can't list", dir names = [] names.sort() success = 1 for name in names: fullname = os.path.join(dir, name) if ddir: dfile = os.path.join(ddir, name) else: dfile = None if os.path.isfile(fullname): head, tail = name[:-3], name[-3:] if tail == '.py': cfile = fullname + (__debug__ and 'c' or 'o') ftime = os.stat(fullname)[stat.ST_MTIME] try: ctime = os.stat(cfile)[stat.ST_MTIME] except os.error: ctime = 0 if (ctime > ftime) and not force: continue print 'Compiling', fullname, '...' try: py_compile.compile(fullname, None, dfile) except KeyboardInterrupt: raise KeyboardInterrupt except: if type(sys.exc_type) == type(''): exc_type_name = sys.exc_type else: exc_type_name = sys.exc_type.__name__ print 'Sorry:', exc_type_name + ':', print sys.exc_value success = 0 elif maxlevels > 0 and \ name != os.curdir and name != os.pardir and \ os.path.isdir(fullname) and \ not os.path.islink(fullname): compile_dir(fullname, maxlevels - 1, dfile, force) return success
5dcb85d62bdfe3cc748b635ee516b916da660f1c /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8125/5dcb85d62bdfe3cc748b635ee516b916da660f1c/compileall.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 4074, 67, 1214, 12, 1214, 16, 943, 12095, 33, 2163, 16, 302, 1214, 33, 7036, 16, 2944, 33, 20, 4672, 3536, 3216, 17, 11100, 777, 4381, 316, 326, 864, 1867, 2151, 18, 225, 13599, 261, 3700, 1577, 353, 1931, 4672, 225, 1577, 30, 4202, 326, 1867, 358, 1160, 17, 11100, 943, 12095, 30, 4207, 13917, 1801, 261, 1886, 1728, 13, 302, 1214, 30, 1377, 309, 864, 16, 5405, 1798, 1867, 508, 261, 2211, 353, 326, 1867, 508, 716, 903, 2405, 731, 316, 555, 2743, 13, 2944, 30, 377, 309, 404, 16, 2944, 8916, 16, 5456, 309, 11267, 854, 731, 17, 869, 17, 712, 225, 3536, 1172, 296, 19081, 2187, 1577, 16, 20243, 775, 30, 1257, 273, 1140, 18, 1098, 1214, 12, 1214, 13, 1335, 1140, 18, 1636, 30, 1172, 315, 2568, 1404, 666, 3113, 1577, 1257, 273, 5378, 1257, 18, 3804, 1435, 2216, 273, 404, 364, 508, 316, 1257, 30, 13321, 273, 1140, 18, 803, 18, 5701, 12, 1214, 16, 508, 13, 309, 302, 1214, 30, 302, 768, 273, 1140, 18, 803, 18, 5701, 12, 449, 481, 16, 508, 13, 469, 30, 302, 768, 273, 599, 309, 1140, 18, 803, 18, 291, 768, 12, 21885, 4672, 910, 16, 5798, 273, 508, 10531, 17, 23, 6487, 508, 18919, 23, 26894, 309, 5798, 422, 2418, 2074, 4278, 276, 768, 273, 13321, 397, 261, 972, 4148, 972, 471, 296, 71, 11, 578, 296, 83, 6134, 284, 957, 273, 1140, 18, 5642, 12, 21885, 25146, 5642, 18, 882, 67, 49, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 4074, 67, 1214, 12, 1214, 16, 943, 12095, 33, 2163, 16, 302, 1214, 33, 7036, 16, 2944, 33, 20, 4672, 3536, 3216, 17, 11100, 777, 4381, 316, 326, 864, 1867, 2151, 18, 225, 13599, 261, 3700, 1577, 353, 1931, 4672, 225, 1577, 30, 4202, 326, 1867, 358, 1160, 17, 11100, 943, 12095, 30, 4207, 13917, 1801, 261, 1886, 1728, 13, 302, 1214, 30, 1377, 309, 864, 16, 5405, 1798, 1867, 508, 261, 2211, 353, 326, 1867, 508, 716, 903, 2405, 731, 316, 555, 2743, 13, 2944, 30, 377, 309, 404, 16, 2944, 8916, 16, 5456, 309, 11267, 854, 731, 17, 869, 17, 712, 225, 3536, 1172, 296, 19081, 2187, 1577, 16, 20243, 775, 30, 1257, 273, 1140, 18, 2 ]
svg_string += self._svg_circle(19, 6, 1.5) svg_string += self._svg_circle(6, 19, 1.5)
svg_string += self._svg_circle(19 + x, 6 + y, 1.5) svg_string += self._svg_circle(6 + x, 19 + y, 1.5)
def _svg_die(self, n, x, y): svg_string = "%s%f%s%f%s" % ("<g\n transform=\"translate(", x, ", ", y, "\">\n") self.set_stroke_width(1.5) self.set_colors([self._stroke, "none"]) svg_string += self._svg_rect(25, 25, 2, 2, 0, 0) self.set_stroke_width(2) self.set_colors([self._stroke, self._stroke]) if n in [2, 3, 4, 5, 6]: svg_string += self._svg_circle(6, 6, 1.5) svg_string += self._svg_circle(19, 19, 1.5) if n in [1, 3, 5]: svg_string += self._svg_circle(12.5, 12.5, 1.5) if n in [4, 5, 6]: svg_string += self._svg_circle(19, 6, 1.5) svg_string += self._svg_circle(6, 19, 1.5) if n in [6]: svg_string += self._svg_circle(6, 12.5, 1.5) svg_string += self._svg_circle(19, 12.5, 1.5) svg_string += "</g>\n" return svg_string
3abdde2d4415b99e072401aa95cc310d13046e05 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/7609/3abdde2d4415b99e072401aa95cc310d13046e05/gencards.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 11451, 67, 72, 1385, 12, 2890, 16, 290, 16, 619, 16, 677, 4672, 9804, 67, 1080, 273, 2213, 87, 9, 74, 9, 87, 9, 74, 9, 87, 6, 738, 7566, 32, 75, 64, 82, 282, 2510, 5189, 13929, 2932, 16, 619, 16, 3104, 3104, 677, 16, 7023, 5333, 82, 7923, 365, 18, 542, 67, 16181, 67, 2819, 12, 21, 18, 25, 13, 365, 18, 542, 67, 9724, 3816, 2890, 6315, 16181, 16, 315, 6102, 6, 5717, 9804, 67, 1080, 1011, 365, 6315, 11451, 67, 2607, 12, 2947, 16, 6969, 16, 576, 16, 576, 16, 374, 16, 374, 13, 365, 18, 542, 67, 16181, 67, 2819, 12, 22, 13, 365, 18, 542, 67, 9724, 3816, 2890, 6315, 16181, 16, 365, 6315, 16181, 5717, 309, 290, 316, 306, 22, 16, 890, 16, 1059, 16, 1381, 16, 1666, 14542, 9804, 67, 1080, 1011, 365, 6315, 11451, 67, 18970, 12, 26, 16, 1666, 16, 404, 18, 25, 13, 9804, 67, 1080, 1011, 365, 6315, 11451, 67, 18970, 12, 3657, 16, 5342, 16, 404, 18, 25, 13, 309, 290, 316, 306, 21, 16, 890, 16, 1381, 14542, 9804, 67, 1080, 1011, 365, 6315, 11451, 67, 18970, 12, 2138, 18, 25, 16, 2593, 18, 25, 16, 404, 18, 25, 13, 309, 290, 316, 306, 24, 16, 1381, 16, 1666, 14542, 9804, 67, 1080, 1011, 365, 6315, 11451, 67, 18970, 12, 3657, 397, 619, 16, 1666, 397, 677, 16, 404, 18, 25, 13, 9804, 67, 1080, 1011, 365, 6315, 11451, 67, 18970, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 11451, 67, 72, 1385, 12, 2890, 16, 290, 16, 619, 16, 677, 4672, 9804, 67, 1080, 273, 2213, 87, 9, 74, 9, 87, 9, 74, 9, 87, 6, 738, 7566, 32, 75, 64, 82, 282, 2510, 5189, 13929, 2932, 16, 619, 16, 3104, 3104, 677, 16, 7023, 5333, 82, 7923, 365, 18, 542, 67, 16181, 67, 2819, 12, 21, 18, 25, 13, 365, 18, 542, 67, 9724, 3816, 2890, 6315, 16181, 16, 315, 6102, 6, 5717, 9804, 67, 1080, 1011, 365, 6315, 11451, 67, 2607, 12, 2947, 16, 6969, 16, 576, 16, 576, 16, 374, 16, 374, 13, 365, 18, 542, 67, 16181, 67, 2819, 12, 22, 13, 365, 18, 542, 67, 9724, 3816, 2890, 6315, 16181, 2 ]
SuperSocket.close(self)
def close(self): SuperSocket.close(self) if self.promisc: for i in self.iff:
589b981d7d8ff8631ab148a37a1dfa160b0462f8 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/7311/589b981d7d8ff8631ab148a37a1dfa160b0462f8/scapy.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1746, 12, 2890, 4672, 309, 365, 18, 17401, 291, 71, 30, 364, 277, 316, 365, 18, 3048, 30, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1746, 12, 2890, 4672, 309, 365, 18, 17401, 291, 71, 30, 364, 277, 316, 365, 18, 3048, 30, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
class AliasDefinition(PEP253Mixin, GlobalObjectDefinition):
class AliasDefinition(PEP253Mixin, ObjectDefinition):
def output_tp_initBody(self): Output("PyObject *v = NULL;") Output("char *rawdata = NULL;") Output("int rawdatalen = 0;") Output("char *kw[] = {\"itself\", \"rawdata\", 0};") Output() Output("if (!PyArg_ParseTupleAndKeywords(args, kwds, \"|Os#\", kw, &v, &rawdata, &rawdatalen))") Output("return -1;") Output("if (v && rawdata)") OutLbrace() Output("PyErr_SetString(PyExc_TypeError, \"Only one of itself or rawdata may be specified\");") Output("return -1;") OutRbrace() Output("if (!v && !rawdata)") OutLbrace() Output("PyErr_SetString(PyExc_TypeError, \"One of itself or rawdata must be specified\");") Output("return -1;") OutRbrace() Output("if (rawdata)") OutLbrace() Output("if (rawdatalen != sizeof(%s))", self.itselftype) OutLbrace() Output("PyErr_SetString(PyExc_TypeError, \"%s rawdata incorrect size\");", self.itselftype) Output("return -1;") OutRbrace() Output("memcpy(&((%s *)self)->ob_itself, rawdata, rawdatalen);", self.objecttype) Output("return 0;") OutRbrace() Output("if (myPyMac_GetFSRef(v, &((%s *)self)->ob_itself)) return 0;", self.objecttype) Output("return -1;")
8ed30da29d0fd0d5df3fd27bfcaffe5b4b71a5f5 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8125/8ed30da29d0fd0d5df3fd27bfcaffe5b4b71a5f5/filesupport.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 876, 67, 6834, 67, 2738, 2250, 12, 2890, 4672, 3633, 2932, 9413, 921, 380, 90, 273, 3206, 4868, 13, 3633, 2932, 3001, 380, 1899, 892, 273, 3206, 4868, 13, 3633, 2932, 474, 1831, 72, 3145, 275, 273, 374, 4868, 13, 3633, 2932, 3001, 380, 9987, 8526, 273, 288, 2412, 1282, 19079, 22564, 1239, 1899, 892, 22564, 374, 97, 4868, 13, 3633, 1435, 3633, 2932, 430, 16051, 9413, 4117, 67, 3201, 9038, 1876, 14149, 12, 1968, 16, 17149, 16, 1239, 96, 15112, 7, 22564, 5323, 16, 473, 90, 16, 473, 1899, 892, 16, 473, 1899, 72, 3145, 275, 30743, 13, 3633, 2932, 2463, 300, 21, 4868, 13, 3633, 2932, 430, 261, 90, 597, 1831, 892, 2225, 13, 2976, 48, 70, 9963, 1435, 3633, 2932, 9413, 2524, 67, 694, 780, 12, 9413, 29924, 67, 19030, 16, 1239, 3386, 1245, 434, 6174, 578, 1831, 892, 2026, 506, 1269, 2412, 1769, 7923, 3633, 2932, 2463, 300, 21, 4868, 13, 2976, 54, 70, 9963, 1435, 3633, 2932, 430, 16051, 90, 597, 401, 1899, 892, 2225, 13, 2976, 48, 70, 9963, 1435, 3633, 2932, 9413, 2524, 67, 694, 780, 12, 9413, 29924, 67, 19030, 16, 1239, 3335, 434, 6174, 578, 1831, 892, 1297, 506, 1269, 2412, 1769, 7923, 3633, 2932, 2463, 300, 21, 4868, 13, 2976, 54, 70, 9963, 1435, 3633, 2932, 430, 261, 1899, 892, 2225, 13, 2976, 48, 70, 9963, 1435, 3633, 2932, 430, 261, 1899, 72, 3145, 275, 480, 13726, 9275, 87, 30743, 16, 365, 18, 1282, 19079, 723, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 876, 67, 6834, 67, 2738, 2250, 12, 2890, 4672, 3633, 2932, 9413, 921, 380, 90, 273, 3206, 4868, 13, 3633, 2932, 3001, 380, 1899, 892, 273, 3206, 4868, 13, 3633, 2932, 474, 1831, 72, 3145, 275, 273, 374, 4868, 13, 3633, 2932, 3001, 380, 9987, 8526, 273, 288, 2412, 1282, 19079, 22564, 1239, 1899, 892, 22564, 374, 97, 4868, 13, 3633, 1435, 3633, 2932, 430, 16051, 9413, 4117, 67, 3201, 9038, 1876, 14149, 12, 1968, 16, 17149, 16, 1239, 96, 15112, 7, 22564, 5323, 16, 473, 90, 16, 473, 1899, 892, 16, 473, 1899, 72, 3145, 275, 30743, 13, 3633, 2932, 2463, 300, 21, 4868, 13, 3633, 2932, 430, 261, 90, 597, 1831, 892, 2225, 13, 2976, 48, 2 ]
field._renderer = lambda: self.parent.default_renderers['radio']
field._renderer = lambda: field.parent.default_renderers['radio']
def radio(self, options=None): """Render the field as a set of radio buttons.""" field = deepcopy(self) field._renderer = lambda: self.parent.default_renderers['radio'] if options is None: options = self.render_opts.get('options') else: options = _normalized_options(options) field.render_opts = {'options': options} return field
4af9a644c033b5a584bed1bcc327d2033a0a4c54 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/13203/4af9a644c033b5a584bed1bcc327d2033a0a4c54/fields.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 13512, 12, 2890, 16, 702, 33, 7036, 4672, 3536, 3420, 326, 652, 487, 279, 444, 434, 13512, 9502, 12123, 652, 273, 7217, 12, 2890, 13, 652, 6315, 14374, 273, 3195, 30, 652, 18, 2938, 18, 1886, 67, 5902, 414, 3292, 17006, 3546, 309, 702, 353, 599, 30, 702, 273, 365, 18, 5902, 67, 4952, 18, 588, 2668, 2116, 6134, 469, 30, 702, 273, 389, 17762, 67, 2116, 12, 2116, 13, 652, 18, 5902, 67, 4952, 273, 13666, 2116, 4278, 702, 97, 327, 652, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 13512, 12, 2890, 16, 702, 33, 7036, 4672, 3536, 3420, 326, 652, 487, 279, 444, 434, 13512, 9502, 12123, 652, 273, 7217, 12, 2890, 13, 652, 6315, 14374, 273, 3195, 30, 652, 18, 2938, 18, 1886, 67, 5902, 414, 3292, 17006, 3546, 309, 702, 353, 599, 30, 702, 273, 365, 18, 5902, 67, 4952, 18, 588, 2668, 2116, 6134, 469, 30, 702, 273, 389, 17762, 67, 2116, 12, 2116, 13, 652, 18, 5902, 67, 4952, 273, 13666, 2116, 4278, 702, 97, 327, 652, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
d.update(self.__axes_range)
d.update(self.get_axes_range())
def save(self, filename=None, xmin=None, xmax=None, ymin=None, ymax=None, figsize=DEFAULT_FIGSIZE, figure=None, sub=None, savenow=True, dpi=DEFAULT_DPI, axes=None, axes_labels=None, fontsize=None, frame=False, verify=True, aspect_ratio = None, gridlines=None, gridlinesstyle=None, vgridlinesstyle=None, hgridlinesstyle=None): r""" Save the graphics to an image file of type: PNG, PS, EPS, SVG, SOBJ, depending on the file extension you give the filename. Extension types can be: \file{.png}, \file{.ps}, \file{.eps}, \file{.svg}, and \file{.sobj} (for a \sage object you can load later).
cb8ef50c324b324938121dd17f148aed10daf69f /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/9417/cb8ef50c324b324938121dd17f148aed10daf69f/plot.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1923, 12, 2890, 16, 1544, 33, 7036, 16, 13777, 33, 7036, 16, 14016, 33, 7036, 16, 15763, 33, 7036, 16, 15275, 33, 7036, 16, 14697, 33, 5280, 67, 5236, 4574, 16, 7837, 33, 7036, 16, 720, 33, 7036, 16, 4087, 275, 543, 33, 5510, 16, 16361, 33, 5280, 67, 40, 1102, 16, 6515, 33, 7036, 16, 6515, 67, 5336, 33, 7036, 16, 14869, 33, 7036, 16, 2623, 33, 8381, 16, 3929, 33, 5510, 16, 9648, 67, 9847, 273, 599, 16, 3068, 3548, 33, 7036, 16, 3068, 3548, 4060, 33, 7036, 16, 331, 5222, 3548, 4060, 33, 7036, 16, 366, 5222, 3548, 4060, 33, 7036, 4672, 436, 8395, 7074, 326, 17313, 358, 392, 1316, 585, 434, 618, 30, 22476, 16, 26320, 16, 512, 5857, 16, 11281, 16, 348, 24547, 16, 8353, 603, 326, 585, 2710, 1846, 8492, 326, 1544, 18, 10021, 1953, 848, 506, 30, 521, 768, 95, 18, 6446, 5779, 521, 768, 95, 18, 1121, 5779, 521, 768, 95, 18, 13058, 5779, 521, 768, 95, 18, 11451, 5779, 471, 521, 768, 95, 18, 2048, 441, 97, 261, 1884, 279, 521, 87, 410, 733, 1846, 848, 1262, 5137, 2934, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1923, 12, 2890, 16, 1544, 33, 7036, 16, 13777, 33, 7036, 16, 14016, 33, 7036, 16, 15763, 33, 7036, 16, 15275, 33, 7036, 16, 14697, 33, 5280, 67, 5236, 4574, 16, 7837, 33, 7036, 16, 720, 33, 7036, 16, 4087, 275, 543, 33, 5510, 16, 16361, 33, 5280, 67, 40, 1102, 16, 6515, 33, 7036, 16, 6515, 67, 5336, 33, 7036, 16, 14869, 33, 7036, 16, 2623, 33, 8381, 16, 3929, 33, 5510, 16, 9648, 67, 9847, 273, 599, 16, 3068, 3548, 33, 7036, 16, 3068, 3548, 4060, 33, 7036, 16, 331, 5222, 3548, 4060, 33, 7036, 16, 366, 5222, 3548, 4060, 33, 7036, 4672, 436, 8395, 7074, 326, 17313, 358, 392, 1316, 585, 434, 618, 30, 22476, 2 ]
vals['res_model'] = "report.document.user"
if not vals.get('res_id', False) and context.get('default_res_id',False): vals['res_id']=context.get('default_res_id',False) if not vals.get('res_model', False) and context.get('default_res_model',False): vals['res_model']=context.get('default_res_model',False)
def create(self, cr, uid, vals, context={}): vals['title']=vals['name'] vals['parent_id'] = context.get('parent_id',False) or vals.get('parent_id',False)
f47eae52203d4d43bc0e45ff3b2a094943f01118 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/7397/f47eae52203d4d43bc0e45ff3b2a094943f01118/document.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 752, 12, 2890, 16, 4422, 16, 4555, 16, 5773, 16, 819, 12938, 4672, 5773, 3292, 2649, 3546, 33, 4524, 3292, 529, 3546, 5773, 3292, 2938, 67, 350, 3546, 273, 819, 18, 588, 2668, 2938, 67, 350, 2187, 8381, 13, 578, 5773, 18, 588, 2668, 2938, 67, 350, 2187, 8381, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 752, 12, 2890, 16, 4422, 16, 4555, 16, 5773, 16, 819, 12938, 4672, 5773, 3292, 2649, 3546, 33, 4524, 3292, 529, 3546, 5773, 3292, 2938, 67, 350, 3546, 273, 819, 18, 588, 2668, 2938, 67, 350, 2187, 8381, 13, 578, 5773, 18, 588, 2668, 2938, 67, 350, 2187, 8381, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
args = [ arg[2:-1] for arg in args ]
args = [ arg[2:-1] for arg in args ]
def _parse_args(self, handler): args = list(handler.args) if handler.type == 'user': args = [ arg[2:-1] for arg in args ] # strip ${} default_count = len(handler.defaults) if default_count == 0: required = args[:] defaults = [] else: required = args[:-default_count] defaults = zip(args[-default_count:], list(handler.defaults)) varargs = handler.varargs if handler.type == 'user' and varargs is not None: varargs = varargs[2:-1] return required, defaults, varargs
cb95dea07e96d54d843c0aed351e0ed955bfdd79 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/7408/cb95dea07e96d54d843c0aed351e0ed955bfdd79/libdoc.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 2670, 67, 1968, 12, 2890, 16, 1838, 4672, 833, 273, 666, 12, 4176, 18, 1968, 13, 309, 1838, 18, 723, 422, 296, 1355, 4278, 833, 273, 306, 1501, 63, 22, 30, 17, 21, 65, 364, 1501, 316, 833, 308, 225, 468, 2569, 271, 2916, 805, 67, 1883, 273, 562, 12, 4176, 18, 7606, 13, 309, 805, 67, 1883, 422, 374, 30, 1931, 273, 833, 10531, 65, 3467, 273, 5378, 469, 30, 1931, 273, 833, 10531, 17, 1886, 67, 1883, 65, 3467, 273, 3144, 12, 1968, 18919, 1886, 67, 1883, 30, 6487, 666, 12, 4176, 18, 7606, 3719, 19732, 273, 1838, 18, 1401, 1968, 309, 1838, 18, 723, 422, 296, 1355, 11, 471, 19732, 353, 486, 599, 30, 19732, 273, 19732, 63, 22, 30, 17, 21, 65, 327, 1931, 16, 3467, 16, 19732, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 2670, 67, 1968, 12, 2890, 16, 1838, 4672, 833, 273, 666, 12, 4176, 18, 1968, 13, 309, 1838, 18, 723, 422, 296, 1355, 4278, 833, 273, 306, 1501, 63, 22, 30, 17, 21, 65, 364, 1501, 316, 833, 308, 225, 468, 2569, 271, 2916, 805, 67, 1883, 273, 562, 12, 4176, 18, 7606, 13, 309, 805, 67, 1883, 422, 374, 30, 1931, 273, 833, 10531, 65, 3467, 273, 5378, 469, 30, 1931, 273, 833, 10531, 17, 1886, 67, 1883, 65, 3467, 273, 3144, 12, 1968, 18919, 1886, 67, 1883, 30, 6487, 666, 12, 4176, 18, 7606, 3719, 19732, 273, 1838, 18, 1401, 1968, 309, 1838, 18, 723, 422, 296, 1355, 11, 471, 19732, 353, 486, 599, 30, 2 ]
this = apply(_quickfix.new_UnderlyingSymbol, args)
this = _quickfix.new_UnderlyingSymbol(*args)
def __init__(self, *args): this = apply(_quickfix.new_UnderlyingSymbol, args) try: self.this.append(this) except: self.this = this
7e632099fd421880c8c65fb0cf610d338d115ee9 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/8819/7e632099fd421880c8c65fb0cf610d338d115ee9/quickfix.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 380, 1968, 4672, 333, 273, 389, 19525, 904, 18, 2704, 67, 14655, 6291, 5335, 30857, 1968, 13, 775, 30, 365, 18, 2211, 18, 6923, 12, 2211, 13, 1335, 30, 365, 18, 2211, 273, 333, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 380, 1968, 4672, 333, 273, 389, 19525, 904, 18, 2704, 67, 14655, 6291, 5335, 30857, 1968, 13, 775, 30, 365, 18, 2211, 18, 6923, 12, 2211, 13, 1335, 30, 365, 18, 2211, 273, 333, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
shown on each ruler
shown on each ruler.
def ruler_frame(lower_left, upper_right, ticks=4, sub_ticks=4, **kwds): """ Draw a frame made of 3D rulers, with major and minor ticks. INPUT: - ``lower_left`` - the lower left corner of the frame, as a list, tuple, or vector - ``upper_right`` - the upper right corner of the frame, as a list, tuple, or vector - ``ticks`` - (default: 4) the number of major ticks shown on each ruler - ``sub_ticks`` - (default: 4) the number of shown subdivisions between each major tick Type ``line3d.options`` for a dictionary of the default options for lines which are also available. EXAMPLES: A ruler frame:: sage: from sage.plot.plot3d.shapes2 import ruler_frame sage: F = ruler_frame([1,2,3],vector([2,3,4])); F A ruler frame with some options:: sage: F = ruler_frame([1,2,3],vector([2,3,4]),ticks=6, sub_ticks=2, color='red'); F """ return ruler(lower_left, (upper_right[0], lower_left[1], lower_left[2]), ticks=ticks, sub_ticks=sub_ticks, absolute=True, **kwds) \ + ruler(lower_left, (lower_left[0], upper_right[1], lower_left[2]), ticks=ticks, sub_ticks=sub_ticks, absolute=True, **kwds) \ + ruler(lower_left, (lower_left[0], lower_left[1], upper_right[2]), ticks=ticks, sub_ticks=sub_ticks, absolute=True, **kwds)
c85cd8e70aed89c86059888b9925f160e190c0a7 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/9890/c85cd8e70aed89c86059888b9925f160e190c0a7/shapes2.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 436, 17040, 67, 3789, 12, 8167, 67, 4482, 16, 3854, 67, 4083, 16, 13003, 33, 24, 16, 720, 67, 11767, 33, 24, 16, 2826, 25577, 4672, 3536, 10184, 279, 2623, 7165, 434, 890, 40, 436, 332, 414, 16, 598, 7888, 471, 8439, 13003, 18, 225, 12943, 30, 225, 300, 12176, 8167, 67, 4482, 10335, 300, 326, 2612, 2002, 11055, 434, 326, 2623, 16, 487, 279, 666, 16, 3193, 16, 578, 3806, 225, 300, 12176, 5797, 67, 4083, 10335, 300, 326, 3854, 2145, 11055, 434, 326, 2623, 16, 487, 279, 666, 16, 3193, 16, 578, 3806, 225, 300, 12176, 11767, 10335, 300, 261, 1886, 30, 1059, 13, 326, 1300, 434, 7888, 13003, 12188, 603, 1517, 436, 17040, 18, 225, 300, 12176, 1717, 67, 11767, 10335, 300, 261, 1886, 30, 1059, 13, 326, 1300, 434, 12188, 25741, 12682, 3086, 1517, 7888, 4024, 225, 1412, 12176, 1369, 23, 72, 18, 2116, 10335, 364, 279, 3880, 434, 326, 805, 702, 364, 2362, 1492, 854, 2546, 2319, 18, 225, 5675, 8900, 11386, 30, 225, 432, 436, 17040, 2623, 2866, 225, 272, 410, 30, 628, 272, 410, 18, 4032, 18, 4032, 23, 72, 18, 17648, 22, 1930, 436, 17040, 67, 3789, 272, 410, 30, 478, 273, 436, 17040, 67, 3789, 3816, 21, 16, 22, 16, 23, 6487, 7737, 3816, 22, 16, 23, 16, 24, 5717, 1769, 478, 225, 432, 436, 17040, 2623, 598, 2690, 702, 2866, 225, 272, 410, 30, 478, 273, 436, 17040, 67, 3789, 3816, 21, 16, 22, 16, 23, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 436, 17040, 67, 3789, 12, 8167, 67, 4482, 16, 3854, 67, 4083, 16, 13003, 33, 24, 16, 720, 67, 11767, 33, 24, 16, 2826, 25577, 4672, 3536, 10184, 279, 2623, 7165, 434, 890, 40, 436, 332, 414, 16, 598, 7888, 471, 8439, 13003, 18, 225, 12943, 30, 225, 300, 12176, 8167, 67, 4482, 10335, 300, 326, 2612, 2002, 11055, 434, 326, 2623, 16, 487, 279, 666, 16, 3193, 16, 578, 3806, 225, 300, 12176, 5797, 67, 4083, 10335, 300, 326, 3854, 2145, 11055, 434, 326, 2623, 16, 487, 279, 666, 16, 3193, 16, 578, 3806, 225, 300, 12176, 11767, 10335, 300, 261, 1886, 30, 1059, 13, 326, 1300, 434, 7888, 13003, 12188, 603, 1517, 436, 17040, 18, 225, 2 ]
assert(self.i18nMan._init, True)
assert self.i18nMan._init
def CanOpen(self, location): """ Called by wxPython to determine if the c{I18nFileSystemHandler} can open a given file type.
afcba0385c26d4b4b8a74364547f5330c57cadf4 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/9228/afcba0385c26d4b4b8a74364547f5330c57cadf4/i18nmanager.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 4480, 3678, 12, 2890, 16, 2117, 4672, 3536, 11782, 635, 7075, 15774, 358, 4199, 309, 326, 276, 95, 45, 2643, 82, 11785, 1503, 97, 848, 1696, 279, 864, 585, 618, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 4480, 3678, 12, 2890, 16, 2117, 4672, 3536, 11782, 635, 7075, 15774, 358, 4199, 309, 326, 276, 95, 45, 2643, 82, 11785, 1503, 97, 848, 1696, 279, 864, 585, 618, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
"""Reads structure from exiting xml file and returns atoms object in a list
"""Reads structure from exiting xml file.
def read_exciting(fileobj, index=-1): """Reads structure from exiting xml file and returns atoms object in a list Parameters ---------- fileobj : File object Filehandle from which data should be read Other parameters ---------------- index : integer -1 Not used in this implementation """ from lxml import etree as ET #parse file into element tree doc = ET.parse(fileobj) root = doc.getroot() speciesnodes = root.find('structure').getiterator('species') symbols = [] positions = [] basevects = [] atoms = None #collect data from tree for speciesnode in speciesnodes: symbol = speciesnode.get('speciesfile').split('.')[0] natoms = speciesnode.getiterator('atom') for atom in natoms: x, y, z = atom.get('coord').split() positions.append([float(x), float(y), float(z)]) symbols.append(symbol) basevectsn = doc.xpath('//basevect/text()') for basevect in basevectsn: x, y, z = basevect.split() basevects.append([float(x) * Bohr, float(y) * Bohr, float(z) * Bohr]) atoms = Atoms(symbols=symbols, cell=basevects) atoms.set_scaled_positions(positions) if 'molecule' in root.find('structure').attrib.keys(): if root.find('structure').attrib['molecule']: atoms.set_pbc(False) else: atoms.set_pbc(True) return atoms
59a55b9ac73fd158afb853569eee2926e450aead /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/5735/59a55b9ac73fd158afb853569eee2926e450aead/exciting.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 855, 67, 10075, 305, 310, 12, 768, 2603, 16, 770, 29711, 21, 4672, 3536, 7483, 3695, 628, 15702, 2025, 585, 18, 225, 7012, 12181, 17041, 294, 1387, 733, 1387, 4110, 628, 1492, 501, 1410, 506, 855, 4673, 1472, 300, 18753, 770, 294, 3571, 300, 21, 2288, 1399, 316, 333, 4471, 3536, 628, 328, 2902, 1930, 12031, 487, 4518, 468, 2670, 585, 1368, 930, 2151, 997, 273, 4518, 18, 2670, 12, 768, 2603, 13, 1365, 273, 997, 18, 588, 3085, 1435, 12891, 4690, 273, 1365, 18, 4720, 2668, 7627, 16063, 588, 9838, 2668, 22657, 6134, 225, 7963, 273, 5378, 6865, 273, 5378, 1026, 29959, 87, 273, 5378, 9006, 273, 599, 468, 14676, 501, 628, 2151, 364, 12891, 2159, 316, 12891, 4690, 30, 3273, 273, 12891, 2159, 18, 588, 2668, 22657, 768, 16063, 4939, 2668, 1093, 25146, 20, 65, 290, 14937, 273, 12891, 2159, 18, 588, 9838, 2668, 7466, 6134, 364, 3179, 316, 290, 14937, 30, 619, 16, 677, 16, 998, 273, 3179, 18, 588, 2668, 5732, 16063, 4939, 1435, 6865, 18, 6923, 3816, 5659, 12, 92, 3631, 1431, 12, 93, 3631, 1431, 12, 94, 13, 5717, 7963, 18, 6923, 12, 7175, 13, 1026, 29959, 8134, 273, 997, 18, 18644, 2668, 759, 1969, 29959, 19, 955, 1435, 6134, 225, 364, 1026, 29959, 316, 1026, 29959, 8134, 30, 619, 16, 677, 16, 998, 273, 1026, 29959, 18, 4939, 1435, 1026, 29959, 87, 18, 6923, 3816, 5659, 12, 92, 13, 380, 17980, 7256, 16, 1431, 12, 93, 13, 380, 17980, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 855, 67, 10075, 305, 310, 12, 768, 2603, 16, 770, 29711, 21, 4672, 3536, 7483, 3695, 628, 15702, 2025, 585, 18, 225, 7012, 12181, 17041, 294, 1387, 733, 1387, 4110, 628, 1492, 501, 1410, 506, 855, 4673, 1472, 300, 18753, 770, 294, 3571, 300, 21, 2288, 1399, 316, 333, 4471, 3536, 628, 328, 2902, 1930, 12031, 487, 4518, 468, 2670, 585, 1368, 930, 2151, 997, 273, 4518, 18, 2670, 12, 768, 2603, 13, 1365, 273, 997, 18, 588, 3085, 1435, 12891, 4690, 273, 1365, 18, 4720, 2668, 7627, 16063, 588, 9838, 2668, 22657, 6134, 225, 7963, 273, 5378, 6865, 273, 5378, 1026, 29959, 87, 273, 5378, 9006, 273, 599, 468, 14676, 501, 628, 2151, 364, 12891, 2159, 316, 2 ]
for work in works:
for work in works.values():
def write_machine_tags(ln, books): key_to_nyt = {} for book in books: for work in book['ol:works']: key_to_nyt[work] = book['nyt'] works = OL.get_many(list(set(key_to_nyt.keys()))) write = {} for work in works: nyt = key_to_nyt[work['key']] tags = ("New York Times bestseller", "nyt:%s=%s" % ("_".join([s.lower() for s in ln.split()]), nyt['bestsellers_date'])) if 'subjects' not in work: work['subjects'] = list(tags) write[work['key']] = work else: for tag in tags: if tag not in work['subjects']: work['subjects'].append(tag) write[work['key']] = work if work['key'] not in write: LOG("INFO", "all tags already present, skipping %s: '%s' by %s" % ( work['key'], nyt['book_details'][0]['title'], nyt['book_details'][0]['author'] )) else: LOG("DEBUG", "Adding tags (%s) to %s" % (", ".join(tags), work['key'])) LOG("INFO", "WRITING MACHINE TAGS FOR %s of %s works" % ( len(write), len(books) )) if write: OL.save_many(write.values(), comment="Adding tags to New York Times %s bestsellers" % ln)
b571c06cf25ebbfeedc3dfb8e65b86da27cffbca /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/3913/b571c06cf25ebbfeedc3dfb8e65b86da27cffbca/nyt_bestsellers_bot.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1045, 67, 9149, 67, 4156, 12, 2370, 16, 6978, 87, 4672, 498, 67, 869, 67, 18538, 88, 273, 2618, 364, 6978, 316, 6978, 87, 30, 364, 1440, 316, 6978, 3292, 355, 30, 18597, 3546, 30, 498, 67, 869, 67, 18538, 88, 63, 1252, 65, 273, 6978, 3292, 18538, 88, 3546, 225, 6330, 273, 531, 48, 18, 588, 67, 9353, 12, 1098, 12, 542, 12, 856, 67, 869, 67, 18538, 88, 18, 2452, 1435, 20349, 1045, 273, 2618, 364, 1440, 316, 6330, 18, 2372, 13332, 15308, 88, 273, 498, 67, 869, 67, 18538, 88, 63, 1252, 3292, 856, 3546, 65, 2342, 273, 7566, 1908, 1624, 778, 399, 4485, 3796, 1786, 749, 3113, 315, 18538, 88, 5319, 87, 5095, 87, 6, 738, 7566, 9548, 18, 5701, 3816, 87, 18, 8167, 1435, 364, 272, 316, 7211, 18, 4939, 1435, 65, 3631, 15308, 88, 3292, 12729, 87, 1165, 414, 67, 712, 3546, 3719, 309, 296, 7857, 87, 11, 486, 316, 1440, 30, 1440, 3292, 7857, 87, 3546, 273, 666, 12, 4156, 13, 1045, 63, 1252, 3292, 856, 3546, 65, 273, 1440, 469, 30, 364, 1047, 316, 2342, 30, 309, 1047, 486, 316, 1440, 3292, 7857, 87, 3546, 30, 1440, 3292, 7857, 87, 29489, 6923, 12, 2692, 13, 1045, 63, 1252, 3292, 856, 3546, 65, 273, 1440, 309, 1440, 3292, 856, 3546, 486, 316, 1045, 30, 2018, 2932, 5923, 3113, 315, 454, 2342, 1818, 3430, 16, 14195, 738, 87, 30, 1995, 87, 11, 635, 738, 87, 6, 738, 261, 1440, 3292, 2 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1045, 67, 9149, 67, 4156, 12, 2370, 16, 6978, 87, 4672, 498, 67, 869, 67, 18538, 88, 273, 2618, 364, 6978, 316, 6978, 87, 30, 364, 1440, 316, 6978, 3292, 355, 30, 18597, 3546, 30, 498, 67, 869, 67, 18538, 88, 63, 1252, 65, 273, 6978, 3292, 18538, 88, 3546, 225, 6330, 273, 531, 48, 18, 588, 67, 9353, 12, 1098, 12, 542, 12, 856, 67, 869, 67, 18538, 88, 18, 2452, 1435, 20349, 1045, 273, 2618, 364, 1440, 316, 6330, 18, 2372, 13332, 15308, 88, 273, 498, 67, 869, 67, 18538, 88, 63, 1252, 3292, 856, 3546, 65, 2342, 273, 7566, 1908, 1624, 778, 399, 4485, 3796, 1786, 749, 3113, 315, 18538, 88, 5319, 87, 5095, 87, 2 ]
cr.execute('select distinct product_id from stock_move where (location_id=%s) or (location_dest_id=%s)',(id,id))
cr.execute('select distinct product_id from stock_move where (location_id=%s) or (location_dest_id=%s)', (id, id))
def product_detail(self, cr, uid, id, field, context={}): res = {} res[id] = {} final_value = 0.0 field_to_read = 'virtual_available' if field == 'stock_real_value': field_to_read = 'qty_available' cr.execute('select distinct product_id from stock_move where (location_id=%s) or (location_dest_id=%s)',(id,id)) result = cr.dictfetchall() if result: for r in result: c = (context or {}).copy() c['location'] = id product = self.pool.get('product.product').read(cr, uid, r['product_id'], [field_to_read,'standard_price'], context=c) final_value += (product[field_to_read] * product['standard_price']) return final_value
369221b47101072e094ad2d02fe2edd2b47690aa /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/7397/369221b47101072e094ad2d02fe2edd2b47690aa/stock.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3017, 67, 8992, 12, 2890, 16, 4422, 16, 4555, 16, 612, 16, 652, 16, 819, 12938, 4672, 400, 273, 2618, 400, 63, 350, 65, 273, 2618, 727, 67, 1132, 273, 374, 18, 20, 652, 67, 869, 67, 896, 273, 296, 12384, 67, 5699, 11, 309, 652, 422, 296, 15381, 67, 7688, 67, 1132, 4278, 652, 67, 869, 67, 896, 273, 296, 85, 4098, 67, 5699, 11, 4422, 18, 8837, 2668, 4025, 10217, 3017, 67, 350, 628, 12480, 67, 8501, 1625, 261, 3562, 67, 350, 5095, 87, 13, 578, 261, 3562, 67, 10488, 67, 350, 5095, 87, 13, 2187, 261, 350, 16, 612, 3719, 563, 273, 4422, 18, 1576, 5754, 454, 1435, 309, 563, 30, 364, 436, 316, 563, 30, 276, 273, 261, 2472, 578, 2618, 2934, 3530, 1435, 276, 3292, 3562, 3546, 273, 612, 3017, 273, 365, 18, 6011, 18, 588, 2668, 5896, 18, 5896, 16063, 896, 12, 3353, 16, 4555, 16, 436, 3292, 5896, 67, 350, 17337, 306, 1518, 67, 869, 67, 896, 11189, 10005, 67, 8694, 17337, 819, 33, 71, 13, 727, 67, 1132, 1011, 261, 5896, 63, 1518, 67, 869, 67, 896, 65, 380, 3017, 3292, 10005, 67, 8694, 19486, 327, 727, 67, 1132, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3017, 67, 8992, 12, 2890, 16, 4422, 16, 4555, 16, 612, 16, 652, 16, 819, 12938, 4672, 400, 273, 2618, 400, 63, 350, 65, 273, 2618, 727, 67, 1132, 273, 374, 18, 20, 652, 67, 869, 67, 896, 273, 296, 12384, 67, 5699, 11, 309, 652, 422, 296, 15381, 67, 7688, 67, 1132, 4278, 652, 67, 869, 67, 896, 273, 296, 85, 4098, 67, 5699, 11, 4422, 18, 8837, 2668, 4025, 10217, 3017, 67, 350, 628, 12480, 67, 8501, 1625, 261, 3562, 67, 350, 5095, 87, 13, 578, 261, 3562, 67, 10488, 67, 350, 5095, 87, 13, 2187, 261, 350, 16, 612, 3719, 563, 273, 4422, 18, 1576, 5754, 454, 1435, 309, 563, 30, 364, 436, 316, 563, 2 ]
return set([self.target, None])
return cellset(sure=[self.target], others=False)
def prereferences(self): return set([self.target, None])
71e0598bb7dc6d9b90f66161eeb283e8ddccc073 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/2040/71e0598bb7dc6d9b90f66161eeb283e8ddccc073/esotope-bfc.py
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 30328, 2980, 12, 2890, 4672, 327, 444, 3816, 2890, 18, 3299, 16, 599, 5717, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 30328, 2980, 12, 2890, 4672, 327, 444, 3816, 2890, 18, 3299, 16, 599, 5717, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]